Revision as of 14:31, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 463560536 of page Bazinaprine for the Chem/Drugbox validation project (updated: 'UNII', 'ChEMBL', 'CAS_number'). |
Latest revision as of 13:17, 10 July 2023 edit JJMC89 bot III (talk | contribs)Bots, Administrators3,678,000 editsm Moving Category:4-Morpholinyl compunds to Category:4-Morpholinyl compounds per Misplaced Pages:Categories for discussion/Speedy |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
|
| verifiedrevid = 477370741 |
|
| IUPAC_name = 3-{amino}-6-phenylpyridazine-4-carbonitrile |
|
| IUPAC_name = 3-{amino}-6-phenylpyridazine-4-carbonitrile |
|
| image = Bazinaprine.svg |
|
| image = Bazinaprine.svg |
|
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 94011-82-2 --> |
|
| CAS_number = 94011-82-2 |
|
| ATC_prefix = None |
|
| ATC_prefix = None |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = NU8Y4C529J |
|
| UNII = NU8Y4C529J |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 150365 |
|
| ChEMBL = 150365 |
|
| PubChem = 72119 |
|
| PubChem = 72119 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 65096 |
|
| ChemSpiderID = 65096 |
|
| C = 17 | H = 19 | N = 5 | O = 1 |
|
| C = 17 | H = 19 | N = 5 | O = 1 |
|
| molecular_weight = 309.366 g/mol |
|
|
| smiles = N#Cc2cc(nnc2NCCN1CCOCC1)c3ccccc3 |
|
| smiles = N#Cc2cc(nnc2NCCN1CCOCC1)c3ccccc3 |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| InChI = 1/C17H19N5O/c18-13-15-12-16(14-4-2-1-3-5-14)20-21-17(15)19-6-7-22-8-10-23-11-9-22/h1-5,12H,6-11H2,(H,19,21) |
|
|
| InChIKey = KRNDIPHOJLIHRI-UHFFFAOYAK |
|
|
| StdInChI = 1S/C17H19N5O/c18-13-15-12-16(14-4-2-1-3-5-14)20-21-17(15)19-6-7-22-8-10-23-11-9-22/h1-5,12H,6-11H2,(H,19,21) |
|
| StdInChI = 1S/C17H19N5O/c18-13-15-12-16(14-4-2-1-3-5-14)20-21-17(15)19-6-7-22-8-10-23-11-9-22/h1-5,12H,6-11H2,(H,19,21) |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = KRNDIPHOJLIHRI-UHFFFAOYSA-N |
|
| StdInChIKey = KRNDIPHOJLIHRI-UHFFFAOYSA-N |
|
| bioavailability = |
|
| bioavailability = |
Line 26: |
Line 31: |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
}} |
|
}} |
|
|
|
|
|
'''Bazinaprine''' ('''SR-95,191''') is an experimental drug candidate. It is a ] (MAOI) which is believed to be useful for the treatment of ]. The drug strongly inhibits type A ], but only weakly inhibits type B. The effects of the drug are reversible ], but not ].<ref name=88newderivative>{{cite journal | vauthors = Kan JP, Steinberg R, Leclercq J, Worms P, Biziere K | title = Monoamine oxidase-inhibiting properties of SR 95191, a new pyridazine derivative, in the rat: evidence for selective and reversible inhibition of monoamine oxidase type A in vivo but not in vitro | journal = Journal of Neurochemistry | volume = 50 | issue = 4 | pages = 1137–44 | date = April 1988 | pmid = 3346672 | doi = 10.1111/j.1471-4159.1988.tb10584.x | s2cid = 12521641 }}</ref> In studies, the chemical has been shown to not interact ''in vivo'' with other neurotransmitter or drug receptor sites.<ref name=87MAOI>{{cite journal | vauthors = Kan JP, Steinberg R, Mouget-Goniot C, Worms P, Bizière K | title = SR 95191, a selective inhibitor of type A monoamine oxidase with dopaminergic properties. II. Biochemical characterization of monoamine oxidase inhibition | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 240 | issue = 1 | pages = 251–8 | date = January 1987 | pmid = 3100771 | url = http://jpet.aspetjournals.org/cgi/pmidlookup?view=long&pmid=3100771 }}</ref> |
|
|
|
|
|
== See also == |
|
|
* ] (RIMA) |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
{{Antidepressants}} |
|
|
{{Monoamine metabolism modulators}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |