| Revision as of 12:10, 24 October 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'ChEMBL').← Previous edit |
Latest revision as of 13:18, 2 December 2024 edit undoMarbletan (talk | contribs)Extended confirmed users5,350 edits just a catalog listing - no info not already here |
| (21 intermediate revisions by 16 users not shown) |
| Line 1: |
Line 1: |
|
|
{{one source|date=September 2014}} |
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 396292528 |
|
| verifiedrevid = 457135003 |
|
| Name = Apigetrin |
|
| Name = Apigetrin |
|
| Reference= |
|
|
| ImageFile = Apigetrin.png |
|
| Reference= |
|
|
| ImageFile = Apigetrin.svg |
|
| ImageSize = 200px |
|
| ImageName = |
|
|
| IUPACName = 7-(β-<small>D</small>-Glucopyranosyloxy)-4′,5-dihydroxyflavone |
|
| ImageName = |
|
|
| IUPACName = 5-hydroxy-2-(4-hydroxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4, |
|
| SystematicName = 5-Hydroxy-2-(4-hydroxyphenyl)-7-{oxy}-4''H''-1-benzopyran-4-one |
|
⚫ |
| OtherNames= Apigetrin; Cosmosiine; Cosmetin; Cosmosiin; Cosmosioside; Thalictiin; Cosmosin; Apigenin 7-glucoside; Apigenin 7-''O''-glucoside |
|
5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
|
|
⚫ |
|Section1={{Chembox Identifiers |
| ⚫ |
| OtherNames= Apigetrin; Cosmosiine; Cosmetin; Cosmosiin; Cosmosioside; Thalictiin; Cosmosin; ] 7-]; Apigenin 7-O-glucoside |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 4444290 |
|
| ChemSpiderID = 4444290 |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL = 487017 |
|
| ChEMBL = 1159512 |
|
| InChI = 1/C21H20O10/c22-8-16-18(26)19(27)20(28)21(31-16)29-11-5-12(24)17-13(25)7-14(30-15(17)6-11)9-1-3-10(23)4-2-9/h1-7,16,18-24,26-28H,8H2/t16-,18-,19+,20-,21-/m1/s1 |
|
| InChI = 1/C21H20O10/c22-8-16-18(26)19(27)20(28)21(31-16)29-11-5-12(24)17-13(25)7-14(30-15(17)6-11)9-1-3-10(23)4-2-9/h1-7,16,18-24,26-28H,8H2/t16-,18-,19+,20-,21-/m1/s1 |
|
| InChIKey = KMOUJOKENFFTPU-QNDFHXLGBM |
|
| InChIKey = KMOUJOKENFFTPU-QNDFHXLGBM |
| Line 23: |
Line 24: |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 578-74-5 |
|
| CASNo = 578-74-5 |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 7OF2S66PCH |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = C04608 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 16778 |
|
| ChEBI = 16778 |
|
| SMILES = O=C\3c4c(O)cc(O1O((O)(O)1O)CO)cc4O/C(c2ccc(O)cc2)=C/3 |
|
| SMILES = O=C\3c4c(O)cc(O1O((O)(O)1O)CO)cc4O/C(c2ccc(O)cc2)=C/3 |
|
| PubChem = 5280704 |
|
| PubChem = 5280704 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=21 | H=20 | O=10 |
|
| Formula = C<sub>21</sub>H<sub>20</sub>O<sub>10</sub> |
|
|
⚫ |
| MeltingPt = |
|
| MolarMass = 432.3775 g/mol |
|
|
| ExactMass = 432.105647 |
|
| ⚫ |
| MeltingPt = °C |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Apigetrin''' is a chemical compound that can be found in ]. |
|
|
|
|
|
|
|
'''Apigetrin''' is a chemical compound that can be found in ] and in '']''.<ref>{{cite journal | doi = 10.1021/np50041a040| title = Flavonoid Aglycones and Glycosides from Teucrium gnaphalodes| journal = Journal of Natural Products| volume = 48| issue = 5| pages = 859| year = 1985| last1 = Barberán| first1 = F. A. T.| last2 = Gil| first2 = M. I.| last3 = Tomás| first3 = F.| last4 = Ferreres| first4 = F.| last5 = Arques| first5 = A.}}</ref> |
| ⚫ |
==References== |
|
|
|
|
|
⚫ |
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
==External links== |
|
|
* |
|
|
|
|
|
|
{{flavone}} |
|
{{flavone}} |
| Line 47: |
Line 48: |
|
] |
|
] |
|
|
|
|
|
{{Natural-phenol-stub}} |
|
{{organic-compound-stub}} |
|
|
|
|
] |
|