| Revision as of 04:49, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 470386734 of page Aleuritic_acid for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 22:21, 18 April 2021 edit Christian75 (talk | contribs)Extended confirmed users, New page reviewers, Pending changes reviewers, Rollbackers114,654 edits remove text from the bottom. Not sure if it seriously - e.g. "Storage: Basically this material is required to be protected from dirt. " |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 399403545 |
|
| verifiedrevid = 477314731 |
|
|Reference=<ref>EPA Registry</ref> |
|
| Reference=<ref>EPA Registry</ref> |
|
|ImageFile = Aleuritic acid.png |
|
| ImageFile = Aleuritic acid.png |
|
|IUPACName=(9''R'',10''S'')-rel-9,10,16-Trihydroxyhexadecanoic acid |
|
| PIN = ''rel''-(9''R'',10''S'')-9,10,16-Trihydroxyhexadecanoic acid |
|
|OtherNames=Aleuritolic acid |
|
| OtherNames = Aleuritolic acid |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 5602481 |
|
| ChemSpiderID = 5602481 |
|
| InChI = 1/C16H32O5/c17-13-9-5-4-7-11-15(19)14(18)10-6-2-1-3-8-12-16(20)21/h14-15,17-19H,1-13H2,(H,20,21)/t14-,15+/m0/s1 |
|
| InChI = 1/C16H32O5/c17-13-9-5-4-7-11-15(19)14(18)10-6-2-1-3-8-12-16(20)21/h14-15,17-19H,1-13H2,(H,20,21)/t14-,15+/m0/s1 |
| Line 15: |
Line 15: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = MEHUJCGAYMDLEL-LSDHHAIUSA-N |
|
| StdInChIKey = MEHUJCGAYMDLEL-LSDHHAIUSA-N |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 533-87-9 --> |
|
|
|
| CASNo=533-87-9 |
| ⚫ |
| SMILES = O=C(O)CCCCCCC(O)(O)CCCCCCO |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem = 222178 |
|
|
|
| UNII = 442LQ2K03A |
|
⚫ |
| SMILES = O=C(O)CCCCCCC(O)(O)CCCCCCO |
|
⚫ |
| PubChem = 222178 |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>16</sub>H<sub>32</sub>O<sub>5</sub> |
|
| Formula=C<sub>16</sub>H<sub>32</sub>O<sub>5</sub> |
|
| MolarMass=304.43 g/mol |
|
| MolarMass=304.43 g/mol |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Aleuritic acid''', or '''α-aleuritic acid''', is a major ingredient in ], constituting about 35% of it. It is used as a starting material in the ] industry for the preparation of ] aroma. |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
{{Fatty acids}} |
|
|
|
|
|
] |
|
|
|
|
|
|
|
|
{{Organic-compound-stub}} |