| Revision as of 20:05, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 457804847 of page Actinonin for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 10:41, 2 January 2024 edit Artoria2e5 (talk | contribs)Extended confirmed users, IP block exemptions34,342 edits HONH-Val-Pro-OH |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Chembox |
|
{{Chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 457803727 |
|
| verifiedrevid = 477241675 |
|
| ImageFile = Actinonin.svg |
|
| ImageFile = Actinonin.svg |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| IUPACName = (2''R'')-''N''<sup>4</sup>-hydroxy-''N''<sup>1</sup>-{(2''S'')-1--3-methyl-1-oxobutan-2-yl}-2-pentylbutanediamide |
|
| PIN = (2''R'')-''N''<sup>4</sup>-Hydroxy-''N''<sup>1</sup>-{(2''S'')-1--3-methyl-1-oxobutan-2-yl}-2-pentylbutanediamide |
|
| OtherNames = |
|
| OtherNames = HONH-Val-Pro-OH (IUPAC peptide linear) |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo = <!-- blanked - oldvalue: 13434-13-4 --> |
|
| CASNo = 13434-13-4 |
|
| CASNo_Ref = {{cascite|changed|??}}= {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem = 443600 |
|
|
|
| UNII = P18SPA8N0K |
|
⚫ |
| PubChem = 443600 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 308333 |
|
| ChEMBL = 308333 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 391756 |
|
| ChemSpiderID = 391756 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB04310 |
|
| DrugBank = DB04310 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| Line 22: |
Line 23: |
|
| StdInChIKey = XJLATMLVMSFZBN-VYDXJSESSA-N |
|
| StdInChIKey = XJLATMLVMSFZBN-VYDXJSESSA-N |
|
| SMILES = O=C(N1(CO)CCC1)(NC(=O)(CCCCC)CC(=O)NO)C(C)C |
|
| SMILES = O=C(N1(CO)CCC1)(NC(=O)(CCCCC)CC(=O)NO)C(C)C |
|
| InChI = InChI=1S/C19H35N3O5/c1-4-5-6-8-14(11-16(24)21-27)18(25)20-17(13(2)3)19(26)22-10-7-9-15(22)12-23/h13-15,17,23,27H,4-12H2,1-3H3,(H,20,25)(H,21,24)/t14-,15+,17+/m1/s1 |
|
| InChI = InChI=1S/C19H35N3O5/c1-4-5-6-8-14(11-16(24)21-27)18(25)20-17(13(2)3)19(26)22-10-7-9-15(22)12-23/h13-15,17,23,27H,4-12H2,1-3H3,(H,20,25)(H,21,24)/t14-,15+,17+/m1/s1 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=19 | H=35 | N=3 | O=5 |
|
| C=19 | H=35 | N=3 | O=5 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
'''Actinonin''' is a naturally occurring ] that has demonstrated ] activity.<ref>{{cite journal | last1 = Chen | first1 = D.Z. | last2 = Patel | first2 = D.V. | title = Actinonin, a Naturally Occurring Antibacterial Agent, Is a Potent Deformylase Inhibitor | journal = Biochemistry | volume = 39 | pages = 1256–62 | year = 2000 | doi = 10.1021/bi992245y | pmid=10684604 | issue=6}}</ref> |
|
|
|
|
|
Actiononin has been shown to inhibit the ] ], which is essential in ].<ref>{{Cite journal|last1=Yoon|first1=Hye-Jin|last2=Kim|first2=Hye Lee|last3=Lee|first3=Soo-Kyoung|last4=Kim|first4=Hyun-Woo|last5=Kim|first5=Hyung-Wook|last6=Lee|first6=Jae Young|last7=Mikami|first7=Bunzo|last8=Suh|first8=Se Won|date=2004|title=Crystal structure of peptide deformylase from Staphylococcus aureus in complex with actinonin, a naturally occurring antibacterial agent|url=https://onlinelibrary.wiley.com/doi/abs/10.1002/prot.20231|journal=Proteins: Structure, Function, and Bioinformatics|language=en|volume=57|issue=3|pages=639–642|doi=10.1002/prot.20231|pmid=15382235|s2cid=42929776|issn=1097-0134}}</ref> |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
] |
|
|
|
|
|
|
|
|
{{Organic-compound-stub}} |