Revision as of 21:31, 27 January 2011 editYobot (talk | contribs)Bots4,733,870 editsm WP:CHECKWIKI error 61 fixes + general fixes, References after punctuation per WP:REFPUNC and WP:PAIC using AWB (7510)← Previous edit |
Latest revision as of 07:35, 10 August 2024 edit undoWhywhenwhohow (talk | contribs)Autopatrolled, Extended confirmed users, Pending changes reviewers49,257 editsm script-assisted date audit and style fixes per MOS:NUM |
(76 intermediate revisions by 42 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
|
|
{{Use mdy dates|date=August 2024}} |
|
| IUPAC_name = |
|
|
|
{{cs1 config |name-list-style=vanc |display-authors=6}} |
|
| image = Cabazitaxel.png |
|
|
|
{{Infobox drug |
|
| alt = |
|
|
|
| Verifiedfields = changed |
|
| CAS_number = 183133-96-2 |
|
|
|
| Watchedfields = changed |
|
| ATC_prefix = <!-- 'none' if uncategorised --> |
|
|
|
| verifiedrevid = 460123299 |
|
| ATC_suffix = |
|
|
|
| image = Cabazitaxel.png |
|
| PubChem = |
|
|
| DrugBank = |
|
| width = |
|
|
| alt = |
|
| C=45 | H=57 | N=1 | O=14 |
|
|
|
| caption = |
|
| molecular_weight = 894.01 |
|
|
|
|
|
|
<!-- Clinical data --> |
|
|
| pronounce = |
|
|
| tradename = Jevtana |
|
|
| Drugs.com = {{drugs.com|monograph|cabazitaxel}} |
|
|
| MedlinePlus = a611009 |
|
|
| DailyMedID = Cabazitaxel |
|
|
| pregnancy_AU = D |
|
|
| pregnancy_AU_comment = |
|
|
| pregnancy_category = |
|
|
| routes_of_administration = ] |
|
|
| class = |
|
|
| ATC_prefix = L01 |
|
|
| ATC_suffix = CD04 |
|
|
| ATC_supplemental = |
|
|
|
|
|
<!-- Legal status --> |
|
|
| legal_AU = S4 |
|
|
| legal_AU_comment = |
|
|
| legal_BR = <!-- OTC, A1, A2, A3, B1, B2, C1, C2, C3, C4, C5, D1, D2, E, F --> |
|
|
| legal_BR_comment = |
|
|
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_CA_comment = |
|
|
| legal_DE = <!-- Anlage I, II, III or Unscheduled --> |
|
|
| legal_DE_comment = |
|
|
| legal_NZ = <!-- Class A, B, C --> |
|
|
| legal_NZ_comment = |
|
|
| legal_UK = POM |
|
|
| legal_UK_comment = |
|
|
| legal_US = Rx-only |
|
|
| legal_US_comment = <ref name="Jevtana FDA label">{{cite web | title=Jevtana- cabazitaxel kit | website=DailyMed | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=de3d9c26-572b-4ea4-9b2d-dd58a2b3e8fa | access-date=December 30, 2021}}</ref> |
|
|
| legal_EU = Rx-only |
|
|
| legal_EU_comment = <ref>{{cite web | title=Jevtana EPAR | website=European Medicines Agency (EMA) | date=March 17, 2011 | url=https://www.ema.europa.eu/en/medicines/human/EPAR/jevtana | access-date=August 10, 2024}}</ref> |
|
|
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV --> |
|
|
| legal_UN_comment = |
|
|
| legal_status = <!-- For countries not listed above --> |
|
|
|
|
|
<!-- Pharmacokinetic data --> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
|
| metabolites = |
|
|
| onset = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| duration_of_action = |
|
|
| excretion = |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
|
|
|
| pregnancy_US = D |
|
|
|
<!-- Identifiers --> |
|
| pregnancy_category= |
|
|
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
|
|
| CAS_number = 183133-96-2 |
|
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
|
| CAS_supplemental = |
|
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM --> |
|
|
| legal_US = Rx-only |
|
| PubChem = 9854073 |
|
|
| IUPHAR_ligand = 6798 |
|
| legal_status = |
|
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| routes_of_administration = Intravenous |
|
|
|
| DrugBank = DB06772 |
|
| licence_US = Cabazitaxel |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 8029779 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 51F690397J |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
