| Revision as of 10:46, 21 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,054 edits Saving copy of the {{drugbox}} taken from revid 461519097 of page Bekanamycin for the Chem/Drugbox validation project (updated: 'ChEMBL', 'ChEBI', 'CAS_number'). |
Latest revision as of 07:46, 4 July 2023 edit Eastmain (talk | contribs)Extended confirmed users, New page reviewers, Pending changes reviewers, Rollbackers53,878 edits + {{Cite web |last=PubChem |title=Bekanamycin |url=https://pubchem.ncbi.nlm.nih.gov/compound/439318 |access-date=2023-07-04 |website=pubchem.ncbi.nlm.nih.gov |language=en}}Tag: 2017 wikitext editor |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 461517751 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| IUPAC_name = (2''S'',3''R'',4''S'',5''S'',6''R'')-4-amino-2-{oxy}-2-hydroxycyclohexyl]oxy}-6-(hydroxymethyl)oxane-3,5-diol |
|
|
⚫ |
| verifiedrevid = 461747587 |
|
⚫ |
| IUPAC_name = (2''S'',3''R'',4''S'',5''S'',6''R'')-4-amino-2-<nowiki/>{oxy}-2-hydroxycyclohexyl]oxy}-6-(hydroxymethyl)oxane-3,5-diol |
|
| image = Bekanamycin.png |
|
| image = Bekanamycin.png |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| Drugs.com = {{drugs.com|international|bekanamycin}} |
|
| Drugs.com = {{drugs.com|international|bekanamycin}} |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
| Line 16: |
Line 18: |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = Rx-only |
|
| legal_status = Rx-only |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 4696-76-8 --> |
|
| CAS_number = 4696-76-8 |
|
| CAS_supplemental = |
|
| CAS_supplemental = |
|
| ATC_prefix = none |
|
| ATC_prefix = J01 |
|
| ATC_suffix = |
|
| ATC_suffix = GB13 |
|
| ATC_supplemental = |
|
| ATC_supplemental = |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 15JT14C3GI |
|
| UNII = 15JT14C3GI |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 176 |
|
| ChEMBL = 176 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 28098 |
|
| ChEBI = 28098 |
|
| PubChem = 439318 |
|
| PubChem = 439318 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 388449 |
|
| ChemSpiderID = 388449 |
|
|
| NIAID_ChemDB = 005087 |
| ⚫ |
| SMILES = C1((((1N)O2((((O2)CO)O)N)O)O)O3((((O3)CN)O)O)N)N |
|
| ⚫ |
| InChI = 1/C18H37N5O10/c19-2-6-11(26)12(27)9(23)17(30-6)32-15-4(20)1-5(21)16(14(15)29)33-18-13(28)8(22)10(25)7(3-24)31-18/h4-18,24-29H,1-3,19-23H2/t4-,5+,6+,7+,8-,9+,10+,11+,12+,13+,14-,15+,16-,17+,18+/m0/s1 |
|
| ⚫ |
| InChIKey = SKKLOUVUUNMCJE-FQSMHNGLBM |
|
| ⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C18H37N5O10/c19-2-6-11(26)12(27)9(23)17(30-6)32-15-4(20)1-5(21)16(14(15)29)33-18-13(28)8(22)10(25)7(3-24)31-18/h4-18,24-29H,1-3,19-23H2/t4-,5+,6+,7+,8-,9+,10+,11+,12+,13+,14-,15+,16-,17+,18+/m0/s1 |
|
| ⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChIKey = SKKLOUVUUNMCJE-FQSMHNGLSA-N |
|
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| chemical_formula = |
|
| chemical_formula = |
|
| C=18 | H=37 | As= | N=5 | O=10 |
|
| C=18 | H=37 | N=5 | O=10 |
|
⚫ |
| smiles = C1((((1N)O2((((O2)CO)O)N)O)O)O3((((O3)CN)O)O)N)N |
|
| molecular_weight = 483.51 g/mol |
|
|
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| smiles = C1(((C(1N)O2((((O2)CO)O)N)O)O)O3((((O3)CN)O)O)N)N |
|
|
⚫ |
| StdInChI = 1S/C18H37N5O10/c19-2-6-11(26)12(27)9(23)17(30-6)32-15-4(20)1-5(21)16(14(15)29)33-18-13(28)8(22)10(25)7(3-24)31-18/h4-18,24-29H,1-3,19-23H2/t4-,5+,6+,7+,8-,9+,10+,11+,12+,13+,14-,15+,16-,17+,18+/m0/s1 |
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = SKKLOUVUUNMCJE-FQSMHNGLSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Bekanamycin''' (]; '''kanamycin B''') is an ] ].<ref>{{cite journal | vauthors = Morales MA, Castrillon JL, Hernandez DA | title = Effects of bekanamycin and dibekacin on the electrical activity of cardiac pacemaker cells | journal = Archives of Medical Research | volume = 24 | issue = 4 | pages = 339–45 | year = 1993 | pmid = 8118157 }}</ref><ref>{{Cite web |last=PubChem |title=Bekanamycin |url=https://pubchem.ncbi.nlm.nih.gov/compound/439318 |access-date=2023-07-04 |website=pubchem.ncbi.nlm.nih.gov |language=en}}</ref> |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
{{AminoglycosideAntiBiotics}} |
|
|
|
|
|
] |
|
|
|
|
|
{{antibiotic-stub}} |