| Revision as of 19:39, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 451222048 of page ATC-0175 for the Chem/Drugbox validation project (updated: ''). |
Latest revision as of 12:08, 25 March 2024 edit DMacks (talk | contribs)Edit filter managers, Autopatrolled, Administrators186,428 edits auto mw |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
| verifiedrevid = 434886635 |
|
| verifiedrevid = 477236709 |
|
| IUPAC_name = N-amino)cyclohexyl]-3,4-difluorobenzamide |
|
| IUPAC_name = ''N''-amino)cyclohexyl]-3,4-difluorobenzamide |
|
| image = ATC-0175_structure.png |
|
| image = ATC-0175_structure.png |
|
|
|
|
| Line 15: |
Line 15: |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
| Line 22: |
Line 22: |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number = |
|
| IUPHAR_ligand = 1305 |
|
|
| CAS_number = 509118-03-0 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 539503G9M0 |
|
| ATC_prefix = |
|
| ATC_prefix = |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
| PubChem = |
|
| PubChem = 9934033 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
| Line 36: |
Line 39: |
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=23 | H=25 | F=2 | N=5 | O=1 |
|
| C=23 | H=25 | F=2 | N=5 | O=1 |
|
| molecular_weight = 425.473 |
|
|
| smiles = Fc1ccc(cc1F)C(=O)NC3CCC(CC3)Nc(nc4N(C)C)nc2ccccc24 |
|
| smiles = Fc1ccc(cc1F)C(=O)NC3CCC(CC3)Nc(nc4N(C)C)nc2ccccc24 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| Line 43: |
Line 45: |
|
| StdInChIKey = FAIMGWSOSCFGRU-UHFFFAOYSA-N |
|
| StdInChIKey = FAIMGWSOSCFGRU-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''ATC-0175''' is a drug used in scientific research, which is a selective, non-peptide ] at the ] ] ]. In animal studies it has been shown to produce both ] and ] actions, but without ] or ] side effects.<ref name="pmid15677346">{{cite journal |vauthors=Chaki S, Funakoshi T, Hirota-Okuno S, Nishiguchi M, Shimazaki T, Iijima M, Grottick AJ, Kanuma K, Omodera K, Sekiguchi Y, Okuyama S, Tran TA, Semple G, Thomsen W |title=Anxiolytic- and antidepressant-like profile of ATC0065 and ATC0175: nonpeptidic and orally active melanin-concentrating hormone receptor 1 antagonists |journal=The Journal of Pharmacology and Experimental Therapeutics |volume=313 |issue=2 |pages=831–9 |date=May 2005 |pmid=15677346 |doi=10.1124/jpet.104.081711 |s2cid=23023526 }}</ref><ref name="pmid16002290">{{cite journal |vauthors=Kanuma K, Omodera K, Nishiguchi M, Funakoshi T, Chaki S, Semple G, Tran TA, Kramer B, Hsu D, Casper M, Thomsen B, Sekiguchi Y |title=Lead optimization of 4-(dimethylamino)quinazolines, potent and selective antagonists for the melanin-concentrating hormone receptor 1 |journal=Bioorganic & Medicinal Chemistry Letters |volume=15 |issue=17 |pages=3853–6 |date=September 2005 |pmid=16002290 |doi=10.1016/j.bmcl.2005.05.121 }}</ref><ref name="pmid16614734">{{cite journal |vauthors=Chaki S, Yamaguchi J, Yamada H, Thomsen W, Tran TA, Semple G, Sekiguchi Y |title=ATC0175: an orally active melanin-concentrating hormone receptor 1 antagonist for the potential treatment of depression and anxiety |journal=CNS Drug Reviews |volume=11 |issue=4 |pages=341–52 |year=2005 |pmid=16614734 |doi= 10.1111/j.1527-3458.2005.tb00052.x|pmc=6741758 }}</ref> |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
{{Anxiolytics}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{Anxiolytic-stub}} |