| Revision as of 15:04, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 471585928 of page Buthionine_sulfoximine for the Chem/Drugbox validation project (updated: 'ChEBI', 'CASNo'). |
Latest revision as of 15:46, 18 April 2024 edit Tonysoprano419 (talk | contribs)5 editsNo edit summaryTag: Manual revert |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 401093345 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=Buthionine sulfoximine.svg |
|
|
⚫ |
| verifiedrevid = 477374857 |
| ⚫ |
|ImageSize= |
|
|
⚫ |
| ImageFile=Buthionine sulfoximine.svg |
| ⚫ |
|IUPACName=2-amino-4-(butylsulfonimidoyl)butanoic acid |
|
|
⚫ |
| ImageSize= |
| ⚫ |
|OtherNames= |
|
|
|
| ImageAlt = Skeletal formula of buthionine sulfoximine |
|
|
| ImageFile1 = Buthionine-sulfoximine-zwitterion-3D-balls.png |
|
|
| ImageAlt1 = Ball-and-stick model of buthionine sulfoximine as a zwitterion |
|
⚫ |
| IUPACName=2-amino-4-(butylsulfonimidoyl)butanoic acid |
|
⚫ |
| OtherNames= BSO |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 5072-26-4 --> |
|
|
|
| CASNo=5072-26-4 |
| ⚫ |
| ChEBI = 28714 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = LW4108Q0BV |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
⚫ |
| ChEBI = 28714 |
|
| PubChem=21157 |
|
| PubChem=21157 |
|
| SMILES=CCCCS(=N)(=O)CCC(C(=O)O)N |
|
| SMILES=CCCCS(=N)(=O)CCC(C(=O)O)N |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 19896 |
|
| ChemSpiderID = 19896 |
|
| InChI = 1/C8H18N2O3S/c1-2-3-5-14(10,13)6-4-7(9)8(11)12/h7,10H,2-6,9H2,1H3,(H,11,12) |
|
| InChI = 1/C8H18N2O3S/c1-2-3-5-14(10,13)6-4-7(9)8(11)12/h7,10H,2-6,9H2,1H3,(H,11,12) |
|
| InChIKey = KJQFBVYMGADDTQ-UHFFFAOYAW |
|
| InChIKey = KJQFBVYMGADDTQ-UHFFFAOYAW |
| ⚫ |
| StdInChI = 1S/C8H18N2O3S/c1-2-3-5-14(10,13)6-4-7(9)8(11)12/h7,10H,2-6,9H2,1H3,(H,11,12) |
|
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| ⚫ |
| StdInChIKey = KJQFBVYMGADDTQ-UHFFFAOYSA-N |
|
|
⚫ |
| StdInChI = 1S/C8H18N2O3S/c1-2-3-5-14(10,13)6-4-7(9)8(11)12/h7,10H,2-6,9H2,1H3,(H,11,12) |
| ⚫ |
| MeSHName=Buthionine+sulfoximine |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = KJQFBVYMGADDTQ-UHFFFAOYSA-N |
|
⚫ |
| MeSHName=Buthionine+sulfoximine |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>8</sub>H<sub>18</sub>N<sub>2</sub>O<sub>3</sub>S |
|
| Formula=C<sub>8</sub>H<sub>18</sub>N<sub>2</sub>O<sub>3</sub>S |
|
| MolarMass=222.305 g/mol |
|
| MolarMass=222.305 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density=1.29 g/mL |
|
|
| MeltingPtC=215 |
|
| MeltingPt= |
|
|
|
| BoilingPtC=382.3 |
|
| BoilingPt= |
|
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Buthionine sulfoximine''' (BSO) is a ] derivative which reduces levels of ] and is being investigated as an adjunct with ] in the treatment of cancer.<ref>{{cite journal|last1=Defty|first1=CL|last2=Marsden|first2=JR|title=Melphalan in regional chemotherapy for locally recurrent metastatic melanoma.|journal=Current Topics in Medicinal Chemistry|date=2012|volume=12|issue=1|pages=53–60|pmid=22196271|doi=10.2174/156802612798919187}}</ref> The compound inhibits ], the ] required in the first step of ]. Buthionine sulfoximine may also be used to increase the sensitivity of ]s to oxidative ].<ref name="urlDefinition of buthionine sulfoximine - National Cancer Institute Drug Dictionary">{{cite web |url=http://www.cancer.gov/Templates/drugdictionary.aspx?CdrID=39123 |title=Definition of buthionine sulfoximine - National Cancer Institute Drug Dictionary |format= |date=2011-02-02 }}</ref> |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{organic-compound-stub}} |