| Revision as of 20:02, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 464942404 of page Acrisorcin for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number'). |
Latest revision as of 13:34, 30 January 2023 edit Entranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers170,249 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| image = Acrisorcin.png |
|
| image = Acrisorcin.png |
|
| verifiedrevid = 457803415 |
|
| verifiedrevid = 477241233 |
|
|
|
|
<!--Combo data--> |
|
<!--Combo data--> |
|
| type = combo |
|
| type = combo |
|
| component1 = 9-Aminoacridine |
|
| component1 = 9-Aminoacridine |
|
| class1 = |
|
| class1 = ] |
|
| component2 = 4-Hexylresorcinol |
|
| component2 = 4-Hexylresorcinol |
|
| class2 = ] |
|
| class2 = Antiseptic |
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 7527-91-5 --> |
|
| CAS_number = 7527-91-5 |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
| PubChem = 24144 |
|
| PubChem = 24144 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 22568 |
|
| ChemSpiderID = 22568 |
| Line 39: |
Line 37: |
|
| KEGG = D02759 |
|
| KEGG = D02759 |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL = <!-- blanked - oldvalue: 1201038 --> |
|
| ChEMBL = 1201038 |
|
|
<!--Chemical data--> |
|
| smiles = Oc1cc(O)c(cc1)CCCCCC.n1c3c(c(c2c1cccc2)N)cccc3 |
|
|
| InChI = 1/C13H10N2.C12H18O2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;1-2-3-4-5-6-10-7-8-11(13)9-12(10)14/h1-8H,(H2,14,15);7-9,13-14H,2-6H2,1H3 |
|
|
| InChIKey = YZODJQFXMFEJRM-UHFFFAOYAT |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C13H10N2.C12H18O2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;1-2-3-4-5-6-10-7-8-11(13)9-12(10)14/h1-8H,(H2,14,15);7-9,13-14H,2-6H2,1H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChIKey = YZODJQFXMFEJRM-UHFFFAOYSA-N |
|
|
}} |
|
}} |
|
|
|
|
|
'''Acrisorcin''' is a topical anti-infective typically used as a ].<ref>{{Cite web|url=https://pubchem.ncbi.nlm.nih.gov/compound/24144|title=Acrisorcin| work = PubChem | publisher = U.S. National Library of Medicine |language=en|access-date=2019-03-26}}</ref> It is a combination of the active ingredients ] and ].<ref>{{Cite web|url=https://echa.europa.eu/substance-information/-/substanceinfo/100.028.536|title=Acrisorcin - Substance Information | publisher = European Chemicals Agency (ECHA) |language=en-GB|access-date=2019-03-26}}</ref> |
|
|
|
|
|
__TOC__ |
|
|
==History== |
|
|
|
|
|
Acrisorcin was marketed as a cream under the trade name '''Akrinol''', which has since been discontinued. It was developed at ] in 1961.<ref name="JAMA">{{cite journal | vauthors = <!-- No authors listed -->| title = A new agent for the control of tinea versicolor. Acrisorcin (Akrinol) | journal = JAMA | volume = 196 | issue = 11 | pages = 1010 | date = June 1966 | pmid = 5952419 | doi = 10.1001/jama.1966.03100240144035 }}</ref> |
|
|
|
|
|
==Indications== |
|
|
|
|
|
Acrisorcin was used to combat ].<ref name="JAMA" /> |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{antimicrobial-stub}} |