| Revision as of 12:14, 19 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 08:12, 16 December 2022 edit undoPrimefac (talk | contribs)Edit filter managers, Autopatrolled, Bureaucrats, Checkusers, Oversighters, Administrators209,207 edits histmerge completeTag: Manual revert |
| (13 intermediate revisions by 11 users not shown) |
| Line 1: |
Line 1: |
|
|
{{short description|Chemical compound}} |
|
{{DISPLAYTITLE:Benzo(''c'')cinnoline}} |
|
{{DISPLAYTITLE:Benzo(''c'')cinnoline}} |
|
{{correct title|reason=bracket|Benzocinnoline}} |
|
{{correct title|reason=bracket|edit=substitution|Benzocinnoline}} |
|
{{Chembox |
|
{{Chembox |
|
⚫ |
| Name = Benzocinnoline |
| ⚫ |
| verifiedrevid = 407858918 |
|
|
|
| Verifiedfields = changed |
| ⚫ |
|ImageFile=Benzo-c-cinnoline.png |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageSize=180px |
|
|
⚫ |
| verifiedrevid = 424845554 |
| ⚫ |
|IUPACName=Benzocinnoline |
|
|
⚫ |
| ImageFile=Benzo-c-cinnoline.png |
| ⚫ |
|OtherNames=Diphenylenazone; phenazone; 9,10-diazaphenanthrene; 2,2'-azobiphenyl; 3,4-benzocinnoline; 5,6-phenanthroline |
|
|
⚫ |
| ImageSize=180px |
|
|
| PIN=Benzocinnoline |
|
⚫ |
| OtherNames=Diphenylenazone; phenazone; 9,10-diazaphenanthrene; 2,2'-azobiphenyl; 3,4-benzocinnoline; 5,6-phenanthroline |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo=34524-78-2 |
|
| CASNo = 230-17-1 |
| ⚫ |
| PubChem=9190 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES=C1=CC=C2C(=C1)C3=CC=CC=C3N=N2 |
|
|
|
| UNII = P346MC4QRL |
|
⚫ |
| PubChem=9190 |
|
⚫ |
| SMILES=C1=CC=C2C(=C1)C3=CC=CC=C3N=N2 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 8835 |
|
|
| InChI = 1/C12H8N2/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)14-13-11/h1-8H |
|
|
| InChIKey = SWJXWSAKHXBQSY-UHFFFAOYAY |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C12H8N2/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)14-13-11/h1-8H |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = SWJXWSAKHXBQSY-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>12</sub>H<sub>8</sub>N<sub>2</sub> |
|
| Formula=C<sub>12</sub>H<sub>8</sub>N<sub>2</sub> |
|
| MolarMass=180.21 g/mol |
|
| MolarMass=180.21 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
| Line 37: |
Line 52: |
|
|
|
|
|
{{heterocyclic-stub}} |
|
{{heterocyclic-stub}} |
|
] |
|
] |
|
] |
|
] |