| Revision as of 12:38, 26 November 2011 editThe chemistds (talk | contribs)Extended confirmed users5,761 edits added CSID, (Std)InChI & (Std)InChIKey← Previous edit |
Latest revision as of 19:48, 14 January 2024 edit undoSam Hnri (talk | contribs)Extended confirmed users1,139 editsmNo edit summaryTag: Visual edit |
| (19 intermediate revisions by 16 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 397488666 |
|
| verifiedrevid = 462561702 |
|
| Reference = <ref>http://www.food.gov.uk/multimedia/pdfs/Dossier_aspartame.pdf</ref> |
|
|
|
| Reference = <ref>{{cite web|url=http://www.food.gov.uk/multimedia/pdfs/Dossier_aspartame.pdf |title=Archived copy |accessdate=2007-10-21 |url-status=dead |archiveurl=https://web.archive.org/web/20080910124100/http://www.food.gov.uk/multimedia/pdfs/Dossier_aspartame.pdf |archivedate=2008-09-10 }}</ref> |
|
| ImageFile = Aspartame Acesulfam Salt V.1.svg |
|
| ImageFile = Aspartame Acesulfam Salt V.1.svg |
|
| ImageSize = 330 |
|
|
|
| ImageSize = 330 |
| ⚫ |
| IUPACName = ethanaminium 6-methyl-4-oxo-1,2,3-oxathiazin-3-ide-2,2-dioxide |
|
|
| OtherNames = Salt of Aspartame-acesulfame |
|
| ImageAlt = Skeletal formulas of aspartame-acesulfame salt |
|
|
| ImageFile1 = Aspartame-acesulfame-salt-3D-spacefill.png |
|
|
| ImageSize1 = 300 |
|
|
| ImageAlt1 = Space-filling models of the component ions of aspartame-acesulfame salt |
|
⚫ |
| IUPACName = ethanaminium 6-methyl-4-oxo-1,2,3-oxathiazin-3-ide-2,2-dioxide |
|
|
| OtherNames = Salt of Aspartame-acesulfame |
|
Twinsweet |
|
Twinsweet |
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 106372-55-8 |
|
|
| EINECS = |
|
| CASNo = 106372-55-8 |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
| ⚫ |
| RTECS = |
|
|
| PubChem = 10972537 |
|
| UNII = IFE6C6BS24 |
|
|
| EINECS = |
| ⚫ |
| ChemSpiderID = 9147744 |
|
|
⚫ |
| RTECS = |
| ⚫ |
| SMILES = O=S1(=O)O/C(=C\C(=O)1)C.C(=O)C(N)C(=O)N(C(=O)OC)Cc1ccccc1 |
|
|
|
| PubChem = 10972537 |
| ⚫ |
| InChI = 1/C14H18N2O5.C4H5NO4S/c1-21-14(20)11(7-9-5-3-2-4-6-9)16-13(19)10(15)8-12(17)18;1-3-2-4(6)5-10(7,8)9-3/h2-6,10-11H,7-8,15H2,1H3,(H,16,19)(H,17,18);2H,1H3,(H,5,6)/t10-,11-;/m0./s1 |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ⚫ |
| InChIKey = KVHQNWGLVVERFR-ACMTZBLWBH |
|
|
⚫ |
| ChemSpiderID = 9147744 |
| ⚫ |
| StdInChI = 1S/C14H18N2O5.C4H5NO4S/c1-21-14(20)11(7-9-5-3-2-4-6-9)16-13(19)10(15)8-12(17)18;1-3-2-4(6)5-10(7,8)9-3/h2-6,10-11H,7-8,15H2,1H3,(H,16,19)(H,17,18);2H,1H3,(H,5,6)/t10-,11-;/m0./s1 |
|
|
⚫ |
| SMILES = O=S1(=O)O/C(=C\C(=O)1)C.C(=O)C(N)C(=O)N(C(=O)OC)Cc1ccccc1 |
| ⚫ |
| StdInChIKey = KVHQNWGLVVERFR-ACMTZBLWSA-N |
|
|
⚫ |
| InChI = 1/C14H18N2O5.C4H5NO4S/c1-21-14(20)11(7-9-5-3-2-4-6-9)16-13(19)10(15)8-12(17)18;1-3-2-4(6)5-10(7,8)9-3/h2-6,10-11H,7-8,15H2,1H3,(H,16,19)(H,17,18);2H,1H3,(H,5,6)/t10-,11-;/m0./s1 |
|
⚫ |
| InChIKey = KVHQNWGLVVERFR-ACMTZBLWBH |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChI = 1S/C14H18N2O5.C4H5NO4S/c1-21-14(20)11(7-9-5-3-2-4-6-9)16-13(19)10(15)8-12(17)18;1-3-2-4(6)5-10(7,8)9-3/h2-6,10-11H,7-8,15H2,1H3,(H,16,19)(H,17,18);2H,1H3,(H,5,6)/t10-,11-;/m0./s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = KVHQNWGLVVERFR-ACMTZBLWSA-N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
|
| C=18 | H=23 | O=9 | N=3 | S=1 |
|
| Formula = C<sub>18</sub>H<sub>23</sub>O<sub>9</sub>N<sub>3</sub>S |
|
|
⚫ |
| Appearance = white crystalline powder |
|
| MolarMass = 457.46 |
|
|
|
| Density = |
| ⚫ |
| Appearance = white crystalline powder |
|
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
