Misplaced Pages

Biapenem: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 23:12, 6 August 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'ChEBI').← Previous edit Latest revision as of 20:36, 12 August 2023 edit undoVaccinationist (talk | contribs)Extended confirmed users4,732 edits skeletal formula in svgTag: 2017 wikitext editor 
(37 intermediate revisions by 19 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{drugbox
{{Drugbox
| Verifiedfields = changed
⚫ | verifiedrevid = 443422119
⚫ | UNII_Ref = {{fdacite|changed|FDA}}
⚫ | IUPAC_name = (4''R'',5''S'',6''S'')-3-(6,7-dihydro-5''H''- pyrazolo triazol-8- ium-6-ylsulfanyl)- 6-(1-hydroxyethyl)- 4-methyl-7-oxo-1-azabicyclohept-2- ene-2-carboxylate
⚫ | UNII = YR5U3L9ZH1
⚫ | image = Biapenem.svg
⚫ | verifiedrevid = 403359783

⚫ | IUPAC_name = (4''R'',5''S'',6''S'')-3-(6,7-dihydro-5''H''- pyrazolotriazol-8- ium-6-ylsulfanyl)- 6-(1-hydroxyethyl)- 4-methyl-7-oxo-1-azabicyclohept-2- ene-2-carboxylate
<!--Clinical data-->
⚫ | image = Biapenem.png
| tradename = Omegacin
| Drugs.com = {{drugs.com|international|biapenem}}
⚫ | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫ | pregnancy_US = <!-- A / B / C / D / X -->
⚫ | pregnancy_category =
⚫ | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
⚫ | legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
⚫ | legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
⚫ | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫ | legal_status = Rx-only
⚫ | routes_of_administration = ]

<!--Pharmacokinetic data-->
⚫ | bioavailability =
⚫ | protein_bound =
⚫ | metabolism =
⚫ | elimination_half-life =
⚫ | excretion =

<!--Identifiers-->
⚫ | CAS_number_Ref = {{cascite|correct|??}}
⚫ | CAS_number = 120410-24-4
⚫ | CAS_supplemental =
⚫ | ATC_prefix = J01
⚫ | ATC_suffix = DH05
⚫ | ATC_supplemental =
⚫ | PubChem = 71339
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
⚫ | DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 64442 | ChemSpiderID = 64442
⚫ | UNII_Ref = {{fdacite|correct|FDA}}
| InChI = 1/C15H18N4O4S/c1-7-11-10(8(2)20)14(21)19(11)12(15(22)23)13(7)24-9-3-17-5-16-6-18(17)4-9/h5-11,20H,3-4H2,1-2H3/t7-,8-,10-,11-/m1/s1
⚫ | UNII = YR5U3L9ZH1
| InChIKey = MRMBZHPJVKCOMA-YJFSRANCBZ
| ChEBI_Ref = {{ebicite|correct|EBI}}
| smiles1 = C(=O)C=4N1C(=O)((O)C)1(C=4SC3C2cncn2C3)C
⚫ | ChEBI = 3089
| ChEMBL_Ref = {{ebicite|correct|EBI}}
⚫ | ChEMBL = 285347

<!--Chemical data-->
⚫ | chemical_formula =
⚫ | C=15 | H=18 | N=4 | O=4 | S=1
⚫ | smiles = CC1C2C(C(=O)N2C(=C1SC3CN4C=NC=4C3)C(=O))C(C)O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C15H18N4O4S/c1-7-11-10(8(2)20)14(21)19(11)12(15(22)23)13(7)24-9-3-17-5-16-6-18(17)4-9/h5-11,20H,3-4H2,1-2H3/t7-,8-,10-,11-/m1/s1 | StdInChI = 1S/C15H18N4O4S/c1-7-11-10(8(2)20)14(21)19(11)12(15(22)23)13(7)24-9-3-17-5-16-6-18(17)4-9/h5-11,20H,3-4H2,1-2H3/t7-,8-,10-,11-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = MRMBZHPJVKCOMA-YJFSRANCSA-N | StdInChIKey = MRMBZHPJVKCOMA-YJFSRANCSA-N
⚫ | CAS_number = 120410-24-4
⚫ | CAS_supplemental =
⚫ | ChEMBL_Ref = {{ebicite|correct|EBI}}
⚫ | ChEMBL = 285347
⚫ | ATC_prefix = J01
⚫ | ATC_suffix = DH05
⚫ | ATC_supplemental =
⚫ | ChEBI = 3089
⚫ | PubChem = 71339
⚫ | DrugBank =
⚫ | chemical_formula =
⚫ | C=15 | H=18 | N=4 | O=4 | S=1
| molecular_weight = 350.39 g/mol
⚫ | smiles = CC1C2C(C(=O)N2C(=C1SC3CN4C=NC=4C3)C(=O))C(C)O
⚫ | bioavailability =
⚫ | protein_bound =
⚫ | metabolism =
⚫ | elimination_half-life =
⚫ | excretion =
⚫ | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫ | pregnancy_US = <!-- A / B / C / D / X -->
⚫ | pregnancy_category=
⚫ | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
⚫ | legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
⚫ | legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
⚫ | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫ | legal_status = Rx-only
⚫ | routes_of_administration = ]
}} }}


'''Biapenem''' (]) is a ] antibiotic. It has in vitro activity against anaerobes.<ref name="pmid8031067">{{cite journal |author=Aldridge KE, Morice N, Schiro DD |title=In vitro activity of biapenem (L-627), a new carbapenem, against anaerobes |journal=Antimicrob. Agents Chemother. |volume=38 |issue=4 |pages=889–93 |year=1994 |month=April |pmid=8031067 |pmc=284564 |doi= |url=http://aac.asm.org/cgi/pmidlookup?view=long&pmid=8031067}}</ref> '''Biapenem''' (]) is a ] antibiotic. It has in vitro activity against anaerobes.<ref name="pmid8031067">{{cite journal |vauthors=Aldridge KE, Morice N, Schiro DD |title=In vitro activity of biapenem (L-627), a new carbapenem, against anaerobes |journal=Antimicrob. Agents Chemother. |volume=38 |issue=4 |pages=889–93 |date=April 1994 |pmid=8031067 |pmc=284564 |doi= 10.1128/aac.38.4.889|url=}}</ref>
⚫ 1-β-methyl-carbapenem antibiotic. Approved in Japan in 2001.


⚫ == References ==
⚫ Approved in Japan in 2001.

⚫ ==References==
{{Reflist}} {{Reflist}}


==External links== == External links ==
* {{ja icon}} * {{in lang|ja}}


{{CephalosporinAntiBiotics}} {{CephalosporinAntiBiotics}}


] ]



{{antibiotic-stub}} {{antibiotic-stub}}