| Revision as of 22:47, 7 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,071 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'StdInChI', 'StdInChIKey', 'CAS_number').← Previous edit |
Latest revision as of 01:08, 5 April 2024 edit undoInnerstream (talk | contribs)Autopatrolled, Extended confirmed users4,142 editsmNo edit summary |
| (40 intermediate revisions by 19 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| IUPAC_name = phenylmethyl 2-cyclohexanecarbonyl]oxybenzoate |
|
|
|
| verifiedrevid = 459532473 |
| ⚫ |
| image = Benexate.png |
|
|
⚫ |
| IUPAC_name = Phenylmethyl 2-cyclohexanecarbonyl]oxybenzoate |
|
⚫ |
| image = Benexate.svg |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
| Line 21: |
Line 24: |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number = <!-- blanked - oldvalue: 78718-52-2 --> |
|
| CAS_number = 78718-52-2 |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
| ATC_supplemental = |
|
| ATC_supplemental = |
|
|
| ChEMBL = CHEMBL2104696 |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C23H27N3O4/c24-23(25)26-14-16-10-12-18(13-11-16)21(27)30-20-9-5-4-8-19(20)22(28)29-15-17-6-2-1-3-7-17/h1-9,16,18H,10-15H2,(H4,24,25,26) |
|
| StdInChI = 1S/C23H27N3O4/c24-23(25)26-14-16-10-12-18(13-11-16)21(27)30-20-9-5-4-8-19(20)22(28)29-15-17-6-2-1-3-7-17/h1-9,16,18H,10-15H2,(H4,24,25,26) |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = IAXUQWSLRKIRFR-UHFFFAOYSA-N |
|
| StdInChIKey = IAXUQWSLRKIRFR-UHFFFAOYSA-N |
|
| PubChem = 2316 |
|
| PubChem = 2316 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 2226 |
|
| ChemSpiderID = 2226 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| Line 37: |
Line 45: |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| chemical_formula = |
|
|
| C=23 | H=27 | N=3 | O=4 |
|
| C=23 | H=27 | N=3 | O=4 |
|
| molecular_weight = 409.47 g/mol |
|
|
| smiles = O=C(OCc1ccccc1)c3ccccc3OC(=O)C2CCC(C/N=C(\N)N)CC2 |
|
| smiles = O=C(OCc1ccccc1)c3ccccc3OC(=O)C2CCC(C/N=C(\N)N)CC2 |
|
| InChI = 1/C23H27N3O4/c24-23(25)26-14-16-10-12-18(13-11-16)21(27)30-20-9-5-4-8-19(20)22(28)29-15-17-6-2-1-3-7-17/h1-9,16,18H,10-15H2,(H4,24,25,26) |
|
|
| InChIKey = IAXUQWSLRKIRFR-UHFFFAOYAF |
|
|
}} |
|
}} |
|
|
|
|
|
|
'''Benexate''' (BEX) is an anti-ulcer agent used in the treatment of acid-related disorders. It is unique in its inability to form salts that are both non-bitter and soluble.<ref>{{cite journal | vauthors = Hori Y, Odaguchi K, Jyoyama H, Yasui K, Mizui T | title = Differential effect of benexate hydrochloride betadex on prostaglandin levels in stomach and inflammatory sites in rats | journal = Japanese Journal of Pharmacology| issue = 2 | pages = 183–190 | date = 1996| volume = 72 | pmid = 8912919| doi = 10.1254/jjp.72.183 | doi-access = free }}</ref><ref>{{cite journal | vauthors = Muranushi N, Yoshida M, Kinoshita H, Hirose F, Fukuda T, Doteuchi M, Yamada H | title = Studies of benexate CD: effect of inclusion compound formation on the antiulcer activity of benexate, the effective ingredient of benexate CD. | journal = Folia Pharmacologica Japonica | issue = 91| pages = 377–383 | date = 1998 }}</ref> |
|
'''Benexate''' (]) is a drug used in the treatment of acid-related disorders. |
|
|
|
|
|
|
|
== Medical uses == |
| ⚫ |
] |
|
|
|
Benexate is approved from treatment of ] in Japan.<ref>{{cite web | url = https://drugs.ncats.io/drug/O3PR2X907M | title = Benexate | work = Inxight Drugs | publisher = National Center for Advancing Translational Sciences }}</ref> |
| ⚫ |
] |
|
| ⚫ |
] |
|
|
|
|
|
|
|
== Mechanism of action == |
|
|
The ] of benexate involves promotion of ] synthesis, ], and blood flow stimulation in the gastrointestinal tract.<ref>{{cite journal | title = Benexate hydrochloride betadex modulates nitric oxide synthesis and cytokine expression in gastric ulcers| year = 2016| pmid = 27446246| doi = 10.3892/etm.2016.3384 | pmc = 4950842 |vauthors=Lee JM, Lim J, Kim Y, Kim YJ, Choi HS, Kim ES, Keum B, Seo YS, Jeen YT, Lee HS, Um SH, Kim CD, Ryu HS, Sul D, Hong J, Chun HJ | journal = Experimental and Therapeutic Medicine| volume = 12| issue = 2| pages = 573–580 |name-list-style=vanc}}</ref> |
|
|
|
|
|
|
==See also== |
|
{{gastrointestinal-drug-stub}} |
|
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
==Further reading== |
|
|
* {{Cite book |title=Advances in Organic Crystal Chemistry: Comprehensive Reviews 2015 |date=2015|editor=Rui Tamura, Mikiji Miyata | publisher = Springer Japan |doi=10.1007/978-4-431-55555-1| isbn=978-4-431-55554-4 |s2cid=93141904|url= https://www.springer.com/gp/book/9784431555544|edition=1st}} |
|
|
|
|
⚫ |
] |
|
⚫ |
] |
|
|
] |
|
|
] |
|
⚫ |
] |