| Revision as of 20:08, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 449109966 of page Adenophostin for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 00:56, 9 March 2022 edit Fswitzer4 (talk | contribs)Extended confirmed users10,572 editsm Added/Verified UNII and Verified CAS |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 413303492 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|Name=Adenophostin A |
|
|
⚫ |
| verifiedrevid = 477242299 |
| ⚫ |
|ImageFile=Adenophostin.png |
|
|
⚫ |
| Name=Adenophostin A |
| ⚫ |
|ImageSize=200px |
|
|
⚫ |
| ImageFile=Adenophostin.png |
| ⚫ |
|IUPACName= <small>oxy]-5-(hydroxymethyl)-3-tetrahydrofuranyl] dihydrogen phosphate</small> |
|
|
⚫ |
| ImageSize=200px |
| ⚫ |
|OtherNames= |
|
|
⚫ |
| IUPACName= <small>oxy]-5-(hydroxymethyl)-3-tetrahydrofuranyl] dihydrogen phosphate</small> |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
⚫ |
| OtherNames= |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
|Section1={{Chembox Identifiers |
|
|
| IUPHAR_ligand = 4124 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 110268 |
|
| ChemSpiderID = 110268 |
|
| InChI = 1/C16H26N5O18P3/c17-13-7-14(19-3-18-13)21(4-20-7)15-12(39-42(31,32)33)9(5(1-22)34-15)36-16-8(24)11(38-41(28,29)30)10(6(2-23)35-16)37-40(25,26)27/h3-6,8-12,15-16,22-24H,1-2H2,(H2,17,18,19)(H2,25,26,27)(H2,28,29,30)(H2,31,32,33)/t5-,6-,8-,9-,10-,11-,12-,15-,16-/m1/s1 |
|
| InChI = 1/C16H26N5O18P3/c17-13-7-14(19-3-18-13)21(4-20-7)15-12(39-42(31,32)33)9(5(1-22)34-15)36-16-8(24)11(38-41(28,29)30)10(6(2-23)35-16)37-40(25,26)27/h3-6,8-12,15-16,22-24H,1-2H2,(H2,17,18,19)(H2,25,26,27)(H2,28,29,30)(H2,31,32,33)/t5-,6-,8-,9-,10-,11-,12-,15-,16-/m1/s1 |
| Line 14: |
Line 16: |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 204385 |
|
| ChEMBL = 204385 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 2S7AR5SVD7 |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C16H26N5O18P3/c17-13-7-14(19-3-18-13)21(4-20-7)15-12(39-42(31,32)33)9(5(1-22)34-15)36-16-8(24)11(38-41(28,29)30)10(6(2-23)35-16)37-40(25,26)27/h3-6,8-12,15-16,22-24H,1-2H2,(H2,17,18,19)(H2,25,26,27)(H2,28,29,30)(H2,31,32,33)/t5-,6-,8-,9-,10-,11-,12-,15-,16-/m1/s1 |
|
| StdInChI = 1S/C16H26N5O18P3/c17-13-7-14(19-3-18-13)21(4-20-7)15-12(39-42(31,32)33)9(5(1-22)34-15)36-16-8(24)11(38-41(28,29)30)10(6(2-23)35-16)37-40(25,26)27/h3-6,8-12,15-16,22-24H,1-2H2,(H2,17,18,19)(H2,25,26,27)(H2,28,29,30)(H2,31,32,33)/t5-,6-,8-,9-,10-,11-,12-,15-,16-/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = RENVITLQVBEFDT-MZQFDOALSA-N |
|
| StdInChIKey = RENVITLQVBEFDT-MZQFDOALSA-N |
|
| CASNo = <!-- blanked - oldvalue: 149091-92-9 --> |
|
| CASNo=149091-92-9 |
|
| PubChem=123695 |
|
| PubChem=123695 |
|
| SMILES = O=P(O)(O)O4(O1O((OP(=O)(O)O)(OP(=O)(O)O)1O)CO)(O4n2c3ncnc(N)c3nc2)CO |
|
| SMILES = O=P(O)(O)O4(O1O((OP(=O)(O)O)(OP(=O)(O)O)1O)CO)(O4n2c3ncnc(N)c3nc2)CO |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=16 | H=26 | N=5 | O=18 | P=3 |
|
| Formula=C<sub>16</sub>H<sub>26</sub>N<sub>5</sub>O<sub>18</sub>P<sub>3</sub> |
|
|
| MolarMass=669.32 g/mol |
|
| MolarMass=669.32 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Adenophostin''' A is a potent ] (IP<sub>3</sub>) ], but is much more potent than IP<sub>3</sub>. |
|
|
|
|
|
IP<sub>3</sub>R is a ] that plays a central role in modulating ]ic free ] concentration (Ca<sup>2+</sup>i). Adenophostin A is structurally different from IP<sub>3</sub> but could elicit distinct ] in cells.<ref>{{cite journal | last1 = Mak | first1 = D.-O. D. | last2 = McBride | first2 = S | last3 = Foskett | first3 = JK | title = ATP-dependent Adenophostin Activation of Inositol 1,4,5-Trisphosphate Receptor Channel Gating: Kinetic Implications for the Durations of Calcium Puffs in Cells | journal = The Journal of General Physiology | volume = 117 | issue = 4 | pages = 299–314 | year = 2001 | pmid = 11279251 | pmc = 2217258 | doi = 10.1085/jgp.117.4.299 }}</ref> |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{organic-compound-stub}} |