| KEGG = D09755 |
|
|
| KEGG2 = D10452 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 63584 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 1201748 |
|
|
| NIAID_ChemDB = |
|
|
| PDB_ligand = |
|
|
| synonyms = XRP-6258 |
|
|
|
|
|
<!-- Chemical and physical data --> |
|
|
| IUPAC_name = (1''S'',2''S'',3''R'',4''S'',7''R'',9''S'',10''S'',12''R'',15''S'')-4-(Acetyloxy)-15-<nowiki/>{amino}-2-hydroxy-3-phenylpropanoyl]oxy}-1-hydroxy-9,12-dimethoxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracycloheptadec-13-en-2-yl benzoate |
|
|
| C=45 | H=57 | N=1 | O=14 |
|
|
| SMILES = CO1C2OC2(OC(C)=O)2(OC(=O)c3ccccc3)3(O)C(OC(=O)(O)(NC(=O)OC(C)(C)C)c4ccccc4)C(C)=C((OC)C(=O)12C)C3(C)C |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C45H57NO14/c1-24-28(57-39(51)33(48)32(26-17-13-11-14-18-26)46-40(52)60-41(3,4)5)22-45(53)37(58-38(50)27-19-15-12-16-20-27)35-43(8,36(49)34(55-10)31(24)42(45,6)7)29(54-9)21-30-44(35,23-56-30)59-25(2)47/h11-20,28-30,32-35,37,48,53H,21-23H2,1-10H3,(H,46,52)/t28-,29-,30+,32-,33+,34+,35-,37-,43+,44-,45+/m0/s1 |
|
|
| StdInChI_comment = |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChIKey = BMQGVNUXMIRLCK-OAGWZNDDSA-N |
|
|
| density = |
|
|
| density_notes = |
|
|
| melting_point = |
|
|
| melting_high = |
|
|
| melting_notes = |
|
|
| boiling_point = |
|
|
| boiling_notes = |
|
|
| solubility = |
|
|
| sol_units = |
|
|
| specific_rotation = |
|
}} |
|
}} |
|
|
|
|
|
'''Cabazitaxel''' (previously XRP-6258, tradename Jevtana) is a semi-synthetic derivative of a natural ].<ref>http://www.cancer.gov/drugdictionary/?CdrID=534131</ref> It was developed by ] and was approved by the U.S. Food and Drug Administration (FDA) for the treatment of hormone-refractory ] on June 17, 2010. It is a microtubule inhibitor.<ref>{{cite press release |
|
'''Cabazitaxel''', sold under the brand name '''Jevtana''', is a semi-synthetic derivative of a natural ].<ref>{{cite web | title = Cabazitaxel | url = http://www.cancer.gov/drugdictionary/?CdrID=534131 | work = NCI Drug Dictionary | publisher = U.S. Department of Health and Human Services, National Institutes of Health, National Cancer Institute|date = February 2, 2011}}</ref> It is a ] inhibitor,<ref name="Jevtana FDA label" /> and the fourth ] to be approved as a ].{{citation needed|date=December 2021}} |
|
| title = Jevtana (cabazitaxel) Injection Approved by U.S. FDA After Priority Review |
|
|
| publisher = sanofi-aventis |
|
|
| date = 2010-06-17 |
|
|
| url = http://sanofi-aventis.mediaroom.com/index.php?s=43&item=288 |
|
|
| accessdate = June 17, 2010 |
|
|
}}</ref> |
|
|
|
|
|
|
|
Cabazitaxel was developed by ] and was approved by the US ] (FDA) for the treatment of hormone-refractory ] in June 2010.<ref>{{cite web | title=Drug Approval Package: Jevtana (Cabazitaxel) NDA #201023 | website=U.S. ] (FDA) | date=July 8, 2013 | url=https://www.accessdata.fda.gov/drugsatfda_docs/nda/2010/201023s000TOC.cfm | access-date=December 30, 2021 }}</ref><ref>{{cite press release | title=Jevtana (cabazitaxel) Injection Approved by U.S. FDA After Priority Review | publisher=Sanofi Aventis | via=PR Newswire | date=June 17, 2010 | url=https://www.prnewswire.com/news-releases/jevtana-cabazitaxel-injection-approved-by-us-fda-after-priority-review-96589609.html | access-date=December 30, 2021}}</ref><ref>{{cite press release | title=Jevtana (cabazitaxel) Injection Approved by U.S. FDA After Priority Review - Jun 17, 2010 | publisher=Sanofi | date=June 17, 2010 | url=https://www.news.sanofi.us/press-releases?item=118525 | access-date=December 30, 2021}}</ref> It is available as a ].<ref>{{cite web | title=Cabazitaxel: FDA-Approved Drugs | website=U.S. ] (FDA) | url=https://www.accessdata.fda.gov/scripts/cder/daf/index.cfm?event=overview.process&ApplNo=207949 | access-date=December 30, 2021}}</ref><ref>{{cite web | title=First Generic Drug Approvals | website=U.S. Food and Drug Administration | date=October 17, 2022 | url=https://www.fda.gov/drugs/drug-and-biologic-approval-and-ind-activity-reports/first-generic-drug-approvals | access-date=November 28, 2022}}</ref> |
