| Revision as of 10:49, 9 April 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 448002428 of page Bibrocathol for the Chem/Drugbox validation project (updated: 'StdInChI', 'StdInChIKey', 'CAS_number'). |
Latest revision as of 16:34, 5 December 2024 edit Marbletan (talk | contribs)Extended confirmed users5,340 edits Bibrocathol structure a.svg |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
|
| verifiedrevid = 486407352 |
|
| IUPAC_name = 4,5,6,7-tetrabromo-2-hydroxy-1,3,2-benzodioxabismole |
|
| IUPAC_name = 4,5,6,7-tetrabromo-2-hydroxy-1,3,2-benzodioxabismole |
|
| image = Bibrocathol structure.svg |
|
| image = Bibrocathol structure a.svg |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = Noviform, Posiformin |
|
| Drugs.com = {{drugs.com|international|bibrocathol}} |
|
| Drugs.com = {{drugs.com|international|bibrocathol}} |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = Topical (eye ointment) |
|
| routes_of_administration = Topical (eye ointment) |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 6915-57-7 --> |
|
| CAS_number = 6915-57-7 |
|
| ATC_prefix = S01 |
|
| ATC_prefix = S01 |
|
| ATC_suffix = AX05 |
|
| ATC_suffix = AX05 |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C6H2Br4O2.Bi.H2O/c7-1-2(8)4(10)6(12)5(11)3(1)9;;/h11-12H;;1H2/q;+3;/p-3 |
|
| StdInChI = 1S/C6H2Br4O2.Bi.H2O/c7-1-2(8)4(10)6(12)5(11)3(1)9;;/h11-12H;;1H2/q;+3;/p-3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = VTAVFIZOZUAKKE-UHFFFAOYSA-K |
|
| StdInChIKey = VTAVFIZOZUAKKE-UHFFFAOYSA-K |
|
| PubChem = 16683103 |
|
| PubChem = 16683103 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 11232581 |
|
| ChemSpiderID = 11232581 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 0KJ20H1BLJ |
|
| UNII = 0KJ20H1BLJ |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 44875 |
|
| ChEMBL = 44875 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| chemical_formula = |
|
| chemical_formula = |
|
| C=6 | H=1 | Bi=1 | Br=4 | O=3 |
|
| C=6 | H=1 | Bi=1 | Br=4 | O=3 |
|
| molecular_weight = 650.675 g/mol |
|
|
| smiles = O1Oc2c(Br)c(Br)c(Br)c(Br)c2O1 |
|
| smiles = O1Oc2c(Br)c(Br)c(Br)c(Br)c2O1 |
|
| InChI = 1/C6H2Br4O2.Bi.H2O/c7-1-2(8)4(10)6(12)5(11)3(1)9;;/h11-12H;;1H2/q;+3;/p-3/rC6HBiBr4O3/c8-1-2(9)4(11)6-5(3(1)10)13-7(12)14-6/h12H |
|
|
| InChIKey = VTAVFIZOZUAKKE-AJXSUKGNAS |
|
|
| synonyms = Bibrocathin<br>Tetrabromopyrocatechol bismuth |
|
| synonyms = Bibrocathin<br>Tetrabromopyrocatechol bismuth |
|
}} |
|
}} |
|
|
'''Bibrocathol''' (]; trade names '''Noviform''' and '''Posiformin''') is a pharmaceutical ]. Its chemical name is 4,5,6,7-tetrabrom-1,3,2-benzodioxabismol-2-ol. It contains ] and is used to treat eye infections and control swelling.<ref>{{cite book | vauthors = Gurtler L | chapter = Chapter 2: The Eye and Conjunctiva as Target of Entry for Infectious Agents: Prevention by Protection and by Antiseptic Prophylaxis | veditors = Kramer A, Behrens-Baumann W |title=Antiseptic prophylaxis and therapy in ocular infections: principles, clinical practice, and infection control | series = Developments in Ophthalmology |date= January 2002 | volume = 33 | pages = 9–13 |publisher=Karger |location=Basel |isbn=978-3-8055-7316-0 | doi = 10.1159/000065934 | pmid = 12236131 | chapter-url = https://books.google.com/books?id=JkQOSAnOIhoC&dq=Bibrocathol&pg=PA96 }}</ref> |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
==External links== |
|
|
* {{Commonscatinline}} |
|
|
|
|
|
{{Bismuth compounds}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{antiinfective-drug-stub}} |