| Revision as of 14:25, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 477352970 of page BIBP-3226 for the Chem/Drugbox validation project (updated: 'CAS_number'). |
Latest revision as of 10:32, 11 January 2024 edit Maxim Masiutin (talk | contribs)Extended confirmed users, IP block exemptions, Pending changes reviewers31,042 edits Added s2cid. Added the cs1 style template to denote Vancouver ("vanc") citation style, because references contain "vauthors" attribute to specify the list of authors. |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
|
{{cs1 config|name-list-style=vanc}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 462337276 |
|
| verifiedrevid = 477369930 |
|
| IUPAC_name = (2R)-5-(diaminomethylideneamino)-2-(amino)-N-pentanamide |
|
| IUPAC_name = (2R)-5-(diaminomethylideneamino)-2-(amino)-N-pentanamide |
|
| image = BIBP-3226_structure.png |
|
| image = BIBP-3226 Structure.svg |
|
| width = 300 |
|
| width = 300 |
|
|
|
|
| Line 17: |
Line 18: |
|
| legal_US = <!-- Schedule I / Schedule II / Schedule III --> |
|
| legal_US = <!-- Schedule I / Schedule II / Schedule III --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 159013-54-4 --> |
|
| CAS_number = 159013-54-4 |
|
| ATC_prefix = |
|
| ATC_prefix = |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 332347 |
|
| ChEMBL = 332347 |
|
| PubChem = 5311023 |
|
| PubChem = 5311023 |
| Line 37: |
Line 38: |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4470561 |
|
| ChemSpiderID = 4470561 |
|
| InChI = 1/C27H31N5O3/c28-27(29)30-17-7-12-23(25(34)31-18-19-13-15-22(33)16-14-19)32-26(35)24(20-8-3-1-4-9-20)21-10-5-2-6-11-21/h1-6,8-11,13-16,23-24,33H,7,12,17-18H2,(H,31,34)(H,32,35)(H4,28,29,30)/t23-/m1/s1 |
|
|
| InChIKey = KUWBXRGRMQZCSS-HSZRJFAPBL |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C27H31N5O3/c28-27(29)30-17-7-12-23(25(34)31-18-19-13-15-22(33)16-14-19)32-26(35)24(20-8-3-1-4-9-20)21-10-5-2-6-11-21/h1-6,8-11,13-16,23-24,33H,7,12,17-18H2,(H,31,34)(H,32,35)(H4,28,29,30)/t23-/m1/s1 |
|
| StdInChI = 1S/C27H31N5O3/c28-27(29)30-17-7-12-23(25(34)31-18-19-13-15-22(33)16-14-19)32-26(35)24(20-8-3-1-4-9-20)21-10-5-2-6-11-21/h1-6,8-11,13-16,23-24,33H,7,12,17-18H2,(H,31,34)(H,32,35)(H4,28,29,30)/t23-/m1/s1 |
| Line 46: |
Line 45: |
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=27 | H=31 | N=5 | O=3 |
|
| C=27 | H=31 | N=5 | O=3 |
|
| molecular_weight = 473.566 g/mol |
|
|
| smiles = C1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)N(CCCN=C(N)N)C(=O)NCC3=CC=C(C=C3)O |
|
| smiles = C1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)N(CCCN=C(N)N)C(=O)NCC3=CC=C(C=C3)O |
|
| synonyms = BIBP-3226 |
|
| synonyms = BIBP-3226 |
|
}} |
|
}} |
|
|
|
|
|
'''BIBP-3226''' is a drug used in scientific research which acts as a potent and selective ] for both the ] receptor ]<ref name="pmid7705422">{{cite journal | vauthors = Rudolf K, Eberlein W, Engel W, Wieland HA, Willim KD, Entzeroth M, Wienen W, Beck-Sickinger AG, Doods HN | title = The first highly potent and selective non-peptide neuropeptide Y Y1 receptor antagonist: BIBP3226 | journal = European Journal of Pharmacology | volume = 271 | issue = 2–3 | pages = R11–3 |date=December 1994 | pmid = 7705422 | doi = 10.1016/0014-2999(94)90822-2}}</ref> and also the ].