| Revision as of 13:31, 12 May 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 05:40, 2 July 2024 edit undo5.20.193.193 (talk) fixing incorrect naming |
| (15 intermediate revisions by 14 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 299501157 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|Reference=<ref> at ]</ref> |
|
|
⚫ |
| verifiedrevid = 428751681 |
| ⚫ |
|Name=CAPS |
|
|
⚫ |
| Reference=<ref> at ]</ref> |
| ⚫ |
|ImageFile=CAPS buffer.png |
|
|
⚫ |
| Name=CAPS |
|
|ImageSize=200px |
|
|
⚫ |
| ImageFile=CAPS buffer.png |
|
|IUPACName=3-(Cyclohexylamino)-1-propanesulfonic acid |
|
| PIN=3-(Cyclohexylamino)propane-1-sulfonic acid |
|
|OtherNames= |
|
| OtherNames= |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=1135-40-6 |
|
| CASNo=1135-40-6 |
|
| PubChem=70815 |
|
| PubChem=70815 |
| ⚫ |
| SMILES=C1CCC(CC1)NCCCS(=O)(=O)O |
|
|
|
| DrugBank = DB02219 |
|
|
| EC_number = 214-492-1 |
|
|
| UNII = 4W981O1LXP |
|
⚫ |
| SMILES=C1CCC(CC1)NCCCS(=O)(=O)O |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 63979 |
|
|
| InChI = 1/C9H19NO3S/c11-14(12,13)8-4-7-10-9-5-2-1-3-6-9/h9-10H,1-8H2,(H,11,12,13) |
|
|
| InChIKey = PJWWRFATQTVXHA-UHFFFAOYAU |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C9H19NO3S/c11-14(12,13)8-4-7-10-9-5-2-1-3-6-9/h9-10H,1-8H2,(H,11,12,13) |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = PJWWRFATQTVXHA-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>9</sub>H<sub>19</sub>NO<sub>3</sub>S |
|
| Formula=C<sub>9</sub>H<sub>19</sub>NO<sub>3</sub>S |
|
| MolarMass=221.32 g/mol |
|
| MolarMass=221.32 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= >300 °C |
|
| MeltingPt= >300 °C |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
| pKa = 10.4<ref>{{cite journal | last1 = Esplin | first1 = Taran L. | last2 = Cable | first2 = Morgan L. | last3 = Gray | first3 = Harry B. | last4 = Ponce | first4 = Adrian | title = Terbium-Macrocycle Complexes as Chemical Sensors: Detection of an Aspirin Metabolite in Urine Using a Salicylurate-Specific Receptor Site | journal = Inorganic Chemistry | date = 2010 | volume = 49 | issue = 10 | pages = 4643–4647 | doi = 10.1021/ic1003066}}<br>{{cite journal | last1 = Tabata | first1 = Masaaki | last2 = Habib | first2 = Ahsan | last3 = Watanabe | first3 = Keiichi | title = DNA Cleavage by Good’s Buffers in the Presence of Au(III) | journal = Bulletin of the Chemical Society of Japan | date = 2005 | volume = 78 | issue = 7 | pages = 1263–1269 | doi = 10.1246/bcsj.78.1263}}</ref> |
|
| pKa = 10.4 |
|
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
| SPhrases = {{S22}} {{S24/25}} |
|
| GHSPictograms = {{GHS07}} |
|
|
| GHSSignalWord = Warning |
|
|
| HPhrases = {{H-phrases|302|315|319|335}} |
|
|
| PPhrases = {{P-phrases|261|264|270|271|280|301+312|302+352|304+340|305+351+338|312|321|330|332+313|337+313|362|403+233|405|501}} |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''CAPS''' is the common name for '''''N''-cyclohexyl-3-aminopropanesulfonic acid''', a chemical used as ] in ]. The similar substance ''N''-cyclohexyl-2-hydroxyl-3-aminopropanesulfonic acid (CAPSO) is also used as buffering agent in biochemistry. |
|
'''CAPS''' is the common name for '''3-(Cyclohexylamino)-1-propanesulfonic acid''', a chemical used as ] in ]. The similar substance ''N''-cyclohexyl-2-hydroxyl-3-aminopropanesulfonic acid (CAPSO) is also used as buffering agent in biochemistry. Its useful pH range is 9.7-11.1. |
|
|
|
|
|
==See also== |
|
==See also== |
|
*] |
|
|
*] |
|
*] |
|
|
*] |
|
*] |
|
|
*] |
|
|
*] |
|
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
⚫ |
] |
|
⚫ |
] |
|
|
|
|
| ⚫ |
{{biochem-stub}} |
|
|
|
|
|
|
⚫ |
{{biochem-stub}} |
| ⚫ |
] |
|
| ⚫ |
] |
|