Revision as of 14:54, 13 November 2010 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: StdInChI StdInChIKey.← Previous edit |
Latest revision as of 00:11, 5 November 2022 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers172,083 edits +sd |
(25 intermediate revisions by 22 users not shown) |
Line 1: |
Line 1: |
|
|
{{short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| verifiedrevid = 396516252 |
|
| IUPAC_name = 3-fluoro-7-(2,2,2-trifluoroethoxy)phenoxathiine 10,10-dioxide |
|
| IUPAC_name = 3-fluoro-7-(2,2,2-trifluoroethoxy)phenoxathiine 10,10-dioxide |
|
| image = CX157 structure.svg |
|
| image = CX157 structure.svg |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_status = Uncontrolled |
|
⚫ |
| routes_of_administration = Oral |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 205187-53-7 |
|
|
| CAS_number_Ref = {{cascite|correct|CAS}} |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = O6L62LZJ0Q |
|
⚫ |
| ATC_prefix = none |
|
⚫ |
| ATC_suffix = |
|
⚫ |
| PubChem = 18687754 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 13701383 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| C = 14 | H = 8 | F = 4 | O = 4 | S = 1 |
|
⚫ |
| smiles = FC(F)(F)COc2cc3Oc1cc(F)ccc1S(=O)(=O)c3cc2 |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C14H8F4O4S/c15-8-1-3-12-10(5-8)22-11-6-9(21-7-14(16,17)18)2-4-13(11)23(12,19)20/h1-6H,7H2 |
|
| StdInChI = 1S/C14H8F4O4S/c15-8-1-3-12-10(5-8)22-11-6-9(21-7-14(16,17)18)2-4-13(11)23(12,19)20/h1-6H,7H2 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = PDIMOTRDGUQMNY-UHFFFAOYSA-N |
|
| StdInChIKey = PDIMOTRDGUQMNY-UHFFFAOYSA-N |
⚫ |
| CAS_number = |
|
⚫ |
| ATC_prefix = none |
|
⚫ |
| ATC_suffix = |
|
⚫ |
| PubChem = 18687754 |
|
⚫ |
| ChemSpiderID = 13701383 |
|
|
| chemical_formula = C<sub>14</sub>H<sub>8</sub>F<sub>4</sub>O<sub>4</sub>S |
|
|
| molecular_weight = 348.27 g/mol |
|
⚫ |
| smiles = FC(F)(F)COc2cc3Oc1cc(F)ccc1S(=O)(=O)c3cc2 |
|
⚫ |
| bioavailability = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_status = Uncontrolled |
|
⚫ |
| routes_of_administration = Oral |
|
|
}} |
|
}} |
|
|
|
|
|
'''Tyrima''' ('''CX157''') is a ] and ] (RIMA).<ref>{{cite conference |author=Fielding R, Mielach F, Free J, Pande A |title=Pharmacokinetics and oral bioavailability of CX157, a reversible selective MAO-A inhibitor, in primates |year=2007 |conference=2007 AAPS Annual Meeting & Exposition |url=http://www.aapsj.org/abstracts/AM_2007/AAPS2007-001233.PDF |accessdate=2009-06-14}}</ref> It is currently in phase II ]s for the treatment of ].<ref>{{ClinicalTrialsGov|NCT00739908}}</ref> |
|
'''CX157''' (proposed trade name '''TriRima''', formerly '''Tyrima''') is a ] and ] (RIMA).<ref>{{cite conference |vauthors=Fielding R, Mielach F, Free J, Pande A |title=Pharmacokinetics and oral bioavailability of CX157, a reversible selective MAO-A inhibitor, in primates |year=2007 |conference=2007 AAPS Annual Meeting & Exposition |url=http://www.aapsj.org/abstracts/AM_2007/AAPS2007-001233.PDF |accessdate=2009-06-14 |archive-url=https://web.archive.org/web/20110526192425/http://www.aapsj.org/abstracts/AM_2007/AAPS2007-001233.PDF |archive-date=2011-05-26 |url-status=dead }}</ref> As of 2007 it was in ] ]s for the treatment of ].<ref>{{ClinicalTrialsGov|NCT00739908}|A Study of CX157 (TriRima) for the Treatment of Depression (CX157-200)}}</ref> In 2013, work on the drug was terminated. |
|
|
|
|
== See also == |
|
⚫ |
* ] (RIMA) |
|
|
* ] (MAOI) |
|
|
|
|
|
|
== References == |
|
==References== |
|
{{Reflist|2}} |
|
{{Reflist|2}} |
|
|
|
|
|
|
|
|
|
|
{{Monoamine metabolism modulators}} |
|
{{Antidepressants}} |
|
|
{{Anxiolytics}} |
|
|
{{Adrenergics}} |
|
|
{{Dopaminergics}} |
|
|
{{Serotonergics}} |
|
|
|
|
|
|
⚫ |
] |
|
] |
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|