| Revision as of 11:46, 28 October 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo').← Previous edit |
Latest revision as of 14:32, 11 December 2024 edit undoMarbletan (talk | contribs)Extended confirmed users5,350 editsmNo edit summary |
| (43 intermediate revisions by 28 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
|ImageFile=Adenosine diphosphate ribose.svg |
|
|
|
| Watchedfields = changed |
|
|ImageFile2=Adenosine diphosphate ribose 3D.png |
|
|
|
| verifiedrevid = 457804269 |
| ⚫ |
|ImageSize=250px |
|
|
⚫ |
| ImageFile=ADP ribose.svg |
| ⚫ |
|ImageSize2=250px |
|
|
|
| ImageFile1=ADP-ribose 3D.png |
| ⚫ |
|IUPACName= |
|
|
|OtherNames=ADP ribose |
|
| ImageFile2=Three-dimensional model of ADP ribose.png |
|
⚫ |
| ImageSize=250px |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
⚫ |
| ImageSize2=250px |
|
| CASNo = <!-- blanked - oldvalue: 20762-30-5 --> |
|
|
⚫ |
| IUPACName= |
| ⚫ |
| PubChem=192 |
|
|
|
| OtherNames=ADP ribose<br/>ADPR<br />Adenosine 5'-diphosphoribose |
|
| SMILES= |
|
|
⚫ |
|Section1={{Chembox Identifiers |
|
| ChEMBL = <!-- blanked - oldvalue: 1161865 --> |
|
|
|
| CASNo_Ref = {{cascite|changed|??}} |
| ⚫ |
| MeSHName=Adenosine+Diphosphate+Ribose |
|
|
|
| CASNo=20762-30-5 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = XV3S4KV26E |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 1161865 |
|
⚫ |
| MeSHName=Adenosine+Diphosphate+Ribose |
|
⚫ |
| PubChem = 439200 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 388340 |
|
|
| SMILES = O=P(O1O((O)1O)CO)(O)OP(=O)(OC4O(n3c2ncnc(N)c2nc3)(O)4O)O |
|
|
| InChI = 1/C15H23N5O14P2/c16-12-7-13(18-3-17-12)20(4-19-7)14-10(24)9(23)6(31-14)2-30-35(26,27)34-36(28,29)33-15-11(25)8(22)5(1-21)32-15/h3-6,8-11,14-15,21-25H,1-2H2,(H4,16,17,18,26,27,28,29)/p+1/t5-,6+,8-,9+,10+,11-,14+,15+/m0/s1 |
|
|
| InChIKey = YNCNQNWXUFCWJS-LKOYDKQFBH |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C15H23N5O14P2/c16-12-7-13(18-3-17-12)20(4-19-7)14-10(24)9(23)6(31-14)2-30-35(26,27)34-36(28,29)33-15-11(25)8(22)5(1-21)32-15/h3-6,8-11,14-15,21-25H,1-2H2,(H4,16,17,18,26,27,28,29)/p+1/t5-,6+,8-,9+,10+,11-,14+,15+/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = YNCNQNWXUFCWJS-DKMYFHGXSA-O |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=15 | H=23 | N=5 | O=14 | P=2 |
|
| Formula=C<sub>15</sub>H<sub>23</sub>N<sub>5</sub>O<sub>14</sub>P<sub>2</sub> |
|
|
| MolarMass=559.316 g/mol |
|
| MolarMass=559.316 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Adenosine diphosphate ribose''' is a molecule formed into chains by the enzyme ]. It binds to and activates the ] ion channel.<ref name="pmid15302683">{{cite journal |author=Fonfria E, Marshall IC, Benham CD, ''et al'' |title=TRPM2 channel opening in response to oxidative stress is dependent on activation of poly(ADP-ribose) polymerase |journal=Br. J. Pharmacol. |volume=143 |issue=1 |pages=186–92 |year=2004 |month=September |pmid=15302683 |pmc=1575275 |doi=10.1038/sj.bjp.0705914 |url=}}</ref> |
|
'''Adenosine diphosphate ribose''' ('''ADPR''') is an ] molecule formed into chains by the enzyme ].<ref name="pmid29634344">{{cite journal | vauthors = Braidy N, Berg J, Clement J, Sachdev P | title = Role of Nicotinamide Adenine Dinucleotide and Related Precursors as Therapeutic Targets for Age-Related Degenerative Diseases: Rationale, Biochemistry, Pharmacokinetics, and Outcomes | journal = ] | volume = 10 | issue = 2 | pages = 251–294 | date=2019 | doi = 10.1089/ars.2017.7269 | pmc =6277084 | pmid = 29634344}}</ref> ADPR is created from ] (cADPR) by the ] enzyme using ] (NAD<sup>+</sup>) as a ].<ref name="pmid29634344" /> |
