| Revision as of 20:11, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456550291 of page Adipiodone for the Chem/Drugbox validation project (updated: ''). |
Latest revision as of 21:15, 8 February 2024 edit VastV0idInSpace0 (talk | contribs)Extended confirmed users2,389 edits →References: Fixed spacing between stub template and category templates.Tag: 2017 wikitext editor |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
|
{{Distinguish|Adipiplon}} |
|
{{Drugbox |
|
{{Drugbox |
|
⚫ |
| verifiedrevid = 477242817 |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| ⚫ |
| verifiedrevid = 443657879 |
|
|
| IUPAC_name = 3-{5-pentanamido}-2,4,6-triiodobenzoic acid |
|
| IUPAC_name = 3-{5-pentanamido}-2,4,6-triiodobenzoic acid |
|
| image = Adipiodone.png |
|
| image = Adipiodone.png |
|
| drug_name = Iodipamide |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = Cholografin, Biligrafin |
|
| Drugs.com = {{drugs.com|CONS|iodipamide}} |
|
| Drugs.com = |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = Rx-only |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| IUPHAR_ligand = 7400 |
|
| CASNo_Ref = {{cascite|??|??}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 606-17-7 |
|
| CAS_number = 606-17-7 |
| Line 41: |
Line 36: |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = TKQ858A3VW |
|
| UNII = TKQ858A3VW |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D01774 |
|
| KEGG = D01774 |
|
|
| ChEBI = 31176 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 1165268 |
|
| ChEMBL = 1165268 |
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=20 | H=14 | I=6 | N=2 | O=6 |
|
| C=20 | H=14 |
|
|
| I=6 | N=2 |
|
|
| O=6 |
|
| molecular_weight = 1139.76 g/mol |
|
|
| smiles = O=C(Nc1c(I)c(c(I)cc1I)C(=O)O)CCCCC(=O)Nc2c(I)c(C(=O)O)c(I)cc2I |
|
| smiles = O=C(Nc1c(I)c(c(I)cc1I)C(=O)O)CCCCC(=O)Nc2c(I)c(C(=O)O)c(I)cc2I |
|
| InChI = 1/C20H14I6N2O6/c21-7-5-9(23)17(15(25)13(7)19(31)32)27-11(29)3-1-2-4-12(30)28-18-10(24)6-8(22)14(16(18)26)20(33)34/h5-6H,1-4H2,(H,27,29)(H,28,30)(H,31,32)(H,33,34) |
|
|
| InChIKey = FFINMCNLQNTKLU-UHFFFAOYAL |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C20H14I6N2O6/c21-7-5-9(23)17(15(25)13(7)19(31)32)27-11(29)3-1-2-4-12(30)28-18-10(24)6-8(22)14(16(18)26)20(33)34/h5-6H,1-4H2,(H,27,29)(H,28,30)(H,31,32)(H,33,34) |
|
| StdInChI = 1S/C20H14I6N2O6/c21-7-5-9(23)17(15(25)13(7)19(31)32)27-11(29)3-1-2-4-12(30)28-18-10(24)6-8(22)14(16(18)26)20(33)34/h5-6H,1-4H2,(H,27,29)(H,28,30)(H,31,32)(H,33,34) |
| Line 58: |
Line 52: |
|
| synonyms = <small>3-<nowiki>-6-oxohexanoyl]amino]-2,4,6-triiodobenzoic acid </small> |
|
| synonyms = <small>3-<nowiki>-6-oxohexanoyl]amino]-2,4,6-triiodobenzoic acid </small> |
|
}} |
|
}} |
|
|
|
|
|
'''Adipiodone''' (], or '''iodipamide'''; trade names '''Cholografin''' and '''Biligrafin''') is a pharmaceutical drug used as a ] in ]. It was introduced in the 1950s.<ref>{{cite journal | vauthors = Hastings-James R, Glazebrook AJ | title = Cholografin | journal = Canadian Medical Association Journal | volume = 72 | issue = 8 | pages = 561–5 | date = April 1955 | pmid = 14364399 | pmc = 1825662 }}</ref><ref>{{cite journal | vauthors = Dilger SK, Nelson N, Venkatesh SK, Ehman EC, Fidler JL, Fletcher JG, McCollough CH, Yu L | display-authors = 6 | title = Computed Tomography Cholangiography Using the Magnetic Resonance Contrast Agent Gadoxetate Disodium: A Phantom Study | journal = Investigative Radiology | volume = 54 | issue = 9 | pages = 572–579 | date = September 2019 | pmid = 31261292 | doi = 10.1097/RLI.0000000000000580 | s2cid = 195772743 }}</ref> |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
{{Contrast media}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{pharmacology-stub}} |