| Revision as of 08:23, 25 November 2010 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: StdInChI StdInChIKey.← Previous edit | Latest revision as of 04:47, 27 October 2024 edit undoWhywhenwhohow (talk | contribs)Autopatrolled, Extended confirmed users, Pending changes reviewers49,153 edits rank | ||
| (49 intermediate revisions by 23 users not shown) | |||
| Line 1: | Line 1: | ||
| {{Short description|Antihypertensive medication}} | |||
| {{Cleanup|date=June 2009}}{{Refimprove|date=December 2009}} | |||
| {{Use dmy dates|date=February 2024}} | |||
| {{Drugbox | {{Drugbox | ||
| | Verifiedfields = changed | |||
| | type = combo | |||
| | Watchedfields = changed | |||
| | image = Amlodipine.svg | |||
| | verifiedrevid = 415479203 | |||
| | image2 = Benazepril.svg | |||
| | type = combo | |||
| | component1 = Amlodipine | |||
| | image = Amlodipine.svg | |||
| | class1 = ] | |||
| | alt = | |||
| | component2 = Benazepril | |||
| | image2 = Benazepril.svg | |||
| | class2 = ] | |||
| | alt2 = | |||
| <!-- Combo data --> | |||
| | component1 = Amlodipine | |||
| | class1 = ] | |||
| | component2 = Benazepril | |||
| | class2 = ] | |||
| <!-- Clinical data --> | |||
| | tradename = Lotrel | |||
| | Drugs.com = {{drugs.com|ppa|amlodipine-and-benazepril}} | |||
| | DailyMedID = Amlodipine and benazepril | |||
| | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | |||
| | pregnancy_category = | |||
| | routes_of_administration = ] | |||
| | ATC_prefix = C09 | |||
| | ATC_suffix = BB13 | |||
| <!-- Legal status --> | |||
| | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled --> | |||
| | legal_AU_comment = | |||
| | legal_BR = <!-- OTC, A1, A2, A3, B1, B2, C1, C2, C3, C4, C5, D1, D2, E, F --> | |||
| | legal_BR_comment = | |||
| | legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII --> | |||
| | legal_CA_comment = | |||
| | legal_DE = <!-- Anlage I, II, III or Unscheduled --> | |||
| | legal_DE_comment = | |||
| | legal_NZ = <!-- Class A, B, C --> | |||
| | legal_NZ_comment = | |||
| | legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM / Class A, B, C --> | |||
| | legal_UK_comment = | |||
| | legal_US = Rx-only | |||
| | legal_US_comment = <ref name="Lotrel FDA label">{{cite web | title=Lotrel- amlodipine besylate and benazepril hydrochloride capsule | work = DailyMed | publisher = U.S. National Library of Medicine | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=94ae6054-b7ae-4212-a567-4f803af8f2c7 | access-date=20 June 2021}}</ref> | |||
| | legal_EU = | |||
| | legal_EU_comment = | |||
| | legal_UN = <!-- N I, II, III, IV / P I, II, III, IV --> | |||
| | legal_UN_comment = | |||
| | legal_status = <!-- For countries not listed above --> | |||
| <!-- Identifiers --> | |||
| | CAS_number_Ref = {{cascite|changed|??}} | |||
| | CAS_number = 357437-90-2 | |||
| | PubChem = 5746247 | |||
| | DrugBank = | |||
| | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | |||
| | ChemSpiderID = 4676979 | | ChemSpiderID = 4676979 | ||
| | KEGG = D11069 | |||
| | InChI = 1/C24H28N2O5.C20H25ClN2O5/c1-2-31-24(30)20(14-12-17-8-4-3-5-9-17)25-19-15-13-18-10-6-7-11-21(18)26(23(19)29)16-22(27)28;1-4-28-20(25)18-15(11-27-10-9-22)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)21/h3-11,19-20,25H,2,12-16H2,1H3,(H,27,28);5-8,17,23H,4,9-11,22H2,1-3H3/t19-,20-;/m0./s1 | |||
| | smiles = Clc1ccccc1C2C(\C(=O)OC)=C(/N\C(=C2\C(=O)OCC)COCCN)C.O=C(OCC)(N2C(=O)N(c1ccccc1CC2)CC(=O)O)CCc3ccccc3 | |||
| | InChIKey = SRTZYSFUFGOMFR-FKLPMGAJBV | |||
| | StdInChI = 1S/C24H28N2O5.C20H25ClN2O5/c1-2-31-24(30)20(14-12-17-8-4-3-5-9-17)25-19-15-13-18-10-6-7-11-21(18)26(23(19)29)16-22(27)28;1-4-28-20(25)18-15(11-27-10-9-22)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)21/h3-11,19-20,25H,2,12-16H2,1H3,(H,27,28);5-8,17,23H,4,9-11,22H2,1-3H3/t19-,20-;/m0./s1 | |||
| | StdInChIKey = SRTZYSFUFGOMFR-FKLPMGAJSA-N | |||
| | CAS_number = | |||
| | ATC_prefix = | |||
