| Revision as of 01:28, 6 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to verified fields - updated 'DrugBank_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:WikiProject_Pharmacology|erro← Previous edit |
Latest revision as of 13:39, 20 January 2024 edit undoMaxim Masiutin (talk | contribs)Extended confirmed users, IP block exemptions, Pending changes reviewers31,042 edits Altered title. Added s2cid. Added the cs1 style template to denote Vancouver ("vanc") citation style, because references contain "vauthors" attribute to specify the list of authors. |
| (21 intermediate revisions by 15 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{cs1 config|name-list-style=vanc}} |
| ⚫ |
| Verifiedfields = changed |
|
|
|
{{Drugbox |
| ⚫ |
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
⚫ |
| Watchedfields = changed |
| ⚫ |
| UNII = 1Q8D39N37L |
|
|
| verifiedrevid = 403349247 |
|
| verifiedrevid = 443275125 |
|
| IUPAC_name = 5-amino-2--1''H''-benzoisoquinoline-1,3(2''H'')-dione |
|
| IUPAC_name = 5-amino-2--1''H''-benzoisoquinoline-1,3(2''H'')-dione |
|
| image = Amonafide.svg |
|
| image = Amonafide.svg |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = Xanafide, Quinamed |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 69408-81-7 |
|
⚫ |
| ATC_prefix = none |
|
⚫ |
| ATC_suffix = |
|
⚫ |
| PubChem = 50515 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 45804 |
|
| ChemSpiderID = 45804 |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
⚫ |
| UNII = 1Q8D39N37L |
|
⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
⚫ |
| ChEMBL = 428676 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D10090 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=16 | H=17 | N=3 | O=3 |
|
⚫ |
| smiles = O=C2c1c3c(ccc1)cc(cc3C(=O)N2CCN(C)C)N |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C16H17N3O2/c1-18(2)6-7-19-15(20)12-5-3-4-10-8-11(17)9-13(14(10)12)16(19)21/h3-5,8-9H,6-7,17H2,1-2H3 |
|
| StdInChI = 1S/C16H17N3O2/c1-18(2)6-7-19-15(20)12-5-3-4-10-8-11(17)9-13(14(10)12)16(19)21/h3-5,8-9H,6-7,17H2,1-2H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = UPALIKSFLSVKIS-UHFFFAOYSA-N |
|
| StdInChIKey = UPALIKSFLSVKIS-UHFFFAOYSA-N |
| ⚫ |
| smiles = O=C2c1c3c(ccc1)cc(cc3C(=O)N2CCN(C)C)N |
|
| ⚫ |
| CAS_number = 69408-81-7 |
|
| ⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ⚫ |
| ChEMBL = 428676 |
|
| ⚫ |
| ATC_prefix = none |
|
| ⚫ |
| ATC_suffix = |
|
| ⚫ |
| PubChem = 50515 |
|
| ⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| ⚫ |
| DrugBank = |
|
| ⚫ |
| C=16|H=17|N=3|O=3 |
|
|
| molecular_weight = 283.325 g/mol |
|
| ⚫ |
| bioavailability = |
|
| ⚫ |
| protein_bound = |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| ⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
'''Amonafide''' (originally AS1413) (], trade name '''Quinamed''') is a drug that is being studied in the treatment of ]. It belongs to the families of drugs called ]s and ]s. |
|
'''Amonafide''' (originally AS1413) (], trade names '''Quinamed''' and '''Xanafide''') was a drug that was being studied in the treatment of ]. It belongs to a novel family of chemotherapeutic drugs called Naphthalimides and is a potential ] and ].<ref name="Allen_2011">{{cite journal | vauthors = Allen SL, Lundberg AS | title = Amonafide: a potential role in treating acute myeloid leukemia | journal = Expert Opinion on Investigational Drugs | volume = 20 | issue = 7 | pages = 995–1003 | date = July 2011 | pmid = 21591994 | doi = 10.1517/13543784.2011.585756 | s2cid = 10999582 }}</ref><ref name="Freeman_2012">{{cite journal | vauthors = Freeman CL, Swords R, Giles FJ | title = Amonafide: a future in treatment of resistant and secondary acute myeloid leukemia? | journal = Expert Review of Hematology | volume = 5 | issue = 1 | pages = 17–26 | date = February 2012 | pmid = 22272701 | doi = 10.1586/ehm.11.68 | s2cid = 26740617 }}</ref> |
|
|
|
|
|
It is being developed as an anti-cancer therapy by ].<ref>http://www.genengnews.com/news/bnitem.aspx?name=78979622 </ref> |
|
It was being developed as an anti-cancer therapy by ].<ref>{{cite web | title = Antisoma's Shares Plummet 70% as Cancer Candidate Bombs in Phase III NSCLC Trial | url = http://www.genengnews.com/news/bnitem.aspx?name=78979622 | archive-url = https://web.archive.org/web/20100401235144/http://www.genengnews.com/news/bnitem.aspx?name=78979622 | archive-date = 1 April 2010 | date = 29 March 2010 | work = Genetic Engineering & Biotechnology News }}</ref> |
|
|
|
|
|
{{As of|2008}}, it is in ] ]s. |
|
{{As of|2008}}, it is in ] ]s. |
|
eg In March 2010 it is ] trial against secondary ] (AML).<ref>http://clinicaltrials.gov/ct2/show/NCT00715637 "Phase III Randomized Study of Amonafide (AS1413) and Cytarabine Versus Daunorubicin and Cytarabine in Patients With Secondary Acute Myeloid Leukemia (AML)- the ACCEDE Study"</ref> |
|
e.g. In March 2010 it is ] trial against secondary ] (AML).<ref>{{ClinicalTrialsGov|NCT00715637|Phase III Randomized Study of Amonafide (AS1413) and Cytarabine Versus Daunorubicin and Cytarabine in Patients With Secondary Acute Myeloid Leukemia (AML)- the ACCEDE Study}}</ref> In June 2010, it gained an FDA Fast Track Status for the treatment of Secondary Acute Myeloid Leukaemia.{{cn|date=February 2023}} |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
|
|
|
==References== |
|
==References== |
| Line 49: |
Line 64: |
|
|
|
|
|
== External links == |
|
== External links == |
|
* entry in the public domain NCI Dictionary of Cancer Terms |
|
* entry in the public domain NCI Dictionary of Cancer Terms |
|
* at ClinicalTrials.gov |
|
* at ClinicalTrials.gov |
|
|
|
|