| Revision as of 08:23, 6 April 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits removed Category:Alkylbenzenes using HotCat |
Latest revision as of 13:33, 12 March 2022 edit DMacks (talk | contribs)Edit filter managers, Autopatrolled, Administrators186,370 edits Discuss related |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{Chembox |
|
| verifiedrevid = 400096210 |
|
| verifiedrevid = 422660536 |
|
| ImageFile = Fuchsine acid.png |
|
| ImageFile = Acid fuchsin.svg |
|
| ImageSize = |
|
| ImageSize = 200px |
|
|
| IUPACName = Disodium 2-amino-5--3-methylbenzenesulfonate |
|
| IUPACName = |
|
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
⚫ |
| CASNo = 3244-88-0 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 8RA6L21QTM |
|
⚫ |
| PubChem = 5464362 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 16736101 |
|
| ChemSpiderID = 16736101 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 87052 |
|
|
| EC_number = 221-816-5 |
|
|
| SMILES = CC1=CC(=CC(=C1N)S(=O)(=O))/C(=C\2/C=CC(=)C(=C2)S(=O)(=O))/C3=CC(=C(C=C3)N)S(=O)(=O).. |
|
| InChI = 1/C20H19N3O9S3.2Na/c1-10-6-13(9-18(20(10)23)35(30,31)32)19(11-2-4-14(21)16(7-11)33(24,25)26)12-3-5-15(22)17(8-12)34(27,28)29;;/h2-9,21H,22-23H2,1H3,(H,24,25,26)(H,27,28,29)(H,30,31,32);;/q;2*+1/p-2/b19-11-,21-14?;; |
|
| InChI = 1/C20H19N3O9S3.2Na/c1-10-6-13(9-18(20(10)23)35(30,31)32)19(11-2-4-14(21)16(7-11)33(24,25)26)12-3-5-15(22)17(8-12)34(27,28)29;;/h2-9,21H,22-23H2,1H3,(H,24,25,26)(H,27,28,29)(H,30,31,32);;/q;2*+1/p-2/b19-11-,21-14?;; |
|
| InChIKey = RZUBARUFLYGOGC-LOQRZINWBG |
|
| InChIKey = RZUBARUFLYGOGC-LOQRZINWBG |
| Line 14: |
Line 23: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = RZUBARUFLYGOGC-MTHOTQAESA-L |
|
| StdInChIKey = RZUBARUFLYGOGC-MTHOTQAESA-L |
| ⚫ |
| CASNo = 3244-88-0 |
|
| ⚫ |
| PubChem = |
|
|
| SMILES = ..O=S()(=O)C\1=C\C(\C=C/C/1=)=C(\c2ccc(N)c(c2)S()(=O)=O)c3cc(c(N)c(C)c3)S()(=O)=O |
|
| ⚫ |
}} |
|
|
| Section2 = {{Chembox Properties |
|
|
| Formula = C<sub>20</sub>H<sub>17</sub>N<sub>3</sub>Na<sub>2</sub>O<sub>9</sub>S<sub>3</sub> |
|
|
| MolarMass = 585.538 g/mol |
|
|
| Appearance = |
|
|
| Density = |
|
|
| MeltingPt = |
|
| ⚫ |
| BoilingPt = |
|
| ⚫ |
| Solubility = |
|
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section2={{Chembox Properties |
|
|
| C=20 | H=17 | N=3 | Na=2 | O=9 | S=3 |
| ⚫ |
| MainHazards = |
|
|
| FlashPt = |
|
| Density = |
|
| Autoignition = |
|
| MeltingPt = |
|
⚫ |
| BoilingPt = |
|
⚫ |
| Solubility = |
|
|
}} |
|
|
|Section3={{Chembox Hazards |
|
⚫ |
| MainHazards = |
|
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
|
| GHSPictograms = {{GHS07}} |
|
|
| GHSSignalWord = Warning |
|
|
| HPhrases = {{H-phrases|315|319|335}} |
|
|
| PPhrases = {{P-phrases|261|264|271|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|403+233|405|501}} |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
|
'''Acid fuchsin''' or '''fuchsine acid''', (also called '''Acid Violet 19'''<ref name="Lillie, 1977" /> and '''] 42685'''<ref name="Lillie, 1977" />) is an ]ic ] ] with the ] C<sub>20</sub>H<sub>17</sub>N<sub>3</sub>Na<sub>2</sub>O<sub>9</sub>S<sub>3</sub>. It is a sodium ] derivative of ]. Acid fuchsin has wide use in ],<ref name="Lillie, 1977" /> and is one of the dyes used in ].<ref>Jocelyn H. Bruce-Gregorios, M.D.: Histopathologic Techniques, JMC Press Inc., Quezon City, Philippines, 1974. {{ISBN|971-11-0853-4}}</ref> This method is commonly used to stain ] and nuclei of tissue sections in the histology laboratory in order to distinguish muscle from ]. The muscle stains red with the acid fuchsin, and the collagen is stained green or blue with ] or ]. It can also be used to identify growing bacteria.<ref>{{cite journal|title=The use of Decolorized Acid Fuchsin as an Acid Indicator in Carbohydrate Fermentation Tests with some Remarks on Acid Production by Bacteria|journal=Journal of Infectious Diseases|volume=15|pages=227–233|doi=10.1093/infdis/15.1.227|year=1914|last1=Holman|first1=W. L|url=https://zenodo.org/record/2508513}}</ref> |
|
'''Fuchsine acid''' is an ]ic ] ] with ] C<sub>20</sub>H<sub>17</sub>N<sub>3</sub>Na<sub>2</sub>O<sub>9</sub>S<sub>3</sub>. |
|
|
|
|
|
|
==See also== |
|
== See also == |
|
* ] |
|
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
|
* ] |
|
|
* ] (Alexander's stain) |
|
|
|
|
|
==External links== |
|
==References== |
|
|
{{Reflist|refs= |
|
|
|
|
|
|
<ref name="Lillie, 1977">{{cite book |last1=Lillie |first1=Ralph Dougall |title=H. J. Conn's Biological stains |date=1977 |publisher=Williams & Wilkins |location=Baltimore |pages=692 |edition=9th}}</ref> |
|
⚫ |
}} |
|
⚫ |
{{organic-compound-stub}} |
|
|
|
|
⚫ |
] |
|
] |
|
] |
|
|
] |
|
] |
|
] |
| ⚫ |
] |
|
|
|
|
|
|
|
| ⚫ |
{{organic-compound-stub}} |
|
|
|
|
|
] |
|