| Revision as of 23:56, 13 July 2011 editZéroBot (talk | contribs)704,777 editsm r2.7.1) (robot Adding: es:Bornano← Previous edit |
Latest revision as of 07:25, 8 March 2023 edit undoJWBE (talk | contribs)Extended confirmed users10,129 edits removed Category:Cyclopentanes using HotCat |
| (14 intermediate revisions by 10 users not shown) |
| Line 1: |
Line 1: |
|
{{distinguish|borane}} |
|
{{distinguish|borane}} |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 383251342 |
|
| verifiedrevid = 439346674 |
|
| ImageFileL1 = bornane.svg |
|
| ImageFileL1 = bornane.svg |
|
| ImageSizeL1 = 120 |
|
|
| ImageNameL1 = Skeletal formula |
|
| ImageNameL1 = Skeletal formula |
|
| ImageFileR1 = Bornane-3D-balls.png |
|
| ImageFileR1 = Bornane-3D-balls.png |
|
⚫ |
| ImageNameR1 = Ball-and-stick model |
|
| ImageSizeR1 = 120 |
|
|
⚫ |
| IUPACName = (1S,4S)-1,7,7-trimethylbicycloheptane |
| ⚫ |
| ImageNameR1 = Ball-and-stick model |
|
|
⚫ |
| OtherNames = |
| ⚫ |
| IUPACName = (1S,4S)-1,7,7-trimethylbicycloheptane |
|
| ⚫ |
| OtherNames = |
|
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo= |
|
| CASNo= 464-15-3 |
|
| PubChem=92108 |
|
| PubChem=92108 |
| ⚫ |
| SMILES=CC1(C2CCC1(CC2)C)C |
|
|
|
| ChemSpiderID = 83155 |
|
|
| Beilstein = 1900804 |
|
|
| ChEBI = 35783 |
|
|
| DrugBank = DB04501 |
|
|
| StdInChI=1S/C10H18/c1-9(2)8-4-6-10(9,3)7-5-8/h8H,4-7H2,1-3H3 |
|
|
| StdInChIKey = BEWYHVAWEKZDPP-UHFFFAOYSA-N |
|
⚫ |
| SMILES=CC1(C2CCC1(CC2)C)C |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>10</sub>H<sub>18</sub> |
|
| Formula=C<sub>10</sub>H<sub>18</sub> |
|
| MolarMass=138.24992 |
|
| MolarMass=138.24992 |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Bornane''' (or '''camphane''') is a compound closely related to ]. |
|
'''Bornane''' (or '''camphane''') is a compound closely related to ]. |
|
|
|
|
|
Its name refers to ], habitat of the tree '']'' from which bornane and related compounds can be extracted. |
|
|
|
|
|
==See also== |
|
==See also== |
| Line 36: |
Line 44: |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{hydrocarbon-stub}} |
|
{{hydrocarbon-stub}} |
|
|
|
|
] |
|
|
] |
|
|
] |
|