Misplaced Pages

Benzoyl-β-D-glucoside: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 12:12, 20 November 2011 editThe chemistds (talk | contribs)Extended confirmed users5,761 edits added CSID, (Std)InChI & (Std)InChIKey← Previous edit Latest revision as of 18:15, 15 September 2024 edit undoSilverLocust (talk | contribs)Administrators25,009 edits cleanup from move 
(17 intermediate revisions by 14 users not shown)
Line 1: Line 1:
{{DISPLAYTITLE:Benzoyl-''beta''-<small>D</small>-glucoside}} {{DISPLAYTITLE:Benzoyl-β-<small>D</small>-glucoside}}
{{chembox {{chembox
| Watchedfields = changed
| verifiedrevid = 438219894 | verifiedrevid = 461583940
| Name = Benzoyl-β-<small>D</small>-glucoside | Name = Benzoyl-β-{{sm|d}}-glucoside
| ImageFile = Benzoyl-beta-D-glucoside.svg | ImageFile = Benzoyl-beta-D-glucoside.svg
| ImageSize = 200px | ImageSize = 200px
| ImageName = Chemical structure of benzoyl-beta-D-glucoside | ImageName = Chemical structure of benzoyl-beta-D-glucoside
| ImageAlt = Chemical structure of benzoyl-beta-D-glucoside | ImageAlt = Chemical structure of benzoyl-beta-D-glucoside
| IUPACName = benzoate | IUPACName = β-<small>D</small>-Glucopyranosyl benzoate
| SystematicName = benzoate
| OtherNames = <!-- <br> --> | OtherNames = <!-- <br> -->
|Section1= {{Chembox Identifiers |Section1={{Chembox Identifiers
| CASNo = 21056-52-0 | CASNo = 21056-52-0
| CASNo_Ref = | CASNo_Ref = {{cascite|correct|??}}
| CASOther = | CASNoOther =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = U2X7G335QH
| PubChem = 12314096 | PubChem = 12314096
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 18620219 | ChemSpiderID = 18620219
| SMILES = O=C(O1O(CO)(O)(O)1O)c2ccccc2 | SMILES = O=C(O1O(CO)(O)(O)1O)c2ccccc2
| InChI = 1/C13H16O7/c14-6-8-9(15)10(16)11(17)13(19-8)20-12(18)7-4-2-1-3-5-7/h1-5,8-11,13-17H,6H2/t8-,9-,10+,11-,13+/m1/s1 | InChI = 1/C13H16O7/c14-6-8-9(15)10(16)11(17)13(19-8)20-12(18)7-4-2-1-3-5-7/h1-5,8-11,13-17H,6H2/t8-,9-,10+,11-,13+/m1/s1
| InChIKey = LVFCLUMIBMHAFL-HMUNZLOLBZ | InChIKey = LVFCLUMIBMHAFL-HMUNZLOLBZ
⚫ | StdInChI = 1S/C13H16O7/c14-6-8-9(15)10(16)11(17)13(19-8)20-12(18)7-4-2-1-3-5-7/h1-5,8-11,13-17H,6H2/t8-,9-,10+,11-,13+/m1/s1
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
⚫ | StdInChIKey = LVFCLUMIBMHAFL-HMUNZLOLSA-N
⚫ | StdInChI = 1S/C13H16O7/c14-6-8-9(15)10(16)11(17)13(19-8)20-12(18)7-4-2-1-3-5-7/h1-5,8-11,13-17H,6H2/t8-,9-,10+,11-,13+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
⚫ | StdInChIKey = LVFCLUMIBMHAFL-HMUNZLOLSA-N
| MeSHName = | MeSHName =
}} }}
|Section2= {{Chembox Properties |Section2={{Chembox Properties
| C=13|H=16|O=7 | C=13 | H=16 | O=7
| ExactMass = 284.089603 u
| Appearance = | Appearance =
| Density = | Density =
| MeltingPt = <!-- °C --> | MeltingPt =
| BoilingPt = <!-- °C --> | BoilingPt =
| Solubility = | Solubility =
}} }}
| Section3 = {{Chembox Hazards |Section3={{Chembox Hazards
| MainHazards = | MainHazards =
| FlashPt = | FlashPt =
| Autoignition = | AutoignitionPt =
| RPhrases =
| SPhrases =
}} }}
}} }}


'''Benzoyl-''beta''-<small>D</small>-glucoside''' is a ] ], a natural substance that can be found in '']''.<ref>{{cite journal | title = New Benzoyl Glucosides and Cytotoxic Pterosin Sesquiterpenes from Pteris ensiformis Burm | author = Yung-Husan Chen, Fang-Rong Chang, Mei-Chin Lu, Pei-Wen Hsieh, Ming-Jiuan Wu, Ying-Chi Du and Yang-Chang Wu | journal = Molecules | year = 2008 | volume = 13 | pages = 255–266 | pmid = 18305416 | doi = 10.3390/molecules13020255}}</ref> '''Benzoyl-β-{{sm|d}}-glucoside''' is a ] ], a natural substance that can be found in '']''.<ref>{{cite journal | title = New Benzoyl Glucosides and Cytotoxic Pterosin Sesquiterpenes from Pteris ensiformis Burm |author1=Yung-Husan Chen |author2=Fang-Rong Chang |author3=Mei-Chin Lu |author4=Pei-Wen Hsieh |author5=Ming-Jiuan Wu |author6=Ying-Chi Du |author7=Yang-Chang Wu | journal = Molecules | year = 2008 | volume = 13 |issue=2 | pages = 255–266 | pmid = 18305416 | doi = 10.3390/molecules13020255|pmc=6245482 |doi-access=free }}</ref>


==References== ==References==
{{reflist}} {{reflist}}


] ]
] ]