Revision as of 23:06, 6 August 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,071 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'ChEBI').← Previous edit |
Latest revision as of 04:07, 10 December 2024 edit undoCitation bot (talk | contribs)Bots5,455,355 edits Altered pages. Formatted dashes. | Use this bot. Report bugs. | Suggested by Dominic3203 | Linked from User:Marbletan/sandbox | #UCB_webform_linked 1181/2664 |
(66 intermediate revisions by 40 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{cs1 config|name-list-style=vanc|display-authors=6}} |
|
| verifiedrevid = 412507542 |
|
|
|
{{Infobox drug |
|
| drug_name = Betaxolol |
|
|
|
| verifiedrevid = 459977756 |
|
| image=Betaxolol.png |
|
|
|
| IUPAC_name = (''RS'')-1-{4--<br/>phenoxy}-3-(isopropylamino)propan-2-ol |
|
| imagename = 1 : 1 mixture (racemate) |
|
|
|
| image = Betaxolol structure.svg |
|
| width = 300 |
|
|
|
| chirality = ] |
|
| IUPAC_name =(''RS'')-1-{4--<br/>phenoxy}-3-(isopropylamino)propan-2-ol |
|
|
|
| image2 = Betaxolol ball-and-stick.png |
|
|
| width = 250px |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = Kerlone |
|
|
| Drugs.com = {{drugs.com|monograph|betaxolol-hydrochloride}} |
|
|
| MedlinePlus = a609023 |
|
|
| pregnancy_AU = C |
|
|
| pregnancy_category = |
|
|
| legal_status = Rx-only |
|
|
| routes_of_administration = ], ] |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = 89% |
|
|
| metabolism = ] |
|
|
| elimination_half-life = 14–22 hours |
|
|
| excretion = ] (20%) |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = 63659-18-7 |
|
|
| ATC_prefix = C07 |
|
|
| ATC_suffix = AB05 |
|
|
| ATC_supplemental = {{ATC|S01|ED02}} |
|
|
| PubChem = 2369 |
|
|
| IUPHAR_ligand = 549 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB00195 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 2279 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = O0ZR1R6RZ2 |
|
| UNII = O0ZR1R6RZ2 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 423 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D07526 |
|
| KEGG = D07526 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| InChI = 1/C18H29NO3/c1-14(2)19-11-17(20)13-22-18-7-5-15(6-8-18)9-10-21-12-16-3-4-16/h5-8,14,16-17,19-20H,3-4,9-13H2,1-2H3 |
|
|
|
| ChEBI = 3082 |
|
| InChIKey = NWIUTZDMDHAVTP-UHFFFAOYAU |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 423 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| C=18 | H=29 | N=1 | O=3 |
|
|
| SMILES = O(CCc1ccc(OCC(O)CNC(C)C)cc1)CC2CC2 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C18H29NO3/c1-14(2)19-11-17(20)13-22-18-7-5-15(6-8-18)9-10-21-12-16-3-4-16/h5-8,14,16-17,19-20H,3-4,9-13H2,1-2H3 |
|
| StdInChI = 1S/C18H29NO3/c1-14(2)19-11-17(20)13-22-18-7-5-15(6-8-18)9-10-21-12-16-3-4-16/h5-8,14,16-17,19-20H,3-4,9-13H2,1-2H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = NWIUTZDMDHAVTP-UHFFFAOYSA-N |
|
| StdInChIKey = NWIUTZDMDHAVTP-UHFFFAOYSA-N |
|
| CAS_number = 63659-18-7 |
|
|
| ATC_prefix=C07 |
|
|
| ATC_suffix=AB05 |
|
|
| ATC_supplemental={{ATC|S01|ED02}} |
|
|
| ChEBI = 3082 |
|
|
| PubChem=2369 |
|
|
| IUPHAR_ligand = 549 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID=2279 |
|
|
| DrugBank=APRD00245 |
|
|
| C=18 | H=29 | N=1 | O=3 |
|
|
|molecular_weight = 307.428 ]/] |
|
|
|smiles = O(CCc1ccc(OCC(O)CNC(C)C)cc1)CC2CC2 |
|
|
|bioavailability = 89% |
|
|
|metabolism = ] |
|
|
|elimination_half-life = 14–22 hours |
|
|
|excretion = ] (20%) |
|
|
|pregnancy_AU = C |
|
|
|pregnancy_US = C |
|
|
|pregnancy_category = |
|
|
|legal_status = Rx-only |
|
|
|routes_of_administration = oral, ] |
|
|
}} |
|
}} |
|
|
<!-- Definition and medical uses --> |
|
|
