Revision as of 15:16, 1 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'ChEMBL', 'StdInChI', 'StdInChIKey', 'CAS_number').← Previous edit |
Latest revision as of 02:12, 1 August 2024 edit undoDanCherek (talk | contribs)Autopatrolled, Administrators74,549 edits Reverted 3 edits by Artem P75 (talk): Revert series of edits that were apparently prepared by an LLM; largely promotional and many instances of close paraphrasingTags: Twinkle Undo |
(21 intermediate revisions by 16 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 458471735 |
|
| IUPAC_name = 4-carbamoyl-1-pyridinium-1-yl}methoxy)methyl]pyridinium dichloride |
|
| IUPAC_name = 4-carbamoyl-1-pyridinium-1-yl}methoxy)methyl]pyridinium dichloride |
|
| image = Asoxime chloride.svg |
|
| image = Asoxime chloride.svg |
Line 23: |
Line 27: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 34433-31-3 --> |
|
| CAS_number = 34433-31-3 |
⚫ |
| ATC_prefix = |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
⚫ |
| ATC_suffix = |
|
|
|
| UNII = HUV88P6SJS |
|
⚫ |
| ATC_prefix = none |
|
⚫ |
| ATC_suffix = |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 33051 |
|
| ChEMBL = 33051 |
⚫ |
| StdInChI = 1S/C14H14N4O3.2ClH/c15-14(19)12-4-7-17(8-5-12)10-21-11-18-6-2-1-3-13(18)9-16-20;;/h1-9H,10-11H2,(H-,15,19);2*1H |
|
⚫ |
| StdInChIKey = QELSIJXWEROXOE-UHFFFAOYSA-N |
|
|
| PubChem = 5484128 |
|
| PubChem = 5484128 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 13004322 |
|
| ChemSpiderID = 13004322 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
|
| C=14 | H=16 | N=4 | O=3 | Cl=2 |
|
| chemical_formula = C<sub>14</sub>H<sub>16</sub>N<sub>4</sub>O<sub>3</sub> · 2Cl<sup>−</sup> |
|
|
|
| smiles = C1=CC=(C(=C1)/C=N/O)COC2=CC=C(C=C2)C(=O)N.. |
|
|
|
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| molecular_weight = 359.21 g/mol |
|
|
⚫ |
| StdInChI = 1S/C14H14N4O3.2ClH/c15-14(19)12-4-7-17(8-5-12)10-21-11-18-6-2-1-3-13(18)9-16-20;;/h1-9H,10-11H2,(H-,15,19);2*1H |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = QELSIJXWEROXOE-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Asoxime chloride''', or more commonly '''HI-6''', is a ] used in the treatment of ]. |
|
'''Asoxime chloride''', or more commonly '''HI-6''', is a ] used in the treatment of ].<ref>{{cite journal | vauthors = Cochran R, Kalisiak J, Küçükkilinç T, Radic Z, Garcia E, Zhang L, Ho KY, Amitai G, Kovarik Z, Fokin VV, Sharpless KB, Taylor P | display-authors = 6 | title = Oxime-assisted acetylcholinesterase catalytic scavengers of organophosphates that resist aging | journal = The Journal of Biological Chemistry | volume = 286 | issue = 34 | pages = 29718–24 | date = August 2011 | pmid = 21730071 | pmc = 3191013 | doi = 10.1074/jbc.M111.264739 | doi-access = free }}</ref> |
|
|
|
|
|
|
==See also== |
⚫ |
{{pharma-stub}} |
|
|
|
* ] |
|
|
* ] |
|
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
{{Antidotes}} |
|
{{Antidotes}} |
|
|
{{Acetylcholine metabolism and transport modulators}} |
|
|
|
|
|
|
] |
|
⚫ |
] |
|
⚫ |
] |
|
|
] |
|
|
] |
|
|
|
|
⚫ |
] |
|
⚫ |
] |
|
|
|
|
|
|
⚫ |
{{pharma-stub}} |
|
] |
|