|
Cabazitaxel in combination with ] is a treatment option for ] following or during ]-based treatment. |
|
|
|
|
|
|
== Medical uses == |
|
|
Cabazitaxel is ] in combination with ] for the treatment of metastatic castration-resistant ] following ]-based treatment.<ref name="Jevtana FDA label" /> |
|
|
|
|
|
== Mechanism of action == |
|
|
Taxanes enhance microtubule stabilization and inhibit cellular mitosis and division.<ref>{{cite journal | vauthors = Jordan MA, Wilson L | title = Microtubules as a target for anticancer drugs | journal = Nature Reviews. Cancer | volume = 4 | issue = 4 | pages = 253–65 | date = April 2004 | pmid = 15057285 | doi = 10.1038/nrc1317 | s2cid = 10228718 }}</ref> Moreover, taxanes prevent androgen receptor (AR) signaling by binding cellular microtubules and the microtubule-associated motor protein dynein, thus averting AR nuclear translocation.<ref>{{cite journal | vauthors = Darshan MS, Loftus MS, Thadani-Mulero M, Levy BP, Escuin D, Zhou XK, Gjyrezi A, Chanel-Vos C, Shen R, Tagawa ST, Bander NH, Nanus DM, Giannakakou P | title = Taxane-induced blockade to nuclear accumulation of the androgen receptor predicts clinical responses in metastatic prostate cancer | journal = Cancer Research | volume = 71 | issue = 18 | pages = 6019–29 | date = September 2011 | pmid = 21799031 | pmc = 3354631 | doi = 10.1158/0008-5472.CAN-11-1417 }}</ref> |
|
|
|
|
|
==Clinical trials== |
|
==Clinical trials== |
|
|
In people with metastatic castration-resistant prostate cancer (mCRPC), overall survival (OS) is markedly enhanced with cabazitaxel versus mitoxantrone after prior docetaxel treatment. FIRSTANA (ClinicalTrials.gov identifier: NCT01308567) assessed whether cabazitaxel 20 mg/m<sup>2</sup> (C20) or 25 mg/m<sup>2</sup> (C25) is superior to docetaxel 75 mg/m<sup>2</sup> (D75) in terms of OS in patients with chemotherapy-naïve mCRPC. However, C20 and C25 did not demonstrate superiority for OS versus D75 in people with chemotherapy-naïve mCRPC. Cabazitaxel and docetaxel demonstrated different toxicity profiles, and C20 showed the overall lowest toxicity.<ref name="ascopubs.org">{{cite journal | vauthors = Oudard S, Fizazi K, Sengeløv L, Daugaard G, Saad F, Hansen S, Hjälm-Eriksson M, Jassem J, Thiery-Vuillemin A, Caffo O, Castellano D, Mainwaring PN, Bernard J, Shen L, Chadjaa M, Sartor O | title = Cabazitaxel Versus Docetaxel As First-Line Therapy for Patients With Metastatic Castration-Resistant Prostate Cancer: A Randomized Phase III Trial-FIRSTANA | journal = Journal of Clinical Oncology | volume = 35 | issue = 28 | pages = 3189–3197 | date = October 2017 | pmid = 28753384 | doi = 10.1200/JCO.2016.72.1068 }}</ref> |
|
In a phase III trial with 755 men for the treatment of ], median survival was 15.1 months for patients receiving cabazitaxel versus 12.7 months for patients receiving mitoxantrone. Cabazitaxel was associated with more grade 3-4 neutropenia (81.7%) than mitoxantrone (58%).<ref>{{cite web |url=http://professional.cancerconsultants.com/oncology_main_news.aspx?id=44709 |title=Cabazitaxel Effective for Hormone Refractory Prostate Cancer After Failure of Taxotere }}</ref> |
|
|
|
