| Revision as of 07:29, 11 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chembox validation|Chem/Drugb← Previous edit |
Latest revision as of 23:14, 29 January 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers172,412 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| (20 intermediate revisions by 17 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{unreferenced|date=June 2011}} |
|
|
{{drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 443223758 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 444222259 |
|
⚫ |
| IUPAC_name = 6--3,3-dimethyl-7-oxo-4-thia-1-azabicycloheptane-2-carboxylic acid |
|
⚫ |
| image = Azidocillin.svg |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
|
| routes_of_administration = Oral, ], ] |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = 57–64% |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = 0.6-1.1 hrs |
|
|
| excretion = 37–50% active substance in urine |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 17243-38-8 |
|
⚫ |
| ATC_prefix = J01 |
|
⚫ |
| ATC_suffix = CE04 |
|
⚫ |
| PubChem = 71886 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = DB08795 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 2105907 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 16735689 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = R8XDP7L3SL |
|
| UNII = R8XDP7L3SL |
|
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
| ⚫ |
| IUPAC_name = 6--3,3-dimethyl-7-oxo-4-thia-1-azabicycloheptane-2-carboxylic acid |
|
|
⚫ |
| KEGG = D07235 |
| ⚫ |
| image = Azidocillin.png |
|
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
⚫ |
| ChEBI = 51758 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=16 | H=17 | N=5 | O=4 | S=1 |
|
⚫ |
| smiles = O=C(O)2N3C(=O)(NC(=O)(\N==)c1ccccc1)3SC2(C)C |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C16H17N5O4S/c1-16(2)11(15(24)25)21-13(23)10(14(21)26-16)18-12(22)9(19-20-17)8-6-4-3-5-7-8/h3-7,9-11,14H,1-2H3,(H,18,22)(H,24,25)/t9-,10-,11+,14-/m1/s1 |
|
| StdInChI = 1S/C16H17N5O4S/c1-16(2)11(15(24)25)21-13(23)10(14(21)26-16)18-12(22)9(19-20-17)8-6-4-3-5-7-8/h3-7,9-11,14H,1-2H3,(H,18,22)(H,24,25)/t9-,10-,11+,14-/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = ODFHGIPNGIAMDK-NJBDSQKTSA-N |
|
| StdInChIKey = ODFHGIPNGIAMDK-NJBDSQKTSA-N |
| ⚫ |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ⚫ |
| ChEBI = 51758 |
|
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ⚫ |
| ChemSpiderID = 16735689 |
|
|
| InChI = 1/C16H17N5O4S/c1-16(2)11(15(24)25)21-13(23)10(14(21)26-16)18-12(22)9(19-20-17)8-6-4-3-5-7-8/h3-7,9-11,14H,1-2H3,(H,18,22)(H,24,25)/t9-,10-,11+,14-/m1/s1 |
|
| ⚫ |
| smiles = O=C(O)2N3C(=O)(NC(=O)(\N==)c1ccccc1)3SC2(C)C |
|
|
| InChIKey = ODFHGIPNGIAMDK-NJBDSQKTBL |
|
| ⚫ |
| CAS_number = 17243-38-8 |
|
| ⚫ |
| ATC_prefix = J01 |
|
| ⚫ |
| ATC_suffix = CE04 |
|
| ⚫ |
| PubChem = 71886 |
|
| ⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| ⚫ |
| DrugBank = DB08795 |
|
| ⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| ⚫ |
| KEGG = D07235 |
|
| ⚫ |
| C=16|H=17|N=5|O=4|S=1 |
|
|
| molecular_weight = 375.40228 |
|
| ⚫ |
| bioavailability = |
|
| ⚫ |
| protein_bound = |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life = |
|
|
| excretion = |
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| ⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
|
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
'''Azidocillin''' is a type of ].<ref>{{cite journal | vauthors = Axelsson A, Jensen C, Melin O, Singer F, von Sydow C | title = Treatment of acute maxillary sinusitis. V. Amoxicillin azidocillin, phenylpropanolamine and pivampicillin | journal = Acta Oto-Laryngologica | volume = 91 | issue = 3–4 | pages = 313–8 | year = 1981 | pmid = 6894819 | doi = 10.3109/00016488109138513 }}</ref><ref>{{cite journal | vauthors = Bergan T, Sørensen G | title = Pharmacokinetics of azidocillin in healthy adults | journal = Arzneimittel-Forschung | volume = 30 | issue = 12 | pages = 2185–91 | year = 1980 | pmid = 6894241 }}</ref> |
|
'''Azidocillin''' is a type of ]. |
|
|
|
|
|
|
|
== References == |
| ⚫ |
{{Cell wall disruptive antibiotics}} |
|
|
|
{{reflist}} |
|
|
|
|
|
⚫ |
{{Cell wall disruptive antibiotics}} |
|
|
|
|
|
⚫ |
] |
|
|
|
|
|
] |
|
{{antibiotic-stub}} |
|
|
|
|
|
] |
|
| ⚫ |
] |
|