Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Adipiodone: Difference between pages - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
(Difference between pages)
Page 1
Page 2
Content deleted Content addedVisualWikitext
Revision as of 20:11, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456550291 of page Adipiodone for the Chem/Drugbox validation project (updated: '').  Latest revision as of 21:15, 8 February 2024 edit VastV0idInSpace0 (talk | contribs)Extended confirmed users2,389 edits References: Fixed spacing between stub template and category templates.Tag: 2017 wikitext editor 
Line 1: Line 1:
{{Short description|Chemical compound}}
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Distinguish|Adipiplon}}
{{Drugbox {{Drugbox
| verifiedrevid = 477242817
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 443657879
| IUPAC_name = 3-{5-pentanamido}-2,4,6-triiodobenzoic acid | IUPAC_name = 3-{5-pentanamido}-2,4,6-triiodobenzoic acid
| image = Adipiodone.png | image = Adipiodone.png
| drug_name = Iodipamide

<!--Clinical data--> <!--Clinical data-->
| tradename = | tradename = Cholografin, Biligrafin
| Drugs.com = {{drugs.com|CONS|iodipamide}} | Drugs.com =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category = | pregnancy_category =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> | legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status = | legal_status = Rx-only
| routes_of_administration = | routes_of_administration =

<!--Pharmacokinetic data--> <!--Pharmacokinetic data-->
| bioavailability = | bioavailability =
| protein_bound = | protein_bound =
| metabolism = | metabolism =
| elimination_half-life = | elimination_half-life =
| excretion = | excretion =

<!--Identifiers--> <!--Identifiers-->
| IUPHAR_ligand = 7400
| CASNo_Ref = {{cascite|??|??}}
| CAS_number_Ref = {{cascite|correct|??}} | CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 606-17-7 | CAS_number = 606-17-7
Line 41: Line 36:
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = TKQ858A3VW | UNII = TKQ858A3VW
| KEGG_Ref = {{keggcite|changed|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D01774 | KEGG = D01774
| ChEBI = 31176
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1165268 | ChEMBL = 1165268

<!--Chemical data--> <!--Chemical data-->
| C=20 | H=14 | I=6 | N=2 | O=6 | C=20 | H=14
| I=6 | N=2
| O=6
| molecular_weight = 1139.76 g/mol
| smiles = O=C(Nc1c(I)c(c(I)cc1I)C(=O)O)CCCCC(=O)Nc2c(I)c(C(=O)O)c(I)cc2I | smiles = O=C(Nc1c(I)c(c(I)cc1I)C(=O)O)CCCCC(=O)Nc2c(I)c(C(=O)O)c(I)cc2I
| InChI = 1/C20H14I6N2O6/c21-7-5-9(23)17(15(25)13(7)19(31)32)27-11(29)3-1-2-4-12(30)28-18-10(24)6-8(22)14(16(18)26)20(33)34/h5-6H,1-4H2,(H,27,29)(H,28,30)(H,31,32)(H,33,34)
| InChIKey = FFINMCNLQNTKLU-UHFFFAOYAL
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C20H14I6N2O6/c21-7-5-9(23)17(15(25)13(7)19(31)32)27-11(29)3-1-2-4-12(30)28-18-10(24)6-8(22)14(16(18)26)20(33)34/h5-6H,1-4H2,(H,27,29)(H,28,30)(H,31,32)(H,33,34) | StdInChI = 1S/C20H14I6N2O6/c21-7-5-9(23)17(15(25)13(7)19(31)32)27-11(29)3-1-2-4-12(30)28-18-10(24)6-8(22)14(16(18)26)20(33)34/h5-6H,1-4H2,(H,27,29)(H,28,30)(H,31,32)(H,33,34)
Line 58: Line 52:
| synonyms = <small>3-<nowiki>-6-oxohexanoyl]amino]-2,4,6-triiodobenzoic acid </small> | synonyms = <small>3-<nowiki>-6-oxohexanoyl]amino]-2,4,6-triiodobenzoic acid </small>
}} }}

'''Adipiodone''' (], or '''iodipamide'''; trade names '''Cholografin''' and '''Biligrafin''') is a pharmaceutical drug used as a ] in ]. It was introduced in the 1950s.<ref>{{cite journal | vauthors = Hastings-James R, Glazebrook AJ | title = Cholografin | journal = Canadian Medical Association Journal | volume = 72 | issue = 8 | pages = 561–5 | date = April 1955 | pmid = 14364399 | pmc = 1825662 }}</ref><ref>{{cite journal | vauthors = Dilger SK, Nelson N, Venkatesh SK, Ehman EC, Fidler JL, Fletcher JG, McCollough CH, Yu L | display-authors = 6 | title = Computed Tomography Cholangiography Using the Magnetic Resonance Contrast Agent Gadoxetate Disodium: A Phantom Study | journal = Investigative Radiology | volume = 54 | issue = 9 | pages = 572–579 | date = September 2019 | pmid = 31261292 | doi = 10.1097/RLI.0000000000000580 | s2cid = 195772743 }}</ref>

== References ==
{{reflist}}

{{Contrast media}}

]
]
]
]


{{pharmacology-stub}}