| Revision as of 20:15, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 471353725 of page Ageliferin for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo'). |
Latest revision as of 18:17, 19 August 2022 edit Fswitzer4 (talk | contribs)Extended confirmed users10,572 editsm Added UNII |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Chembox |
|
{{Chembox |
|
| Verifiedfields = changed |
|
|Verifiedfields = changed |
|
|
|Watchedfields = changed |
|
| verifiedrevid = 401790891 |
|
|verifiedrevid = 477243588 |
|
| ImageFile = Ageliferin.png |
|
|ImageFile = Ageliferin.png |
|
| ImageSize = 200px |
|
|ImageSize = 200px |
|
| IUPACName = ''N''-<nowiki>amino]methyl]-4,5,6,7-tetrahydro-1''H''-benzimidazol-6-yl]methyl]-4-bromo-1''H''-pyrrole-2-carboxamide |
|
|PIN = ''N'',''N''′-<nowiki/>{bis(methylene)}bis(4-bromo-1''H''-pyrrole-2-carboxamide) |
|
| OtherNames = Ageliferine |
|
|OtherNames = Ageliferine |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
|ChEMBL_Ref = {{ebicite|changed|EBI}} |
| ⚫ |
| ChemSpiderID = 10472083 |
|
|
|
|ChEMBL = 502866 |
| ⚫ |
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
⚫ |
|PubChem = 11169518 |
|
| ChEMBL = <!-- blanked - oldvalue: 502866 --> |
|
|
⚫ |
|ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
| InChI1 = 1/C22H24Br2N10O2/c23-10-2-14(27-5-10)19(35)29-4-9-1-13-18(34-22(26)32-13)17(16-8-31-21(25)33-16)12(9)7-30-20(36)15-3-11(24)6-28-15/h2-3,5-6,8-9,12,17,27-28H,1,4,7H2,(H,29,35)(H,30,36)(H3,25,31,33)(H3,26,32,34)/t9-,12-,17?/m1/s1 |
|
|
⚫ |
|ChemSpiderID = 9344613 |
| ⚫ |
| InChIKey1 = DMMLTRAQSJWUHT-GQFUOHMQBZ |
|
|
|
|SMILES = C1(((C2=C1NC(=N2)N)C3=CN=C(N3)N)CNC(=O)C4=CC(=CN4)Br)CNC(=O)C5=CC(=CN5)Br |
| ⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C22H24Br2N10O2/c23-10-2-14(27-5-10)19(35)29-4-9-1-13-18(34-22(26)32-13)17(16-8-31-21(25)33-16)12(9)7-30-20(36)15-3-11(24)6-28-15/h2-3,5-6,8-9,12,17,27-28H,1,4,7H2,(H,29,35)(H,30,36)(H3,25,31,33)(H3,26,32,34)/t9-,12-,17?/m1/s1 |
|
|InChI = 1/C22H24Br2N10O2/c23-10-2-14(27-5-10)19(35)29-4-9-1-13-18(34-22(26)32-13)17(16-8-31-21(25)33-16)12(9)7-30-20(36)15-3-11(24)6-28-15/h2-3,5-6,8-9,12,17,27-28H,1,4,7H2,(H,29,35)(H,30,36)(H3,25,31,33)(H3,26,32,34)/t9-,12-,17-/m1/s1 |
|
⚫ |
|InChIKey = DMMLTRAQSJWUHT-OGTWGDGJBG |
| ⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
⚫ |
|StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| StdInChIKey = DMMLTRAQSJWUHT-GQFUOHMQSA-N |
|
|
⚫ |
|StdInChI = 1S/C22H24Br2N10O2/c23-10-2-14(27-5-10)19(35)29-4-9-1-13-18(34-22(26)32-13)17(16-8-31-21(25)33-16)12(9)7-30-20(36)15-3-11(24)6-28-15/h2-3,5-6,8-9,12,17,27-28H,1,4,7H2,(H,29,35)(H,30,36)(H3,25,31,33)(H3,26,32,34)/t9-,12-,17-/m1/s1 |
| ⚫ |
| CASNo_Ref = {{cascite|correct|??}} |
|
|
⚫ |
|StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
| CASNo = <!-- blanked - oldvalue: 117417-64-8 --> |
|
|
⚫ |
|StdInChIKey = DMMLTRAQSJWUHT-OGTWGDGJSA-N |
| ⚫ |
| PubChem = |
|
|
⚫ |
|CASNo_Ref = {{cascite|changed|??}} |
|
| SMILES = Brc1cc(nc1)C(=O)NC3Cc5nc(N)nc5C(3CNC(=O)c2cc(Br)cn2)c4cnc(N)n4 |
|
|
|
|CASNo = 117417-64-8 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = P4YF5N7VXX |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=22 | H=24 | Br=2 | N=10 | O=2 |
|
|C=22 | H=24 | Br=2 | N=10 | O=2 |
|
| Appearance = |
|
|
| Density = |
|
|
| MeltingPt = |
|
|
| BoilingPt = |
|
|
| Solubility = }} |
|
|
| Section3 = {{Chembox Hazards |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| Autoignition = }} |
|
|
}} |
|
}} |
|
|
}} |
|
|
|
|
|
'''Ageliferin''' is a ] produced by some ]s. It was first isolated from Caribbean and then Okinawan marine sponges in the genus '']''.<ref>{{cite journal |author= Rinehart, Kenneth L |title= Bioactive Compounds from Aquatic and Terrestrial Sources |journal= Journal of Natural Products |year= 1990 |volume= 53 |issue= 4 |pages= 771–792 |doi= 10.1021/np50070a001|pmid= 2095373 |display-authors=etal}}</ref><ref>{{cite journal |author= Keifer, Paul A. |title= Bioactive Bromopyrrole Metabolites from the Caribbean Sponge Agelas conifera |journal= J. Org. Chem. |year= 1991 |volume= 56 |issue= 9 |pages= 2965–75 |doi= 10.1021/jo00009a008|display-authors=etal}}</ref><ref>{{cite journal |author= Kobayashi, Junichi |title= Ageliferins, potent actomyosin ATPase activators from the Okinawan marine sponge Agelas sp. |journal= Tetrahedron |year= 1990 |volume= 46 |issue= 16 |pages= 5579–86 |doi= 10.1016/S0040-4020(01)87756-5|display-authors=etal}}</ref> It often co-exists with the related compound ] and other similar compounds. It has antibacterial properties and can cause ]s to dissolve.<ref>{{cite journal |title= Sponge's secret weapon restores antibiotics' power: Bacteria treated with compound lose their resistance |journal= Science News |author= Laura Sanders |year= 2009 |volume= 175 |issue= 6 |pages= 16 |url= http://www.sciencenews.org/view/generic/id/40894/title/Sponge%27s_secret_weapon_restores_antibiotics%27_power |doi=10.1002/scin.2009.5591750616}}</ref> |
|
|
|
|
|
==See also== |
|
|
* '']'' |
|
|
* '']'' |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
{{Alkaloid-stub}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |