| Revision as of 17:42, 17 December 2010 editLuckas-bot (talk | contribs)929,662 editsm r2.5.2) (robot Adding: vi:Canxi erythorbat← Previous edit |
Latest revision as of 09:36, 24 November 2024 edit undoGraeme Bartlett (talk | contribs)Administrators249,716 edits chemspider |
| (11 intermediate revisions by 11 users not shown) |
| Line 1: |
Line 1: |
|
{{orphan|date=August 2010}} |
|
|
|
|
|
{{Unreferenced|date=August 2010}} |
|
|
{{chembox |
|
{{chembox |
|
|
| verifiedrevid = 402888917 |
|
| Reference = |
|
|
| Name = Calcium erythorbate |
|
| Reference = |
|
|
| Name = Calcium erythorbate |
|
| ImageFile = Calcium erythorbate.png |
|
| ImageFile = Calcium erythorbate.png |
|
| ImageSize = 180px |
|
| ImageSize = 180px |
|
| ImageName = Calcium erythorbate |
|
| ImageName = Calcium erythorbate |
|
| IUPACName = Calcium 5-(1,2-dihydroxyethyl)-3-hydroxy -4-oxo-furan-2-olate |
|
| PIN = Calcium bis{(2''R'')-2--4-hydroxy-5-oxo-2,5-dihydrofuran-3-olate} |
|
| OtherNames = Erythorbic acid, calcium salt; E318 |
|
| OtherNames = Erythorbic acid, calcium salt; E318 |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo = 99552-34-8 |
|
| CASNo = 99552-34-8 |
|
|
| ChemSpiderID = 57566561 |
| ⚫ |
| SMILES = OC1=C()((O)CO)()OC1=O.OC1=C()((O)CO)()OC1=O. |
|
|
|
| PubChem = 54737445 |
|
|
| EC_number = 227-261-5 |
|
|
| InChI=1S/2C6H8O6.Ca/c2*7-1-2(8)5-3(9)4(10)6(11)12-5;/h2*2,5,7-10H,1H2;/q;;+2/p-2 |
|
|
| InChIKey = BLORRZQTHNGFTI-UHFFFAOYSA-L |
|
⚫ |
| SMILES = OC1=C()((O)CO)()OC1=O.OC1=C()((O)CO)()OC1=O. |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = Ca(C<sub>6</sub>H<sub>7</sub>O<sub>6</sub>)<sub>2</sub> |
|
| Formula = Ca(C<sub>6</sub>H<sub>7</sub>O<sub>6</sub>)<sub>2</sub> |
|
| MolarMass = 390.31 |
|
| MolarMass = 390.31 g/mol |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| Solubility = |
|
| Solubility = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
}} |
|
}} |
|
| Section7 = {{Chembox Hazards |
|
|Section7={{Chembox Hazards |
|
| ExternalMSDS = |
|
| ExternalSDS = |
|
| MainHazards = |
|
| MainHazards = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Calcium erythorbate''' is a food additive. Chemically, it is the ] ] of ], with the chemical formula Ca(C<sub>6</sub>H<sub>7</sub>O<sub>6</sub>)<sub>2</sub>. As an ] structurally related to ], it helps improve flavor stability and prevents the formation of ]ic ]s. |
|
'''Calcium erythorbate''' is a food additive.<ref>{{Cite book |last1=Hui |first1=Y. H. |url=https://books.google.com/books?id=Vu8gsgLeW-YC |title=Handbook of Fruits and Fruit Processing |last2=Barta |first2=József |last3=Cano |first3=M. Pilar |last4=Gusek |first4=Todd W. |last5=Sidhu |first5=Jiwan S. |last6=Sinha |first6=Nirmal K. |date=2008-02-28 |publisher=John Wiley & Sons |isbn=978-0-470-27648-8 |pages=276 |language=en}}</ref> Chemically, it is the ] ] of ], with the chemical formula Ca(C<sub>6</sub>H<sub>7</sub>O<sub>6</sub>)<sub>2</sub>. As an ] structurally related to ], it helps improve flavor stability and prevents the formation of ]ic ]s. |
|
|
|
|
|
==References== |
|
==References== |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
{{DEFAULTSORT:Calcium Erythorbate}} |
|
{{Calcium compounds}} |
|
|
|
|
] |
|
] |
|
] |
|
] |
| Line 41: |
Line 45: |
|
|
|
|
|
{{organic-compound-stub}} |
|
{{organic-compound-stub}} |
|
|
|
|
] |
|