| | ATC_suffix = | |||
| | PubChem = 5746247 | |||
| | DrugBank = | |||
| | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | |||
| | pregnancy_US = D | |||
| | pregnancy_category= | |||
| | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | |||
| | legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> | |||
| | legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> | |||
| | legal_US = Rx-only | |||
| | legal_status = | |||
| | routes_of_administration = Oral | |||
| }} | }} | ||
| '''Amlodipine/benazepril''', marketed in the U.S. as '''Lotrel''' by ] and manufactured as a ] by ] and ], is an ] medication which combines a ] (] besylate) with an ] (]).<ref></ref> This combination agent, and other analogs, is prescribed when either agent alone is not sufficient to bring a person's blood pressure down to target range. As a combination agent, Lotrel shares the ] profile of both of its individual parts. | |||
| <!-- Definition and medical uses --> | |||
| == See also == | |||
| '''Amlodipine/benazepril''', sold under the brand name '''Lotrel''' among others, is a ] medication used to treat ].<ref name="Lotrel FDA label" /> It is a combination of ], as the besilate, a ], and ], an ].<ref name="Lotrel FDA label"/> It may be used if a single agent is not sufficient.<ref name="Lotrel FDA label"/> It is taken ].<ref name="Lotrel FDA label"/> | |||
| * ] | |||
| * ] | |||
| <!-- Side effects and mechanisms --> | |||
| ==References== | |||
| Common side effects include cough, dizziness, and swelling.<ref name="Lotrel FDA label"/> Serious side effects may include ], ], ], ], and ].<ref name="Lotrel FDA label"/> Use in ] is not recommended.<ref name="Lotrel FDA label"/> Amlodipine works by ] while benazepril works by decreasing ] activity.<ref name="Lotrel FDA label"/> | |||
| {{Reflist}} | |||
| <!-- Society and culture --> | |||
| ==External links== | |||
| The combination was approved for medical use in the United States in 1995.<ref name=MTM2019>{{cite web | author = Cerner Multum |title=Amlodipine and benazepril Uses, Side Effects & Warnings |url=https://www.drugs.com/mtm/amlodipine-and-benazepril.html |website=Drugs.com |access-date=10 March 2019 |language=en}}</ref> It is available as a ].<ref>{{cite book | vauthors = Bope ET, Kellerman RD |title=Conn's Current Therapy 2017 E-Book |date=2016 |publisher=Elsevier Health Sciences |isbn=978-0-323-44335-7 |page=124 |url=https://books.google.com/books?id=UitFDQAAQBAJ&pg=PT158 }}</ref> In 2022, it was the 170th most commonly prescribed medication in the United States, with more than 3{{nbsp}}million prescriptions.<ref>{{cite web | title=The Top 300 of 2022 | url=https://clincalc.com/DrugStats/Top300Drugs.aspx | website=ClinCalc | access-date=30 August 2024 | archive-date=30 August 2024 | archive-url=https://web.archive.org/web/20240830202410/https://clincalc.com/DrugStats/Top300Drugs.aspx | url-status=live }}</ref><ref>{{cite web | title = Amlodipine; Benazepril Drug Usage Statistics, United States, 2013 - 2022 | website = ClinCalc | url = https://clincalc.com/DrugStats/Drugs/AmlodipineBenazepril | access-date = 30 August 2024 }}</ref> | |||
| * ] | |||
| * Drugs.com | |||
| ==Medical uses== | |||
| * RxList | |||
| It is used to treat ].<ref name="Lotrel FDA label"/> It is not a first-line treatment.<ref>{{cite journal | vauthors = Faulkner MA, Hilleman DE | title = Amlodipine/benazepril: fixed dose combination therapy for hypertension | journal = Expert Opinion on Pharmacotherapy | volume = 2 | issue = 1 | pages = 165–178 | date = January 2001 | pmid = 11336577 | doi = 10.1517/14656566.2.1.165 | s2cid = 23021242 }}</ref> | |||
| == References == | |||
| {{Reflist}} | |||
| {{Calcium channel blockers}} | |||
| {{ACE inhibitors}} | {{ACE inhibitors}} | ||
| {{Calcium channel blockers}} | |||
| {{Portal bar|Medicine}} | |||
| {{DEFAULTSORT:Amlodipine Benazepril}} | |||
| ] | |||
| ] | ] | ||
| ] | |||
| ] | ] | ||
| ] | |||