| Revision as of 12:49, 15 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 472983740 of page Amtolmetin_guacil for the Chem/Drugbox validation project (updated: 'UNII', 'ChEMBL', 'CAS_number'). |
Latest revision as of 15:48, 23 September 2024 edit JWBE (talk | contribs)Extended confirmed users10,111 edits added Category:2-Methoxyphenyl compounds using HotCat |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
|
{{Refimprove|date=March 2019}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 457129598 |
|
| verifiedrevid = 476996616 |
|
| IUPAC_name = (2-methoxyphenyl) 2-acetyl]ami |
|
| IUPAC_name = (2-methoxyphenyl) 2-acetyl]ami |
|
| image = Amtolmetin guacil.png |
|
| image = Amtolmetin guacil.png |
| Line 16: |
Line 17: |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
| Line 23: |
Line 24: |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 87344-06-7 --> |
|
| CAS_number = 87344-06-7 |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
|
| ATC_suffix = |
|
| ATC_suffix = |
| Line 36: |
Line 37: |
|
| ChemSpiderID = 59091 |
|
| ChemSpiderID = 59091 |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII = <!-- blanked - oldvalue: 323A00CRO9 --> |
|
| UNII = 323A00CRO9 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D07453 |
|
| KEGG = D07453 |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL = <!-- blanked - oldvalue: 1766570 --> |
|
| ChEMBL = 1766570 |
|
|
|
|
|
<!--Chemical data--> |
|
| C=24 | H=24 | N=2 | O=5 |
|
| C=24 | H=24 | N=2 | O=5 |
|
| molecular_weight = 420.458 g/mol |
|
|
| smiles = O=C(c1ccc(n1C)CC(=O)NCC(=O)Oc2ccccc2OC)c3ccc(cc3)C |
|
| smiles = O=C(c1ccc(n1C)CC(=O)NCC(=O)Oc2ccccc2OC)c3ccc(cc3)C |
|
| InChI = 1/C24H24N2O5/c1-16-8-10-17(11-9-16)24(29)19-13-12-18(26(19)2)14-22(27)25-15-23(28)31-21-7-5-4-6-20(21)30-3/h4-13H,14-15H2,1-3H3,(H,25,27) |
|
|
| InChIKey = CWJNMKKMGIAGDK-UHFFFAOYAI |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C24H24N2O5/c1-16-8-10-17(11-9-16)24(29)19-13-12-18(26(19)2)14-22(27)25-15-23(28)31-21-7-5-4-6-20(21)30-3/h4-13H,14-15H2,1-3H3,(H,25,27) |
|
| StdInChI = 1S/C24H24N2O5/c1-16-8-10-17(11-9-16)24(29)19-13-12-18(26(19)2)14-22(27)25-15-23(28)31-21-7-5-4-6-20(21)30-3/h4-13H,14-15H2,1-3H3,(H,25,27) |
| Line 52: |
Line 52: |
|
| synonyms = ST-679 |
|
| synonyms = ST-679 |
|
}} |
|
}} |
|
|
|
|
|
'''Amtolmetin guacil''' is a ] (]). It is a ] of ] sodium.<ref>{{Cite journal | vauthors = Tsvetkova E, Denisov L, Nasonov E |url=https://ard.bmj.com/content/76/Suppl_2/1337.2|title=AB0798 Amtolmetin guacil-effective and good safe nonsteroidal anti-inflammatory drug in knee osteoarthritis patients with dyspepsia|issue=Suppl 2|pages=1337.2–1337 |journal=Annals of the Rheumatic Diseases|volume=76|doi=10.1136/annrheumdis-2017-eular.5253|year=2017|doi-access=free}}</ref> |
|
|
|
|
|
==Background == |
|
|
|
|
|
Tolmetin sodium is an approved NSAID, marketed for the treatment of ], ] and ].<ref>{{cite journal | vauthors = Garg A, Shoeb A, Moodahadu LS, Sharma A, Gandhi A, Akku S | title = Amtolmetin: A Reappraisal of NSAID with Gastroprotection | journal = Arthritis | volume = 2016 | pages = 7103705 | date = 2016 | pmid = 27092274 | pmc = 4820613 | doi = 10.1155/2016/7103705 | doi-access = free }}</ref> In humans, tolmetin sodium is absorbed rapidly with peak plasma levels observed 30 minutes after administration. It is eliminated rapidly with a mean plasma elimination t<sub>½</sub> of approximately 1 hour. The preparation of slow release formulations or chemical modification of NSAIDs to form prodrugs has been suggested as a method to reduce the gastrotoxicity of these agents. |
|
|
|
|
|
Amtolmetin guacil is a non-acidic prodrug of tolmetin, having NSAID properties similar to tolmetin with additional ], ], and gastro protective properties. Amtolmetin is formed by ] of tolmetin by ]. |
|
|
|
|
|
==Pharmacology== |
|
|
|
|
|
*Most is absorbed on oral administration. It is concentrated in the gastric wall. Highest concentration is reached 2 hours after administration. |
|
|
*Amtolmetin guacil can be hydrolysed to produce the ] Tolmetin, MED5 and Guiacol. |
|
|
*Elimination completes in 24 hours. This happens mostly with urine in shape of gluconides products (77%), faecal (7.5%). |
|
|
*It is advised to take the drug on empty stomach. |
|
|
*Permanent anti-inflammatory action continues up to 72 hours, with single administration. |
|
|
|
|
|
==Mechanism of action== |
|
|
|
|
|
Amtolmetin guacil stimulates ]s present on gastrointestinal walls, because of presence of vanillic moiety and also releases NO which is gastro protective. It also inhibits ] synthesis and ] (COX). |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
{{NSAIDs}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |