| Revision as of 10:03, 7 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to verified fields - updated 'DrugBank_Ref', 'UNII_Ref', 'ChEBI_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:WikiProject_Pharmacology|erro← Previous edit |
Latest revision as of 19:27, 23 September 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,126 edits removed Category:Phenol ethers; added Category:4-Methoxyphenyl compounds using HotCat |
| (22 intermediate revisions by 18 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
|
{{cs1 config|name-list-style=vanc}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 407629786 |
|
| verifiedrevid = 443485321 |
|
| IUPAC_name = 5-(4-methoxyphenyl)-3''H''-1,2-dithiole-3-thione |
|
| IUPAC_name = 5-(4-methoxyphenyl)-3''H''-1,2-dithiole-3-thione |
|
| image = Anethole trithione.svg |
|
| image = Anethole trithione.svg |
|
|
| alt = Skeletal formula of anethole trithione |
|
|
| image2 = Anethole trithione 3D ball.png |
|
|
| alt2 = Ball-and-stick model of the anethole trithione molecule |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 532-11-6 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = QUY32964DJ |
|
⚫ |
| ATC_prefix = A16 |
|
⚫ |
| ATC_suffix = AX02 |
|
⚫ |
| PubChem = 2194 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
⚫ |
| DrugBank = DB13853 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 2109 |
|
| ChemSpiderID = 2109 |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D01584 |
|
| KEGG = D01584 |
|
| InChI = 1/C10H8OS3/c1-11-8-4-2-7(3-5-8)9-6-10(12)14-13-9/h2-6H,1H3 |
|
|
| InChIKey = KYLIZBIRMBGUOP-UHFFFAOYAF |
|
| ⚫ |
| smiles = S=C\2SS/C(c1ccc(OC)cc1)=C/2 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 178862 |
|
| ChEMBL = 178862 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=10 | H=8 | O=1 | S=3 |
|
⚫ |
| smiles = S=C\2SS/C(c1ccc(OC)cc1)=C/2 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C10H8OS3/c1-11-8-4-2-7(3-5-8)9-6-10(12)14-13-9/h2-6H,1H3 |
|
| StdInChI = 1S/C10H8OS3/c1-11-8-4-2-7(3-5-8)9-6-10(12)14-13-9/h2-6H,1H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = KYLIZBIRMBGUOP-UHFFFAOYSA-N |
|
| StdInChIKey = KYLIZBIRMBGUOP-UHFFFAOYSA-N |
| ⚫ |
| CAS_number = 532-11-6 |
|
| ⚫ |
| ATC_prefix = A16 |
|
| ⚫ |
| ATC_suffix = AX02 |
|
| ⚫ |
| PubChem = 2194 |
|
| ⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| ⚫ |
| DrugBank = |
|
| ⚫ |
| C=10|H=8|O=1|S=3 |
|
|
| molecular_weight = 240.365 g/mol |
|
| ⚫ |
| bioavailability = |
|
| ⚫ |
| protein_bound = |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| ⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
'''Anethole trithione''', '''anetholtrithione''', or '''anetholtrithion''' (]) is a drug used in the treatment of ]. It is listed in the U.S. ]'s ''Dictionary of Cancer Terms'' as being studied in the treatment of cancer.<ref> entry in the public domain ''NCI Dictionary of Cancer Terms''. Retrieved September 13, 2008.</ref> |
|
'''Anethole trithione''', '''anetholtrithione''', or '''anetholtrithion''' (]) is a drug used in the treatment of ]. It is listed in the U.S. ]'s ''Dictionary of Cancer Terms'' as being studied in the treatment of cancer.<ref> entry in the public domain ''NCI Dictionary of Cancer Terms''. Retrieved September 13, 2008.</ref> Anethole trithione is an ], specifically, a ]-thione derivative.<ref name="Christen_1995">{{cite book | vauthors = Christen MO | chapter = Anethole dithiolethione: Biochemical considerations | title = Biothiols Part B: Glutathione and Thioredoxin: Thiols in Signal Transduction and Gene Regulation | series = Methods in Enzymology | volume = 252 | pages = 316–23 | date = 1995 | pmid = 7476368 | doi = 10.1016/0076-6879(95)52034-1 | isbn = 9780121821531 }}</ref> |
|
|
|
|
|
==Brand names== |
|
==Brand names== |
| Line 64: |
Line 78: |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
|
] |
|
|
|
|
|
{{gastrointestinal-drug-stub}} |
|
{{gastrointestinal-drug-stub}} |