| Revision as of 18:36, 11 December 2010 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:Wi← Previous edit |
Latest revision as of 14:58, 23 March 2022 edit undoKoIobok (talk | contribs)Extended confirmed users1,350 edits Added Category:Phenylethanolamine ethers |
| (12 intermediate revisions by 12 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 401812293 |
|
| verifiedrevid = 401813978 |
|
| ImageFile1 = 3,4,5,beta-tetramethoxyphenethylamine.png |
|
| ImageFile1 = 3,4,5,beta-tetramethoxyphenethylamine.png |
|
| ImageSize1 = |
|
| ImageSize1 = |
|
| ImageFile2 = BOM-3d-sticks.png |
|
| ImageFile2 = BOM-3d-sticks.png |
|
| ImageSize2 = |
|
| ImageSize2 = |
|
|
| Name = BOM |
|
| IUPACName = 2-methoxy-2-(3,4,5-trimethoxyphenyl)ethanamine |
|
| PIN = 2-Methoxy-2-(3,4,5-trimethoxyphenyl)ethan-1-amine |
|
| OtherNames = 3,4,5,beta-Tetramethoxyphenethylamine<br>2-(3,4,5,beta-Tetramethoxyphenyl)ethanamine |
|
| OtherNames = 3,4,5,beta-Tetramethoxyphenethylamine<br>2-(3,4,5,beta-Tetramethoxyphenyl)ethanamine<br/>β-methoxymescaline |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| InChIKey = GAKIJEPUVBHWCK-UHFFFAOYAE |
|
| InChIKey = GAKIJEPUVBHWCK-UHFFFAOYAE |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| Line 15: |
Line 16: |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 98537-40-7 |
|
| CASNo = 98537-40-7 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = ZYL4Q2506P |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID=21106265 |
|
| ChemSpiderID=21106265 |
|
| PubChem = |
|
| PubChem = 44719490 |
|
| SMILES = COc1c(cc(cc1OC)C(CN)OC)OC |
|
| SMILES = COc1c(cc(cc1OC)C(CN)OC)OC |
|
| InChI = 1/C12H19NO4/c1-14-9-5-8(11(7-13)16-3)6-10(15-2)12(9)17-4/h5-6,11H,7,13H2,1-4H3 |
|
| InChI = 1/C12H19NO4/c1-14-9-5-8(11(7-13)16-3)6-10(15-2)12(9)17-4/h5-6,11H,7,13H2,1-4H3 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=12 |
|
| Formula = C<sub>12</sub>H<sub>19</sub>NO<sub>4</sub> |
|
|
|
| H=19 |
|
| MolarMass = 241.28 g/mol |
|
|
|
| N=1 |
|
|
| O=4 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
| Line 29: |
Line 34: |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
'''BOM''', or 3,4,5,beta-tetra]], is a lesser-known ]. It is the beta-] ] of ]. BOM was first synthesized by ]. In his book '']'', the minimum dosage is listed as 200 mg, and the duration unknown. BOM produces few to no effects.<ref>{{CitePiHKAL}}</ref> Very little data exists about its pharmacological properties, metabolism, and toxicity. |
|
'''BOM''' ('''3,4,5,beta-tetramethoxyphenethylamine''') is a lesser-known ]. It is the beta-] ] of ]. BOM was first synthesized by ]. In his book '']'', the minimum dosage is listed as 200 mg, and the duration unknown.<ref></ref> BOM produces few to no effects.<ref>{{CitePiHKAL}}</ref> Very little data exists about its pharmacological properties, metabolism, and toxicity. |
|
|
|
|
|
==References== |
|
==Legality== |
|
|
|
| ⚫ |
{{reflist}} |
|
|
|
===United Kingdom=== |
|
|
This substance is a Class A drug in the ].<ref>{{cite web | title = UK Misuse of Drugs act 2001 Amendment summary | url = http://isomerdesign.com/Cdsa/scheduleUK.php?schedule=1&ion=30&structure=C | accessdate = 12 March 2014 | publisher = Isomer Design}}</ref> |
|
|
|
|
|
== See also == |
|
== See also == |
|
|
|
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
|
|
|
|
|
==References== |
|
== External links == |
|
|
⚫ |
{{reflist}} |
|
* |
|
|
* |
|
|
|
|
|
{{PiHKAL}} |
|
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|