'''Betaxolol''' is a selective ] used in the treatment of ] and ].<ref>{{cite journal | vauthors = Buckley MM, Goa KL, Clissold SP | title = Ocular betaxolol. A review of its pharmacological properties, and therapeutic efficacy in glaucoma and ocular hypertension | journal = Drugs | volume = 40 | issue = 1 | pages = 75–90 | date = July 1990 | pmid = 2202584 | doi = 10.2165/00003495-199040010-00005 | s2cid = 46962082 }}</ref> It is also a ] blocker with no partial agonist action and minimal membrane stabilizing activity.<ref>{{Cite web |title=Google Scholar |url=https://scholar.google.com/scholar?q=%22Betaxolol%22#d=gs_qabs&t=1703552255390&u=#p=8zHRlC92iIoJ |access-date=2023-12-26 |website=scholar.google.com}}</ref> Being selective for beta<sub>1</sub> receptors, it typically has fewer systemic ]s than non-selective beta-blockers, for example, not causing ] (mediated by beta<sub>2</sub> receptors) as ] may. Betaxolol also shows greater affinity for beta<sub>1</sub> receptors than ]. In addition to its effect on the heart, betaxolol reduces the pressure within the eye (]). This effect is thought to be caused by reducing the production of the liquid (which is called the ]) within the eye. The precise mechanism of this effect is not known. The reduction in intraocular pressure reduces the risk of damage to the ] and loss of vision in patients with elevated intraocular pressure due to ]. |
|
|
|
|
|
|
<!-- Society and culture --> |
|
'''Betaxolol''' (trade names '''Betoptic''', '''Betoptic S''', '''Lokren''', '''Kerlone''') is a selective ] used in the treatment of ] and ]. Being selective for beta<sub>1</sub> receptors, it typically has fewer systemic ]s than non-selective beta-blockers, for example, not causing ] (mediated by beta<sub>2</sub> receptors) as ] may. Betaxolol also shows greater affininty for beta<sub>1</sub> receptors than ]. In addition to its effect on the heart, betaxolol reduces the pressure within the eye (]). This effect is thought to be caused by reducing the production of the liquid (which is called the ]) within the eye. The precise mechanism of this effect is not known. The reduction in intraocular pressure reduces the risk of damage to the ] and loss of vision in patients with elevated intraocular pressure due to ]. |
|
|
|
It was patented in 1975 and approved for medical use in 1983.<ref>{{cite book | vauthors = Fischer J, Ganellin CR |title=Analogue-based Drug Discovery |date=2006 |publisher=John Wiley & Sons |isbn=9783527607495 |page=461 |url=https://books.google.com/books?id=FjKfqkaKkAAC&pg=PA461 |language=en}}</ref> |
|
|
|
|
|
|
==Medical uses== |
|
Betaxolol was approved by the U.S. ] (FDA) for ocular use as a 0.5% solution ('''Betoptic''') in 1985 and as a 0.25% solution ('''Betoptic S''') in 1989. |
|
|
|
|
|
|
|
=== Hypertension === |
|
==Clinical uses== |
|
|
|
Betaxolol is most commonly ingested orally alone or with other medications for the management of ].<ref>{{cite book | vauthors = Tajran J, Goyal A | chapter = Betaxolol |date=2023 |chapter-url=http://www.ncbi.nlm.nih.gov/books/NBK557870/ | title = StatPearls |access-date=2023-12-26 |place=Treasure Island (FL) |publisher=StatPearls Publishing |pmid=32491793 }}</ref> It is a cardioselective beta blocker, targeting beta-1 adrenergic receptors found in the cardiac muscle. Blood pressure is decreased by the mechanism of blood vessels relaxing and improving the flow of blood.<ref>{{Cite web |title=Betaxolol | work = MedlinePlus Drug Information |url=https://medlineplus.gov/druginfo/meds/a609023.html |access-date=2023-01-12 | publisher = U.S. National Library of Medicine |language=en}}</ref><ref>{{Cite web |title=Betaxolol: MedlinePlus Drug Information |url=https://medlineplus.gov/druginfo/meds/a609023.html |access-date=2023-12-26 |website=medlineplus.gov |language=en}}</ref> |
|
* Oral: for the management of hypertension |
|
|
* Ophthalmic: for the management of glaucoma |
|
|
* the drug seems to have an effect of neuroprotection in glaucoma treatment |
|
|
|
|
|
|
==Dosage== |
|
=== Glaucoma === |
|
|
Ophthalmic betaxolol is an available treatment for ] (POAG) and optical hypertension. Betaxolol effectively prevents the increase of intracellular calcium, which leads to increased production of the aqueous humor. In the context of open angle glaucoma, increased aqueous humor produced by ciliary bodies increases intraocular pressure, causing degeneration of ]s and the optic nerve.<ref name = "Tajran_2022">{{cite book | vauthors = Tajran J, Goyal A | chapter = Betaxolol |date=2022 | chapter-url= http://www.ncbi.nlm.nih.gov/books/NBK557870/ | title = StatPearls |place=Treasure Island (FL) |publisher=StatPearls Publishing |pmid=32491793 |access-date=2023-01-12 }}</ref> |
