| Revision as of 14:21, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 477352304 of page Axillarin for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 03:10, 24 December 2024 edit Citation bot (talk | contribs)Bots5,418,807 edits Added bibcode. | Use this bot. Report bugs. | Suggested by Whoop whoop pull up | Category:O-methylated flavonols | #UCB_Category 31/33 |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 460346913 |
|
| verifiedrevid = 477369433 |
|
| Name = Axillarin |
|
| Name = Axillarin |
|
| ImageFile = Axillarin.PNG |
|
| ImageFile = Axillarin.svg |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| ImageName = Chemical structure of axillarin |
|
| ImageName = Chemical structure of axillarin |
|
| IUPACName = 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,6-dimethoxychromen-4-one |
|
| PIN = 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3,6-dimethoxy-4''H''-1-benzopyran-4-one |
|
| OtherNames = DMQT<br>3,6-Dimethoxyquercetagetin<br>Quercetagetin 3,6-dimethyl ether<br>3',4',5,7-Tetrahydroxy-3,6-dimethoxyflavone |
|
| OtherNames = {{ubl|2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3,6-dimethoxy-4''H''-chromen-4-one|DMQT|3,6-Dimethoxyquercetagetin|Quercetagetin 3,6-dimethyl ether|3',4',5,7-Tetrahydroxy-3,6-dimethoxyflavone}} |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo = <!-- blanked - oldvalue: 5188-73-8 --> |
|
| CASNo = 5188-73-8 |
|
| CASNo_Ref = {{cascite|correct|??}}= |
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASOther = |
|
| CASNoOther = |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = CF7D7U7ZK2 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 487810 |
|
| ChEMBL = 487810 |
|
| PubChem = 5281603 |
|
| PubChem = 5281603 |
|
| SMILES = COC1=C(C=C2C(=C1O)C(=O)C(=C(O2)C3=CC(=C(C=C3)O)O)OC)O |
|
| SMILES = COC1=C(C=C2C(=C1O)C(=O)C(=C(O2)C3=CC(=C(C=C3)O)O)OC)O |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4444922 |
|
| ChemSpiderID = 4444922 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
| ⚫ |
| InChI = 1/C17H14O8/c1-23-16-10(20)6-11-12(13(16)21)14(22)17(24-2)15(25-11)7-3-4-8(18)9(19)5-7/h3-6,18-21H,1-2H3 |
|
|
|
| ChEBI = 2941 |
| ⚫ |
| InChIKey = KIGVXRGRNLQNNI-UHFFFAOYAX |
|
|
⚫ |
| InChI = 1/C17H14O8/c1-23-16-10(20)6-11-12(13(16)21)14(22)17(24-2)15(25-11)7-3-4-8(18)9(19)5-7/h3-6,18-21H,1-2H3 |
| ⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
⚫ |
| InChIKey = KIGVXRGRNLQNNI-UHFFFAOYAX |
|
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C17H14O8/c1-23-16-10(20)6-11-12(13(16)21)14(22)17(24-2)15(25-11)7-3-4-8(18)9(19)5-7/h3-6,18-21H,1-2H3 |
|
| StdInChI = 1S/C17H14O8/c1-23-16-10(20)6-11-12(13(16)21)14(22)17(24-2)15(25-11)7-3-4-8(18)9(19)5-7/h3-6,18-21H,1-2H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = KIGVXRGRNLQNNI-UHFFFAOYSA-N |
|
| StdInChIKey = KIGVXRGRNLQNNI-UHFFFAOYSA-N |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=17 | H=14 | O=8 |
|
| Formula = C<sub>17</sub>H<sub>14</sub>O<sub>8</sub> |
|
|
| MolarMass = 346.28 g/mol |
|
|
| ExactMass = 346.068867 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = 1.659 g/mL |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Axillarin''' is an ]. It can be found in '']'', '']'', '']'',<ref>{{cite journal|doi=10.1021/np990271r | volume=63 | issue=1 | title=Acylated Flavonol Glycosides from the Flower ofInula britannica | year=2000 | journal=Journal of Natural Products | pages=34–36 | last1 = Jung Park | first1 = Eun | last2 = Kim | first2 = Youngleem | last3 = Kim | first3 = Jinwoong| pmid=10650074 }}</ref> '']'' in '']''<ref>{{cite journal | doi = 10.1016/S0031-9422(00)83143-X| title = Methylated flavonols from Wyethia bolanderi and Balsamorhiza macrophylla| journal = Phytochemistry| volume = 24| issue = 9| pages = 2133| year = 1985| last1 = McCormick| first1 = Susan| last2 = Robson| first2 = Kathleen| last3 = Bohm| first3 = Bruce| bibcode = 1985PChem..24.2133M}}</ref> and in '']''.<ref name="Parral">{{cite journal | last = Álvarez | first =Ángel L. |author2=Habtemariam Solomon |author3=Juan-Badaturuge Malindra |author4=Jackson Caroline |author5=Parra Francisco | title =In vitro anti HSV-1 and HSV-2 activity of ''Tanacetum vulgare'' extracts and isolated compounds: An approach to their mechanisms of action | journal =Phytotherapy Research | volume =25 | issue =2 | pages =296–301 | year =2011| doi =10.1002/ptr.3382| pmid=21171142| s2cid =9011931 | url =https://hal.archives-ouvertes.fr/hal-00601639 | type =Submitted manuscript }}</ref> It can also be synthesized.<ref>{{cite journal | doi = 10.1007/BF02144856| title = The syntheses of axillarin and its related compounds| journal = Experientia| volume = 24| issue = 8| pages = 769–770| year = 1968| last1 = Fukui| first1 = K.| last2 = Nakayama| first2 = M.| last3 = Horie| first3 = T.| s2cid = 33789154}}</ref> |
|
|
|
|
|
== Glycosides == |
|
|
] can be found in '']'', a plant used in traditional herbal medicine the Andean provinces of Argentina.<ref>{{cite journal | url = http://www.znaturforsch.com/ac/v59c/s59c0345.pdf | title = Free Radical Scavengers and Antioxidants from Tagetes mendocina | author = Guillermo Schmeda-Hirschmann, Alejandro Tapia, Cristina Theoduloz, Jaime Rodrıguez, Susana Lopez and Gabriela Egly Feresin | journal = Verlag der Zeitschrift für Naturforschung | volume = 59c | pages = 345–353| date = 2004}}</ref> |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
{{Flavonol}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{aromatic-stub}} |