<ref name="pmid16762456">{{cite journal | vauthors = Fang Q, Guo J, He F, Peng YL, Chang M, Wang R | title = In vivo inhibition of neuropeptide FF agonism by BIBP3226, an NPY Y1 receptor antagonist | journal = Peptides | volume = 27 | issue = 9 | pages = 2207–13 |date=September 2006 | pmid = 16762456 | doi = 10.1016/j.peptides.2006.04.002 | s2cid = 34414256 }}</ref> It was the first non-peptide antagonist developed for the Y<sub>1</sub> receptor and has been widely used to help determine its functions in the body. Activation of Y<sub>1</sub> is thought to be involved in functions such as regulation of appetite<ref name="pmid9723965">{{cite journal | vauthors = Kask A, Rägo L, Harro J | title = Evidence for involvement of neuropeptide Y receptors in the regulation of food intake: studies with Y1-selective antagonist BIBP3226 | journal = ] | volume = 124 | issue = 7 | pages = 1507–15 |date=August 1998 | pmid = 9723965 | pmc = 1565528 | doi = 10.1038/sj.bjp.0701969 }}</ref> and anxiety,<ref name="pmid12034130">{{cite journal | vauthors = Kask A, Harro J, von Hörsten S, Redrobe JP, Dumont Y, Quirion R | title = The neurocircuitry and receptor subtypes mediating anxiolytic-like effects of neuropeptide Y | journal = Neuroscience and Biobehavioral Reviews | volume = 26 | issue = 3 | pages = 259–83 |date=May 2002 | pmid = 12034130 | doi = 10.1016/S0149-7634(01)00066-5| s2cid = 34688422 }}</ref> and BIBP-3226 has ]<ref name="pmid9802417">{{cite journal | vauthors = Kask A, Rägo L, Harro J | title = Anxiogenic-like effect of the NPY Y1 receptor antagonist BIBP3226 administered into the dorsal periaqueductal gray matter in rats | journal = Regulatory Peptides | volume = 75-76 | pages = 255–62 |date=September 1998 | pmid = 9802417 | doi = 10.1016/S0167-0115(98)00076-7| s2cid = 19193956 }}</ref> and ] effects, as well as blocking the Y<sub>1</sub>-mediated ] release.<ref name="pmid17463058">{{cite journal | vauthors = Dimitrov EL, DeJoseph MR, Brownfield MS, Urban JH | title = Involvement of neuropeptide Y Y1 receptors in the regulation of neuroendocrine corticotropin-releasing hormone neuronal activity | journal = Endocrinology | volume = 148 | issue = 8 | pages = 3666–73 |date=August 2007 | pmid = 17463058 | doi = 10.1210/en.2006-1730 | doi-access = free }}</ref> It has also been used as a ] to develop a number of newer more potent Y<sub>1</sub> antagonists.<ref name="pmid10915060">{{cite journal | vauthors = Aiglstorfer I, Hendrich I, Moser C, Bernhardt G, Dove S, Buschauer A | title = Structure-activity relationships of neuropeptide Y Y1 receptor antagonists related to BIBP 3226 | journal = Bioorganic & Medicinal Chemistry Letters | volume = 10 | issue = 14 | pages = 1597–600 |date=July 2000 | pmid = 10915060 | doi = 10.1016/S0960-894X(00)00292-4}}</ref><ref name="pmid18851917">{{cite journal | vauthors = Weiss S, Keller M, Bernhardt G, Buschauer A, König B | title = Modular synthesis of non-peptidic bivalent NPY Y1 receptor antagonists | journal = Bioorganic & Medicinal Chemistry | volume = 16 | issue = 22 | pages = 9858–66 |date=November 2008 | pmid = 18851917 | doi = 10.1016/j.bmc.2008.09.033 }}</ref> |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
] |
|
|
|
|
|
|
|
|
{{nervous-system-drug-stub}} |