| Revision as of 23:17, 27 November 2011 editThe chemistds (talk | contribs)Extended confirmed users5,761 edits added CSID, (Std)InChI & (Std)InChIKey← Previous edit |
Latest revision as of 13:34, 13 March 2024 edit undoAnomieBOT (talk | contribs)Bots6,564,811 editsm Dating maintenance tags: {{Rs}} |
| (30 intermediate revisions by 21 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 404808986 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 462806316 |
|
| Name = Butein |
|
| Name = Butein |
|
| ImageFile = Butein.svg |
|
| ImageFile = Butein.svg |
|
| ImageSize = 250px |
|
| ImageSize = 250px |
|
| ImageName = Chemical structure of butein |
|
| ImageName = Chemical structure of butein |
|
|
| PIN = 2′,3,4,4′-Tetrahydroxychalcone |
|
| IUPACName = (''E'')-1-(2,4-dihydroxyphenyl)-3-(3,4-dihydroxyphenyl)prop-2-en-1-one |
|
|
| OtherNames = 2',3,4,4'-Tetrahydroxychalcone<br>2',4',3,4-Tetrahydroxychalcone<br>3,4,2',4'-Tetrahydroxychalcone<br>2′,4′,3,4-Tetrahydroxychalcone |
|
| OtherNames = (2''E'')-1-(2,4-Dihydroxyphenyl)-3-(3,4-dihydroxyphenyl)prop-2-en-1-one<br>2′,4′,3,4-Tetrahydroxychalcone<br>3,4,2′,4′-Tetrahydroxychalcone |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 487-52-5 |
|
| CASNo = 487-52-5 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| CASNo_Ref = |
|
|
| CASOther = 21849-70-7 |
|
| UNII = 4WVS5M0LGF |
|
| PubChem = 5281222 |
|
| PubChem = 5281222 |
|
|
| KEGG = C08578 |
|
|
| ChEBI = 3237 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 128000 |
|
| ChEMBL = 128000 |
|
| SMILES = C1=CC(=C(C=C1C=CC(=O)C2=C(C=C(C=C2)O)O)O)O |
|
| SMILES = C1=CC(=C(C=C1C=CC(=O)C2=C(C=C(C=C2)O)O)O)O |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4444634 |
|
| ChemSpiderID = 4444634 |
|
| InChI = 1/C15H12O5/c16-10-3-4-11(14(19)8-10)12(17)5-1-9-2-6-13(18)15(20)7-9/h1-8,16,18-20H/b5-1+ |
|
| InChI = 1/C15H12O5/c16-10-3-4-11(14(19)8-10)12(17)5-1-9-2-6-13(18)15(20)7-9/h1-8,16,18-20H/b5-1+ |
|
| InChIKey = AYMYWHCQALZEGT-ORCRQEGFBV |
|
| InChIKey = AYMYWHCQALZEGT-ORCRQEGFBV |
| ⚫ |
| StdInChI = 1S/C15H12O5/c16-10-3-4-11(14(19)8-10)12(17)5-1-9-2-6-13(18)15(20)7-9/h1-8,16,18-20H/b5-1+ |
|
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| ⚫ |
| StdInChIKey = AYMYWHCQALZEGT-ORCRQEGFSA-N |
|
|
⚫ |
| StdInChI = 1S/C15H12O5/c16-10-3-4-11(14(19)8-10)12(17)5-1-9-2-6-13(18)15(20)7-9/h1-8,16,18-20H/b5-1+ |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = AYMYWHCQALZEGT-ORCRQEGFSA-N |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=15 | H=12 | O=5 |
|
| Formula = C<sub>15</sub>H<sub>12</sub>O<sub>5</sub> |
|
|
| MolarMass = 272.25 g/mol |
|
|
| ExactMass = 272.068473 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
'''Butein''' is a ]. It can be found in '']'' (or formerly ''Rhus verniciflua''). It has ], ] and ]s inhibitory effects<ref name="pmid18670102">{{cite journal |author=Lee EH, Song DG, Lee JY, Pan CH, Um BH, Jung SH |title=Inhibitory effect of the compounds isolated from Rhus verniciflua on aldose reductase and advanced glycation endproducts |journal=Biol. Pharm. Bull. |volume=31 |issue=8 |pages=1626–30 |year=2008 |month=August |pmid=18670102 |doi= 10.1248/bpb.31.1626|url=http://joi.jlc.jst.go.jp/JST.JSTAGE/bpb/31.1626?from=PubMed}}</ref>. It is also a ], a chemical compound having an effect on sirtuins, a group of enzymes that use NAD<sup>+</sup> to remove acetyl groups from proteins. |
|
'''Butein''' is a ] of the ]s. It can be found in '']'' (or formerly ''Rhus verniciflua''), '']'', '']'' ('']'') and '']''.<ref>Semwal, R. B., Semwal, D. K., Combrinck, S., & Viljoen, A. (2015). Butein: From ancient traditional remedy to modern nutraceutical. Phytochemistry Letters, 11, 188-201. {{doi|10.1016/j.phytol.2014.12.014}}</ref> It has ], ] and ]s inhibitory effects.<ref name="pmid18670102">{{cite journal |vauthors=Lee EH, Song DG, Lee JY, Pan CH, Um BH, Jung SH |title=Inhibitory effect of the compounds isolated from Rhus verniciflua on aldose reductase and advanced glycation endproducts |journal=Biol. Pharm. Bull. |volume=31 |issue=8 |pages=1626–30 |date=August 2008 |pmid=18670102 |doi= 10.1248/bpb.31.1626|doi-access=free }}</ref> It is also a ], a chemical compound having an effect on sirtuins, a group of enzymes that use NAD<sup>+</sup> to remove acetyl groups from proteins. Buteins possess a high ability to inhibit aromatase process in the human body, for this reason, the use of these compounds in the treatment of ] on the estrogen ground has been explored.<ref>Wang Y. "" Life Sci. 2005 May 20;77(1):39-51.</ref> The first attempts of sport pro-hormone supplementation with the use of buteins took place in Poland.<ref>S.Amboziak " 09.2012</ref>{{rs|date=March 2024}} |
|
|
|
|
|
==References== |
|
==References== |
| Line 42: |
Line 49: |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{Natural-phenol-stub}} |
|
|
|
{{aromatic-stub}} |