|
* Oral: The initial dose in hypertension is ordinarily 10 mg once daily either alone or added to diuretic therapy. |
|
|
|
|
|
* Ophthalmic: The recommended dose one to two drops in the affected eye(s) twice daily. |
|
|
|
Furthermore, betaxolol is additionally able to protect retinal neurones following topical application from ] or ], providing a neuroprotective effect. This is thought to be attributed to its capacity to attenuate neuronal calcium and sodium influx.<ref>{{cite journal | vauthors = Wood JP, Schmidt KG, Melena J, Chidlow G, Allmeier H, Osborne NN | title = The beta-adrenoceptor antagonists metipranolol and timolol are retinal neuroprotectants: comparison with betaxolol | journal = Experimental Eye Research | volume = 76 | issue = 4 | pages = 505–516 | date = April 2003 | pmid = 12634114 | doi = 10.1016/s0014-4835(02)00335-4 }}</ref> Betaxolol is also an effective treatment for ]<ref>{{cite journal | vauthors = Goldberg I, Goldberg H | title = Betaxolol eye drops. A clinical trial of safety and efficacy | journal = Australian and New Zealand Journal of Ophthalmology | volume = 23 | issue = 1 | pages = 17–24 | date = February 1995 | pmid = 7619450 | doi = 10.1111/j.1442-9071.1995.tb01640.x }}</ref><br> |
|
|
=== Paronychia === |
|
|
One study showed that topical betaxolol can be used in treating relapsed ].<ref>{{cite journal | vauthors = Yen CF, Hsu CK, Lu CW | title = Topical betaxolol for treating relapsing paronychia with pyogenic granuloma-like lesions induced by epidermal growth factor receptor inhibitors | journal = Journal of the American Academy of Dermatology | volume = 78 | issue = 6 | pages = e143–e144 | date = June 2018 | pmid = 29339238 | doi = 10.1016/j.jaad.2018.01.015 | s2cid = 39861588 }}</ref> |
|
|
|
|
|
==Contraindications== |
|
==Contraindications== |
|
* Hypersensitivity to the drug |
|
* Hypersensitivity to the drug |
|
* Patients with sinus bradycardia, heart block greater than first degree, cardiogenic shock, and overt cardiac failure |
|
* Patients with ], heart block greater than first degree, cardiogenic shock, and overt cardiac failure |
|
|
|
|
|
|
== Side effects == |
|
==External links== |
|
|
|
{{Expand section|date=January 2019}} |
|
* |
|
|
|
The adverse side-effects of betaxolol can be categorized into local and systemic effects.<ref name = "Tajran_2022" /> The local effects include: |
|
|
|
|
|
|
* transient irritation (20-40% of patients) |
|
==See also== |
|
|
|
* burning |
|
] |
|
|
|
* ], or general itching |
|
|
* ] |
|
|
* blurry vision<ref>{{cite journal | vauthors = Buckley MM, Goa KL, Clissold SP | title = Ocular betaxolol. A review of its pharmacological properties, and therapeutic efficacy in glaucoma and ocular hypertension | journal = Drugs | volume = 40 | issue = 1 | pages = 75–90 | date = July 1990 | pmid = 2202584 | doi = 10.2165/00003495-199040010-00005 | s2cid = 46962082 }}</ref> |
|
|
|
|
|
|
Systemically, patients taking betaxolol might experience: |
|
{{beta blockers}} |
|
|
|
|
|
|
* ] |
|
|
* ] |
|
|
* fatigue |
|
|
* sexual impotence |
|
|
* hair loss |
|
|
* confusion |
|
|
* headache |
|
|
* dizziness |
|
|
* ] at higher doses |
|
|
* cardiac problems such as ], ], ], ], and ] |
|
|
* mental effects such as ], ], ], ], ] |
|
|
* ] |
|
|
* metabolic side effects such as an increase in ] levels |
|
|
* can mask the symptoms of ] ] patients |
|
|
|
|
|
{{See also|Beta blocker}} |
|
|
|
|
|
==History== |
|
|
Betaxolol was approved by the U.S. ] (FDA) for ocular use as a 0.5% solution (Betoptic) in 1985 and as a 0.25% solution (Betoptic S) in 1989. |
|
|
|
|
|
==Society and culture== |
|
|
|
|
|
===Brand names=== |
|
|
Brand names include Betoptic, Betoptic S, Lokren, Kerlone. |
|
|
|
|
|
== See also == |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
== External links == |
|
|
* |
|
|
|
|
|
{{Beta blockers}} |
|
{{Antiglaucoma preparations and miotics}} |
|
{{Antiglaucoma preparations and miotics}} |
|
|
{{Adrenergic receptor modulators}} |
|
|
|
|
|
] |
|
] |
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|