| Revision as of 14:04, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 467614911 of page Amurensin_(flavonol) for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 10:42, 21 October 2024 edit JWBE (talk | contribs)Extended confirmed users10,111 edits +Category:4-Hydroxyphenyl compounds; ±Category:Phenols→Category:Hydroxyarenes using HotCat |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 423447203 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| Name = Amurensin |
|
|
⚫ |
| verifiedrevid = 477367232 |
|
| ImageFile = Amurensin.svg |
|
|
| ImageSize = 250px |
|
| Name = Amurensin |
|
⚫ |
| ImageFile = Amurensin.svg |
| ⚫ |
| IUPACName = 3,5-dihydroxy-8-(3-hydroxy-3-methylbutyl)-2-(4-hydroxyphenyl)-7-oxychromen-4-one |
|
|
| OtherNames = |
|
| ImageSize = 250px |
|
|
| ImageFile2 = Amurensin ball-and-stick.png |
| ⚫ |
| Section1= {{Chembox Identifiers |
|
|
|
| IUPACName = 7-(β-<small>D</small>-Glucopyranosyloxy)-3,4′,5-trihydroxy-8-(3-hydroxy-3-methylbutyl)flavone |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
| SystematicName = 3,5-Dihydroxy-8-(3-hydroxy-3-methylbutyl)-2-(4-hydroxyphenyl)-7-{oxy}-4''H''-1-benzopyran-4-one |
| ⚫ |
| ChemSpiderID = 4476774 |
|
|
|
| OtherNames = |
| ⚫ |
| InChI = 1/C26H30O12/c1-26(2,35)8-7-13-15(36-25-22(34)20(32)18(30)16(10-27)37-25)9-14(29)17-19(31)21(33)23(38-24(13)17)11-3-5-12(28)6-4-11/h3-6,9,16,18,20,22,25,27-30,32-35H,7-8,10H2,1-2H3/t16-,18-,20-,22-,25-/m1/s1 |
|
|
⚫ |
|Section1={{Chembox Identifiers |
| ⚫ |
| InChIKey = UNHHWEHQUUGKEE-BGCJFSMVBS |
|
|
|
|
|
| SMILES1 = O=C3c4c(O)cc(O1O((O)(O)1O)CO)c(c4O/C(c2ccc(O)cc2)=C3/O)CCC(O)(C)C |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
⚫ |
| ChemSpiderID = 20120043 |
| ⚫ |
| StdInChI = 1S/C26H30O12/c1-26(2,35)8-7-13-15(36-25-22(34)20(32)18(30)16(10-27)37-25)9-14(29)17-19(31)21(33)23(38-24(13)17)11-3-5-12(28)6-4-11/h3-6,9,16,18,20,22,25,27-30,32-35H,7-8,10H2,1-2H3/t16-,18-,20-,22-,25-/m1/s1 |
|
|
⚫ |
| SMILES = CC(C)(CCC1=C(C=C(C2=C1OC(=C(C2=O)O)C3=CC=C(C=C3)O)O)O4((((O4)CO)O)O)O)O |
| ⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
⚫ |
| InChI = 1/C26H30O12/c1-26(2,35)8-7-13-15(36-25-22(34)20(32)18(30)16(10-27)37-25)9-14(29)17-19(31)21(33)23(38-24(13)17)11-3-5-12(28)6-4-11/h3-6,9,16,18,20,22,25,27-30,32-35H,7-8,10H2,1-2H3/t16-,18-,20+,22-,25-/m1/s1 |
| ⚫ |
| StdInChIKey = UNHHWEHQUUGKEE-BGCJFSMVSA-N |
|
|
⚫ |
| InChIKey = UNHHWEHQUUGKEE-MLLLWRCABA |
| ⚫ |
| CASNo_Ref = {{cascite|correct|??}} |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| CASNo = <!-- blanked - oldvalue: 641-94-1 --> |
|
|
⚫ |
| StdInChI = 1S/C26H30O12/c1-26(2,35)8-7-13-15(36-25-22(34)20(32)18(30)16(10-27)37-25)9-14(29)17-19(31)21(33)23(38-24(13)17)11-3-5-12(28)6-4-11/h3-6,9,16,18,20,22,25,27-30,32-35H,7-8,10H2,1-2H3/t16-,18-,20+,22-,25-/m1/s1 |
| ⚫ |
| PubChem = 5318156 |
|
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| SMILES = CC(C)(CCC1=C(C=C(C2=C1OC(=C(C2=O)O)C3=CC=C(C=C3)O)O)OC4C(C(C(C(O4)CO)O)O)O)O<br>CC(C)(CCC1=C(C=C(C2=C1OC(=C(C2=O)O)C3=CC=C(C=C3)O)O)O4((((O4)CO)O)O)O)O |
|
|
⚫ |
| StdInChIKey = UNHHWEHQUUGKEE-MLLLWRCASA-N |
|
⚫ |
| CASNo_Ref = {{cascite|changed|??}} |
|
|
| CASNo = 641-94-1 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = F3862WT2AZ |
|
⚫ |
| PubChem = 5318156 |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>26</sub>H<sub>30</sub>O<sub>12</sub> |
|
| Formula = C<sub>26</sub>H<sub>30</sub>O<sub>12</sub> |
|
| MolarMass = 534.50 g/mol |
|
| MolarMass = 534.50 g/mol |
|
⚫ |
| Appearance = |
|
| ExactMass = 534.173726 |
|
|
|
| Density = 1.581 g/mL |
| ⚫ |
| Appearance = |
|
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
'''Amurensin''' is a ], a type of flavonoid. It is the ] derivative of ]. It can be found in '']''.<ref>Two New Flavonoid Glycosides from the Leaves of Phellodendron amurense Ruprecht. Masao Hasegawa and Teruo Shirato, J. Am. Chem. Soc., 1953, 75 (22), pages 5507–5511, {{doi|10.1021/ja01118a013}}</ref> |
|
|
|
|
|
<!-- ==Uses== |
|
|
can act as an --> |
|
|
|
|
|
<!--==Metabolism== |
|
|
The enzyme [[ --> |
|
|
|
|
|
== Related compounds == |
|
|
] is found in the leaves of '']''.<ref>Constituents of Leaves of Phellodendron japonicum MAXIM. and Their Antioxidant Activity, Chih-Yang Chiu, Chia-Ying Li, Chao-Chen Chiu, Masatake Niwa, Susumu Kitanaka, Amooru Gangaiah Damu, E-Jian Lee and Tian-Shung Wu, Chem. Pharm. Bull., Vol. 53, pages 1118-1121 (2005), {{doi|10.1248/cpb.53.1118}}</ref> |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
{{Flavonol}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{Aromatic-stub}} |