| Revision as of 11:51, 12 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'DrugBank_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[← Previous edit |
Latest revision as of 19:57, 30 November 2023 edit undoKimen8 (talk | contribs)Extended confirmed users5,112 edits Changing short description from "Chemical compound" to "Antidepressant and anxiolytic drug"Tag: Shortdesc helper |
| (25 intermediate revisions by 18 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Antidepressant and anxiolytic drug}} |
|
{{drugbox |
|
{{drugbox |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 34E28BM822 |
|
| UNII = 34E28BM822 |
|
| verifiedrevid = 437138070 |
|
| verifiedrevid = 444427189 |
|
| IUPAC_name = (+)-4-dihydro-2''H''-chromen-3-yl]-propylamino]butyl]-8-azaspirodecane-7,9-dione |
|
| IUPAC_name = (+)-4-dihydro-2''H''-chromen-3-yl]-propylamino]butyl]-8-azaspirodecane-7,9-dione |
|
| image = Alnespirone.svg |
|
| image = Alnespirone.svg |
|
| InChI = 1/C26H38N2O4.ClH/c1-3-13-27(20-16-21-22(31-2)9-8-10-23(21)32-19-20)14-6-7-15-28-24(29)17-26(18-25(28)30)11-4-5-12-26;/h8-10,20H,3-7,11-19H2,1-2H3;1H/t20-;/m0./s1 |
|
|
| InChIKey = QYFHCFNBYQZGKW-BDQAORGHBQ |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C26H38N2O4.ClH/c1-3-13-27(20-16-21-22(31-2)9-8-10-23(21)32-19-20)14-6-7-15-28-24(29)17-26(18-25(28)30)11-4-5-12-26;/h8-10,20H,3-7,11-19H2,1-2H3;1H/t20-;/m0./s1 |
|
| StdInChI = 1S/C26H38N2O4.ClH/c1-3-13-27(20-16-21-22(31-2)9-8-10-23(21)32-19-20)14-6-7-15-28-24(29)17-26(18-25(28)30)11-4-5-12-26;/h8-10,20H,3-7,11-19H2,1-2H3;1H/t20-;/m0./s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = QYFHCFNBYQZGKW-BDQAORGHSA-N |
|
| StdInChIKey = QYFHCFNBYQZGKW-BDQAORGHSA-N |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 143413-68-7 |
|
| CAS_number = 138298-79-0 |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
| PubChem = 178132 |
|
| PubChem = 178132 |
|
|
| ChEMBL = 2104091 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 8002134 |
|
| ChemSpiderID = 8002134 |
|
| C = 26 | H = 38 | N = 2 | O = 4 |
|
| C = 26 | H = 38 | N = 2 | O = 4 |
|
| molecular_weight = 442.589 g/mol |
|
|
| smiles = Cl.O=C1N(C(=O)CC2(C1)CCCC2)CCCCN(3Cc4c(OC)cccc4OC3)CCC |
|
| smiles = Cl.O=C1N(C(=O)CC2(C1)CCCC2)CCCCN(3Cc4c(OC)cccc4OC3)CCC |
|
| bioavailability = |
|
| bioavailability = |
| Line 29: |
Line 29: |
|
}} |
|
}} |
|
|
|
|
|
'''Alnespirone''' ('''S-20,499''') is a ] ] ] of the ] ].<ref name="pmid1351756">{{cite journal | doi = 10.1097/00001756-199201000-00022 | author = Griebel G, Misslin R, Pawlowski M, Guardiola Lemaître B, Guillaumet G, Bizot-Espiard J. | title = Anxiolytic-like effects of a selective 5-HT1A agonist, S20244, and its enantiomers in mice. | journal = Neuroreport. | volume = 3 | issue = 1 | pages = 84–86 | year = 1992 | pmid = 1351756 }}</ref><ref name="pmid1357709">{{cite journal | doi = 10.1007/BF02245284 | author = Simon P, Guardiola B, Bizot-Espiard J, Schiavi P, Costentin J. | title = 5-HT1A receptor agonists prevent in rats the yawning and penile erections induced by direct dopamine agonists. | journal = Psychopharmacology (Berl). | volume = 108 | issue = 1-2 | pages = 47–50 | year = 1992 | pmid = 1357709 }}</ref><ref name="pmid12505530">{{cite journal | doi = 10.1016/S0014-2999(02)02814-5 | author = Astier B, Lambás Señas L, Soulière F, Schmitt P, Urbain N, Rentero N, Bert L, Denoroy L, Renaud B, Lesourd M, Muñoz C, Chouvet G. | title = In vivo comparison of two 5-HT1A receptors agonists alnespirone (S-20499) and buspirone on locus coeruleus neuronal activity. | journal = Eur J Pharmacol. | volume = 459 | issue = 1 | pages = 17–26 | year = 2003 | pmid = 12505530 }}</ref> It has ] and ] effects.<ref name="pmid1351756" /> |
|
'''Alnespirone''' ('''S-20,499''') is a ] ] ] of the ] ].<ref name="pmid1351756">{{cite journal | doi = 10.1097/00001756-199201000-00022 | vauthors = Griebel G, Misslin R, Pawlowski M, Guardiola Lemaître B, Guillaumet G, Bizot-Espiard J | title = Anxiolytic-like effects of a selective 5-HT1A agonist, S20244, and its enantiomers in mice. | journal = NeuroReport | volume = 3 | issue = 1 | pages = 84–86 | year = 1992 | pmid = 1351756 }}</ref><ref name="pmid1357709">{{cite journal | doi = 10.1007/BF02245284 | vauthors = Simon P, Guardiola B, Bizot-Espiard J, Schiavi P, Costentin J | title = 5-HT1A receptor agonists prevent in rats the yawning and penile erections induced by direct dopamine agonists. | journal = Psychopharmacology | volume = 108 | issue = 1–2 | pages = 47–50 | year = 1992 | pmid = 1357709 | s2cid = 22385029 }}</ref><ref name="pmid12505530">{{cite journal | doi = 10.1016/S0014-2999(02)02814-5 | vauthors = Astier B, Lambás Señas L, Soulière F, Schmitt P, Urbain N, Rentero N, Bert L, Denoroy L, Renaud B, Lesourd M, Muñoz C, Chouvet G | title = In vivo comparison of two 5-HT1A receptors agonists alnespirone (S-20499) and buspirone on locus coeruleus neuronal activity. | journal = Eur J Pharmacol | volume = 459 | issue = 1 | pages = 17–26 | year = 2003 | pmid = 12505530 }}</ref> It has ] and ] effects.<ref name="pmid1351756" /> |
|
|
|
|
|
== See also == |
|
== See also == |
|
|
* ] |
|
* ] |
|
* ] |
|
|
|
|
|
== References == |
|
== References == |
|
{{Reflist|2}} |
|
{{Reflist|2}} |
|
|
|
|
|
|
|
|
{{Antidepressants}} |
|
{{Antidepressants}} |
| Line 45: |
Line 45: |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{Amine-stub}} |
|
{{Amine-stub}} |
|
{{nervous-system-drug-stub}} |
|
{{anxiolytic-stub}} |