In a ] with 755 men for the treatment of ], median survival was 15.1 months for participants receiving cabazitaxel versus 12.7 months for participants receiving ]. Cabazitaxel was associated with more grade 3–4 ] (81.7%) than mitoxantrone (58%).<ref>{{cite web |url=http://professional.cancerconsultants.com/oncology_main_news.aspx?id=44709 |title=Cabazitaxel Effective for Hormone Refractory Prostate Cancer After Failure of Taxotere }}{{Dead link|date=November 2018 |bot=InternetArchiveBot |fix-attempted=yes }}</ref> Common adverse effects with cabazitaxel include neutropenia (including febrile neutropenia) and GIT side effects appeared mainly in diarrhea, whereas, neuropathy was rarely detected.<ref name="ncbi.nlm.nih.gov">{{cite journal | vauthors = Paller CJ, Antonarakis ES | title = Cabazitaxel: a novel second-line treatment for metastatic castration-resistant prostate cancer | journal = Drug Design, Development and Therapy | volume = 5 | pages = 117–24 | date = March 2011 | pmid = 21448449 | pmc = 3063116 | doi = 10.2147/DDDT.S13029 | doi-access = free }}</ref> |
|
|
|
|
|
|
== Pharmacokinetics == |
|
==References== |
|
|
|
Cabazitaxel administration causes a decrease in plasma concentrations showing triphasic kinetics: a mean half life (t<sub>1/2</sub>) of 2.6 min in the first phase, a mean t<sub>1/2</sub> of 1.3 h in the second phase, and a mean t<sub>1/2</sub> of 77.3 h in the third phase.<ref>{{cite journal | vauthors = Mita AC, Denis LJ, Rowinsky EK, Debono JS, Goetz AD, Ochoa L, Forouzesh B, Beeram M, Patnaik A, Molpus K, Semiond D, Besenval M, Tolcher AW | title = Phase I and pharmacokinetic study of XRP6258 (RPR 116258A), a novel taxane, administered as a 1-hour infusion every 3 weeks in patients with advanced solid tumors | journal = Clinical Cancer Research | volume = 15 | issue = 2 | pages = 723–30 | date = January 2009 | pmid = 19147780 | doi = 10.1158/1078-0432.CCR-08-0596 | doi-access = free }}</ref> |
|
|
|
|
|
=== Metabolism === |
|
|
Cabazitaxel is metabolized in the liver by , which result in seven plasma metabolites and excreted 20 metabolites. During 14 days after administration, 80% of cabazitaxel is excreted: 76% in the feces and 3.7% as a renal excretion.<ref name=":0">{{cite journal | vauthors = Tsao CK, Cutting E, Martin J, Oh WK | title = The role of cabazitaxel in the treatment of metastatic castration-resistant prostate cancer | journal = Therapeutic Advances in Urology | volume = 6 | issue = 3 | pages = 97–104 | date = June 2014 | pmid = 24883107 | pmc = 4003844 | doi = 10.1177/1756287214528557 }}</ref> |
|
|
|
|
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
== External links == |
|
== External links == |
|
|
* {{ClinicalTrialsGov|NCT00417079|XRP6258 Plus Prednisone Compared to Mitoxantrone Plus Prednisone in Hormone Refractory Metastatic Prostate Cancer (TROPIC)}} |
|
* - Official web site of manufacturer. |
|
|
|
* {{ClinicalTrialsGov|NCT01308580|Cabazitaxel at 20 mg/m² Compared to 25 mg/m² With Prednisone for the Treatment of Metastatic Castration Resistant Prostate Cancer (PROSELICA)}} |
|
* - Official prescribing information. |
|
|
|
* {{ClinicalTrialsGov|NCT02485691|Cabazitaxel Versus the Switch to Alternative AR-targeted Agent (Enzalutamide or Abiraterone) in Metastatic Castration-resistant Prostate Cancer (mCRPC) Patients Previously Treated With Docetaxel and Who Rapidly Failed a Prior AR-targeted Agent (CARD)}} |
|
* |
|
|
|
|
|
|
{{Chemotherapeutic agents}} |
|
{{Chemotherapeutic agents}} |
|
|
{{Portal bar | Medicine}} |
|
|
{{Authority control}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
|
|
|
{{antineoplastic-drug-stub}} |
|
|
|
|
|
] |
|
|
] |
|