| Revision as of 22:09, 9 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:WikiProject_Chemicals|error← Previous edit |
Latest revision as of 13:43, 24 September 2023 edit undoInnerstream (talk | contribs)Autopatrolled, Extended confirmed users4,032 editsmNo edit summary |
| (8 intermediate revisions by 7 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 443388038 |
|
| verifiedrevid = 443946753 |
|
|ImageFile=Amorpha-4,11-diene.png |
|
| ImageFile=Amorpha-4,11-diene.svg |
|
|ImageSize=180px |
|
| ImageSize=180px |
| ⚫ |
|IUPACName=(1''R'',4''R'',4a''S'',8a''R'')-4,7-dimethyl-1-prop-1-en-2-yl-1,2,3,4,4a,5,6,8a-octahydronaphthalene |
|
|
|
| IUPACName=6α,7β,10α-Cadina-4,11-diene |
| ⚫ |
|OtherNames= |
|
|
⚫ |
| SystematicName=(1''R'',4''R'',4a''S'',8a''R'')-4,7-Dimethyl-1-(prop-1-en-2-yl)-1,2,3,4,4a,5,6,8a-octahydronaphthalene |
|
⚫ |
| OtherNames= |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 9227908 |
|
| ChemSpiderID = 9227908 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
| Line 17: |
Line 19: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = HMTAHNDPLDKYJT-CBBWQLFWSA-N |
|
| StdInChIKey = HMTAHNDPLDKYJT-CBBWQLFWSA-N |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=92692-39-2 |
|
| CASNo=92692-39-2 |
|
| PubChem=11052747 |
|
| PubChem=11052747 |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 52026 |
|
| ChEBI = 52026 |
|
| SMILES=C1CC(21CCC(=C2)C)C(=C)C |
|
| SMILES=C1CC(21CCC(=C2)C)C(=C)C |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>15</sub>H<sub>24</sub> |
|
| Formula=C<sub>15</sub>H<sub>24</sub> |
|
| MolarMass=204.35 g/mol |
|
| MolarMass=204.35 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density=0.869 g/ml |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Amorpha-4,11-diene''' is a precursor to ].<ref></ref> |
|
'''Amorpha-4,11-diene''' is a precursor to ].<ref></ref> |
|
|
|
|
|
==See also== |
|
==See also== |