Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Acedoben: Difference between pages - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
(Difference between pages)
Page 1
Page 2
Content deleted Content addedVisualWikitext
Revision as of 19:45, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 457799411 of page Acedoben for the Chem/Drugbox validation project (updated: 'StdInChI', 'CASNo').  Latest revision as of 00:20, 23 April 2021 edit LegionMammal978 (talk | contribs)Extended confirmed users7,894 edits move PIN 
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{chembox
| Verifiedfields = changed | Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 457798495 | verifiedrevid = 477237964
⚫ | UNII_Ref = {{fdacite|correct|FDA}}
⚫ | Reference = <ref>{{Cite web | url = http://www.sigmaaldrich.com/catalog/product/aldrich/133337 | publisher = ] | title = 4-Acetamidobenzoic acid}}</ref><ref>, ChemIndustry.com</ref>
⚫ | UNII = 04Z20NMK31
⚫ | ImageFile = Acedoben.png
⚫ |Reference=<ref> at ]</ref><ref>, ChemIndustry.com</ref>
⚫ | ImageName = Skeletal formula
⚫ | ImageFile = Acedoben.png
⚫ | ImageFile1 = Acedoben-3D-balls.png
⚫ | ImageName = Skeletal formula
⚫ | ImageName1 = Ball-and-stick model
⚫ | ImageFile1 = Acedoben-3D-balls.png
| PIN = 4-Acetamidobenzoic acid
⚫ | ImageName1 = Ball-and-stick model
|IUPACName=4-Acetamidobenzoic acid | OtherNames = ''N''-Acetyl-PABA; 4-Carboxyacetanilide; ''p''-Acetamidobenzoic acid
|OtherNames=''N''-Acetyl-PABA; 4-Carboxyacetanilide; ''p''-Acetamidobenzoic acid
''p''-Acetaminobenzoic acid; PAAB; ''p''-Acetoaminobenzoic acid ''p''-Acetaminobenzoic acid; PAAB; ''p''-Acetoaminobenzoic acid
|Section1={{Chembox Identifiers |Section1={{Chembox Identifiers
| InChI1 = 1S/C9H9NO3/c1-6(11)10-8-4-2-7(3-5-8)9(12)13/h2-5H,1H3,(H,10,11)(H,12,13) | InChI1 = 1S/C9H9NO3/c1-6(11)10-8-4-2-7(3-5-8)9(12)13/h2-5H,1H3,(H,10,11)(H,12,13)
| InChIKey1 = QCXJEYYXVJIFCE-UHFFFAOYSA-N | InChIKey1 = QCXJEYYXVJIFCE-UHFFFAOYSA-N
| SMILES1 = O=C(Nc1ccc(cc1)C(=O)O)C | SMILES1 = O=C(Nc1ccc(cc1)C(=O)O)C
| CASNo_Ref = {{cascite|changed|??}} | CASNo_Ref = {{cascite|changed|??}}
| CASNo = <!-- blanked - oldvalue: 556-08-1 --> | CASNo = 556-08-1
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 112687 | ChEMBL = 112687
| PubChem=19266 | PubChem = 19266
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 18177 | ChemSpiderID = 18177
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB04500 | DrugBank = DB04500
| SMILES = O=C(Nc1ccc(cc1)C(=O)O)C | SMILES = O=C(Nc1ccc(cc1)C(=O)O)C
| InChI = 1/C9H9NO3/c1-6(11)10-8-4-2-7(3-5-8)9(12)13/h2-5H,1H3,(H,10,​11)(H,12,13) | InChI = 1/C9H9NO3/c1-6(11)10-8-4-2-7(3-5-8)9(12)13/h2-5H,1H3,(H,10,11)(H,12,13)
| InChIKey = QCXJEYYXVJIFCE-UHFFFAOYAT | InChIKey = QCXJEYYXVJIFCE-UHFFFAOYAT
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C9H9NO3/c1-6(11)10-8-4-2-7(3-5-8)9(12)13/h2-5H,1H3,(H,10,11)(H,12,13) | StdInChI = 1S/C9H9NO3/c1-6(11)10-8-4-2-7(3-5-8)9(12)13/h2-5H,1H3,(H,10,11)(H,12,13)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = QCXJEYYXVJIFCE-UHFFFAOYSA-N | StdInChIKey = QCXJEYYXVJIFCE-UHFFFAOYSA-N
| SMILES=CC(=O)NC1=CC=C(C=C1)C(=O)O | SMILES2 = CC(=O)NC1=CC=C(C=C1)C(=O)O
⚫ | UNII_Ref = {{fdacite|correct|FDA}}
⚫ }}
⚫ | UNII = 04Z20NMK31
⚫ }}
|Section2={{Chembox Properties |Section2={{Chembox Properties
| C=9|H=9|N=1|O=3 | C=9|H=9|N=1|O=3
| Appearance= | Appearance =
| Density= | Density =
| MeltingPt=259-262 °C (dec.) | MeltingPtC = 259 to 262
| MeltingPt_notes = (dec.)
| BoilingPt=
| BoilingPt =
| Solubility=
| Solubility =
}} }}
|Section3={{Chembox Hazards |Section3={{Chembox Hazards
| MainHazards= | MainHazards =
| FlashPt= | FlashPt =
| AutoignitionPt =
| Autoignition=
}} }}
}} }}

'''Acedoben''' (4-acetamidobenzoic acid or N-]-]) is a ] with the ] of C<sub>9</sub>H<sub>9</sub>NO<sub>3</sub>. It is the ] derivative of ] (PABA).

Acedoben, as a ] with ], is a component of some pharmaceutical preparations such as ].

==See also==
* ] is an ] of this compound

==References==
{{reflist}}

]
]