|
|
|
|
|
ADPR binds to and activates the ] ion channel.<ref name="pmid15302683">{{cite journal |vauthors =Fonfria E, Marshall IC, Benham CD |title=TRPM2 channel opening in response to oxidative stress is dependent on activation of poly(ADP-ribose) polymerase |journal=Br. J. Pharmacol. |volume=143 |issue=1 |pages=186–92 |date=September 2004|pmid=15302683 |pmc=1575275 |doi=10.1038/sj.bjp.0705914 |display-authors=etal}}</ref> ADPR is the most potent ] of the TRPM2 channel.<ref name="pmid33092205">{{cite journal | vauthors = Yu P, Cai X, Liang Y, Yang W | title = Roles of NAD + and Its Metabolites Regulated Calcium Channels in Cancer | journal = ] | volume = 25 | issue = 20 | pages = 4826 | date=2019 | doi = 10.3390/molecules25204826 | pmc =7587972 | pmid = 33092205 | doi-access = free }}</ref> cADPR also binds to TPRM2, and the action of both molecules is ], with both molecules enhancing the action of the other molecule in activating the TRPM2 channel.<ref name="pmid21786193">{{cite journal | author = Lee HC | title = Cyclic ADP-ribose and NAADP: fraternal twin messengers for calcium signaling | journal = Science China Life Sciences | volume = 54 | issue = 8 | pages = 699–711 | date=2011 | doi = 10.1007/s11427-011-4197-3 | pmid = 21786193| s2cid = 24286381 | doi-access = free }}</ref> Researchers are not sure how the Adenosine diphosphate reacts with the TRPM2 channel, but the ribose sugar may play a role in activating the ] ion channel.<ref>{{cite journal | doi = 10.1021/acs.joc.9b00338 | title = Synthesis of Terminal Ribose Analogues of Adenosine 5′-Diphosphate Ribose as Probes for the Transient Receptor Potential Cation Channel TRPM2 | date = 2019 | last1 = Baszczyňski | first1 = Ondřej | last2 = Watt | first2 = Joanna M. | last3 = Rozewitz | first3 = Monika D. | last4 = Guse | first4 = Andreas H. | last5 = Fliegert | first5 = Ralf | last6 = Potter | first6 = Barry V. L. | journal = The Journal of Organic Chemistry | volume = 84 | issue = 10 | pages = 6143–6157 | pmid = 30978018 | pmc = 6528165 }}</ref> |
|
|
|
|
|
Researchers believe that co-targeting DNA-dependent protein kinase and poly(adenosine diphosphate-ribose) polymerase-1 does not promote apoptosis or mitotic catastrophe of cancer cells after radiation.<ref>{{Cite journal |last1=Azad |first1=Arun |last2=Bukczynska |first2=Patricia |last3=Jackson |first3=Susan |last4=Haput |first4=Ygal |last5=Cullinane |first5=Carleen |last6=McArthur |first6=Grant A. |last7=Solomon |first7=Benjamin |date=2014-02-01 |title=Co-targeting Deoxyribonucleic Acid–Dependent Protein Kinase and Poly(Adenosine Diphosphate-Ribose) Polymerase-1 Promotes Accelerated Senescence of Irradiated Cancer Cells |url=https://www.sciencedirect.com/science/article/abs/pii/S0360301613033026 |journal= International Journal of Radiation Oncology, Biology and Physics |volume=88 |issue=2 |pages=385–394 |doi=10.1016/j.ijrobp.2013.10.043 |pmid=24411611 |issn=0360-3016 |via=Elsevier Science Direct}}</ref> |
|
|
|
|
|
==See also== |
|
==See also== |
|
* ] |
|
* ] |
|
|
* ] |
|
* ] |
|
* ] |
|
|
* ] |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{Reflist}} |
|
|
|
|
|
{{Transient receptor potential channel modulators}} |
|
|
|
|
|
{{DEFAULTSORT:Adenosine Diphosphate Ribose}} |
|
{{DEFAULTSORT:Adenosine Diphosphate Ribose}} |
| Line 42: |
Line 66: |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
{{biochemistry-stub}} |
|
|
|
|
|
] |
|
|
] |
|