| Revision as of 06:30, 2 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report errors or [[user talk:CheMoB← Previous edit |
Latest revision as of 08:56, 5 April 2024 edit undoPashihiko (talk | contribs)Extended confirmed users3,552 editsNo edit summary |
| (18 intermediate revisions by 16 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
| ⚫ |
{{distinguish|Ansamycin}} |
|
|
|
{{cs1 config|name-list-style=vanc}} |
|
⚫ |
{{distinguish|Ansamycin|Annimycin}} |
|
{{Drugbox |
|
{{Drugbox |
|
| verifiedrevid = 443393481 |
|
| verifiedrevid = 447997666 |
|
| IUPAC_name = (7''S'',9''S'')-7-oxy-6,9,11-trihydroxy-9- (2-hydroxyacetyl)-8,10-dihydro-7''H''-tetracene-5,12-dione |
|
| IUPAC_name = (7''S'',9''S'')-7-oxy-6,9,11-trihydroxy-9- (2-hydroxyacetyl)-8,10-dihydro-7''H''-tetracene-5,12-dione |
|
| image = Annamycin.svg |
|
| image = Annamycin.svg |
| Line 15: |
Line 17: |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
| Line 22: |
Line 24: |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 92689-49-1 |
|
| CAS_number = 92689-49-1 |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
| Line 31: |
Line 34: |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
|
| KEGG = D12844 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 103088 |
|
| ChemSpiderID = 103088 |
| Line 38: |
Line 42: |
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=26 | H=25 | I=1 | O=11 |
|
| C=26 | H=25 | I=1 | O=11 |
|
| molecular_weight = 640.375 g/mol |
|
|
| smiles = O=C2c1c(O)c5c(c(O)c1C(=O)c3ccccc23)C(O)(C(=O)CO)C5O4O((O)(O)4I)C |
|
| smiles = O=C2c1c(O)c5c(c(O)c1C(=O)c3ccccc23)C(O)(C(=O)CO)C5O4O((O)(O)4I)C |
|
| InChI = 1S/C26H25IO11/c1-9-19(30)24(35)18(27)25(37-9)38-13-7-26(36,14(29)8-28)6-12-15(13)23(34)17-16(22(12)33)20(31)10-4-2-3-5-11(10)21(17)32/h2-5,9,13,18-19,24-25,28,30,33-36H,6-8H2,1H3/t9-,13-,18+,19-,24-,25-,26-/m0/s1 |
|
|
| InChIKey = CIDNKDMVSINJCG-GKXONYSUSA-N |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C26H25IO11/c1-9-19(30)24(35)18(27)25(37-9)38-13-7-26(36,14(29)8-28)6-12-15(13)23(34)17-16(22(12)33)20(31)10-4-2-3-5-11(10)21(17)32/h2-5,9,13,18-19,24-25,28,30,33-36H,6-8H2,1H3/t9-,13-,18+,19-,24-,25-,26-/m0/s1 |
|
| StdInChI = 1S/C26H25IO11/c1-9-19(30)24(35)18(27)25(37-9)38-13-7-26(36,14(29)8-28)6-12-15(13)23(34)17-16(22(12)33)20(31)10-4-2-3-5-11(10)21(17)32/h2-5,9,13,18-19,24-25,28,30,33-36H,6-8H2,1H3/t9-,13-,18+,19-,24-,25-,26-/m0/s1 |
| Line 50: |
Line 51: |
|
|
|
|
|
== Further reading == |
|
== Further reading == |
|
*{{cite journal |author=Priebe W |title=Mechanism of action-governed design of anthracycline antibiotics: a "turn-off/turn-on" approach |journal=Current Pharmaceutical Design |volume=1 |issue=1 |pages=51–68 |year=1995 |url=http://books.google.com/?id=qq8uPl5YYuoC&pg=PA64&dq=annamycin}} |
|
*{{cite journal |author =Priebe W |title=Mechanism of action-governed design of anthracycline antibiotics: a "turn-off/turn-on" approach |journal=Current Pharmaceutical Design |volume=1 |issue=1 |pages=51–68 |year=1995 |doi=10.2174/1381612801666220524190711 |s2cid=90406009 |url=https://books.google.com/books?id=qq8uPl5YYuoC&q=annamycin&pg=PA64}} |
|
*{{cite journal |author=Trevino AV, Woynarowska BA, Herman TS, Priebe W, Woynarowski JM |title=Enhanced topoisomerase II targeting by annamycin and related 4-demethoxy anthracycline analogues |journal=Mol Cancer Ther |volume=3 |issue=11 |pages=1403–10 |year=2004 |month=November |pmid=15542779 |doi= |url=http://mct.aacrjournals.org/cgi/pmidlookup?view=long&pmid=15542779}} |
|
*{{cite journal |vauthors =Trevino AV, Woynarowska BA, Herman TS, Priebe W, Woynarowski JM |title=Enhanced topoisomerase II targeting by annamycin and related 4-demethoxy anthracycline analogues |journal=Mol Cancer Ther |volume=3 |issue=11 |pages=1403–10 |date=November 2004 |doi=10.1158/1535-7163.1403.3.11 |pmid=15542779 |url=http://mct.aacrjournals.org/cgi/pmidlookup?view=long&pmid=15542779}} |
|
|
|
|
|
== External links == |
|
== External links == |
|
⚫ |
* |
|
|
|
| ⚫ |
* |
|
|
|
|
|
|
] |
|
] |