| Section3 = {{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Aspartame-acesulfame salt''' is an artificial sweetener marketed under the name Twinsweet. It is produced by soaking a 2-1 mixture of ] and ] in an acidic solution and allowing it to crystallize; moisture and potassium are removed during this process. It is approximately 350 times as sweet as ]. |
|
'''Aspartame-acesulfame salt''' is an artificial sweetener marketed under the name Twinsweet. It is produced by soaking a 2:1 mixture of ] and ] in an acidic solution and allowing it to crystallize; moisture and potassium are removed during this process. It is approximately 350 times as sweet as ]. It has been given the ] E962.<ref>{{cite news |title= Holland Sweetener rolls out Twinsweet |url= http://www.bakeryandsnacks.com/Processing-Packaging/Holland-Sweetener-rolls-out-Twinsweet |accessdate= July 29, 2011 |newspaper= BakeryAndSnacks.com |publisher= William Reed Business Media |date= November 19, 2003}}</ref> |
|
|
|
|
|
==History== |
|
==History== |
|
|
|
|
|
Aspartame-acesulfame salt was invented in 1995 by sweetener expert Dr John Fry<ref>US Patent 5827562, Sweetener Salts</ref> while working for The Holland Sweetener Company (HSC), a subsidiary of DSM |DSM. HSC marketed it with the name Twinsweet. It was approved for use as an artificial sweetener in the European Parliament and Council Directive 94/35 EC as amended by Directive 2003/ 115/ EC in 2003. It has been given the ] E962.<ref>{{cite news |title= Holland Sweetener rolls out Twinsweet |url= http://www.bakeryandsnacks.com/Processing-Packaging/Holland-Sweetener-rolls-out-Twinsweet |accessdate= July 29, 2011 |newspaper= BakeryAndSnacks.com |publisher= William Reed Business Media |date= November 19, 2003}}</ref> In North America it falls under the same regulations as aspartame and acesulfame-K, and is also approved for use in China, Russia, Hong-Kong, Australia and New Zealand. |
|
Aspartame-acesulfame salt was invented in 1995 by sweetener expert Dr John Fry<ref>US Patent 5827562, Sweetener Salts</ref> while working for The Holland Sweetener Company (HSC), a subsidiary of ]. HSC marketed it with the name Twinsweet. It was approved for use as an artificial sweetener in the European Parliament and Council Directive 94/35 EC as amended by Directive 2003/115/EC in 2003. In North America, it falls under the same regulations as aspartame and acesulfame-K. It is also approved for use in China, Russia, Hong Kong, Australia, and New Zealand. |
|
|
|
|
|
In December 2006 HSC ceased all of its aspartame operations, citing a glut in the market driving prices below profitable values.<ref>{{cite news | title=DSM pulls out of aspartame market | publisher=FoodNavigator | url=http://www.foodnavigator-usa.com/news-by-product/news.asp?id=66736 | date=2006-03-30 }}</ref> The rights to aspartame-acesulfame are now owned by The NutraSweet Company Inc who have continued to market the sweetener successfully in the USA and EU. |
|
In December 2006, HSC ceased all of its aspartame operations, citing a glut in the market driving prices below profitable values.<ref>{{cite news|title=DSM pulls out of aspartame market |publisher=FoodNavigator |url=http://www.foodnavigator-usa.com/news-by-product/news.asp?id=66736 |date=2006-03-30 }}{{dead link|date=July 2017 |bot=InternetArchiveBot |fix-attempted=yes }}</ref> The rights to aspartame-acesulfame are now owned by The NutraSweet Company Inc., who has continued to market the sweetener successfully in the United States and European Union. |
|
|
|
|
|
==References== |
|
==References== |
| Line 47: |
Line 57: |
|
|
|
|
|
==External links== |
|
==External links== |
|
|
*{{Commonscatinline}} |
|
* |
|
* |
|
|
|
|
|
{{E number infobox 950-969}} |
|
{{E number infobox 950-969}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
] |
|