| Revision as of 00:05, 17 October 2010 editDavid A. Rudnick (talk | contribs)6 editsNo edit summary← Previous edit |
Latest revision as of 22:11, 7 January 2024 edit undoMichael7604 (talk | contribs)Extended confirmed users8,895 edits recategorized from Chlorobenzenes to Chlorobenzene derivatives |
| (31 intermediate revisions by 24 users not shown) |
| Line 1: |
Line 1: |
|
{{citesources|date=June 2009}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
|ImageFile=capravirine.png |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageSize=200px |
|
|
|
| verifiedrevid = 391146416 |
| ⚫ |
|IUPACName= |
|
|
⚫ |
| ImageFile = capravirine.png |
| ⚫ |
|OtherNames= |
|
|
⚫ |
| ImageSize = 200px |
| ⚫ |
|Section1={{Chembox Identifiers |
|
|
⚫ |
| PIN = {5--4-(propan-2-yl)-1--1''H''-imidazol-2-yl}methyl carbamate |
| ⚫ |
| CASNo=178979-85-6 |
|
|
⚫ |
| OtherNames = |
| ⚫ |
| PubChem=1783 |
|
|
⚫ |
| Section1 = {{Chembox Identifiers |
|
| SMILES=CC(C)C1=C(N(C(=N1)COC(=O)N)CC2=CC=NC=C2)SC3=CC(=CC(=C3)Cl)Cl |
|
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = VHC779598X |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
⚫ |
| CASNo = 178979-85-6 |
|
⚫ |
| PubChem = 1783 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 435128 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 1717 |
|
|
| SMILES = O=C(OCc2nc(c(Sc1cc(Cl)cc(Cl)c1)n2Cc3ccncc3)C(C)C)N |
|
|
| InChI = 1/C20H20Cl2N4O2S/c1-12(2)18-19(29-16-8-14(21)7-15(22)9-16)26(10-13-3-5-24-6-4-13)17(25-18)11-28-20(23)27/h3-9,12H,10-11H2,1-2H3,(H2,23,27) |
|
|
| InChIKey = YQXCVAGCMNFUMQ-UHFFFAOYAP |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C20H20Cl2N4O2S/c1-12(2)18-19(29-16-8-14(21)7-15(22)9-16)26(10-13-3-5-24-6-4-13)17(25-18)11-28-20(23)27/h3-9,12H,10-11H2,1-2H3,(H2,23,27) |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = YQXCVAGCMNFUMQ-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|Section2={{Chembox Properties |
|
|Section2 = {{Chembox Properties |
|
| Formula=C<sub>20</sub>H<sub>20</sub>Cl<sub>2</sub>N<sub>4</sub>O<sub>2</sub>S |
|
| Formula = C<sub>20</sub>H<sub>20</sub>Cl<sub>2</sub>N<sub>4</sub>O<sub>2</sub>S |
|
| MolarMass=451.37 g/mol |
|
| MolarMass = 451.37 g/mol |
|
| Appearance= |
|
|
|
| Appearance = |
|
| Density= |
|
|
|
| Density = |
|
| MeltingPt= |
|
|
|
| MeltingPt = |
|
| BoilingPt= |
|
|
|
| BoilingPt = |
|
| Solubility= |
|
|
|
| Solubility = |
|
}} |
|
}} |
|
|
|
|
|Section3={{Chembox Hazards |
|
|Section3 = {{Chembox Hazards |
|
| MainHazards= |
|
|
|
| MainHazards = |
|
| FlashPt= |
|
|
|
| FlashPt = |
|
| Autoignition= |
|
|
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Capravirine''' was a non-nucleoside reverse transcriptase inhibitor which reached phase II trials before development was discontinued by Pfizer. Both phase IIb trials which were conducted failed to demonstrate that therapy with capravirine provided any significant advantage over existing triple-drug HIV therapies, and pharmacology studies showed that capravirine may interact with other HIV drugs. |
|
'''Capravirine''' was a non-nucleoside reverse transcriptase inhibitor which reached ] trials before development was discontinued by ].<ref>{{Cite web|url=https://pubchem.ncbi.nlm.nih.gov/compound/1783|title=Capravirine|last=PubChem|website=pubchem.ncbi.nlm.nih.gov|language=en|access-date=2019-06-02}}</ref><ref>{{Cite web|url=https://www.drugdevelopment-technology.com/projects/capravirine/|title=Capravirine - Anti-Retroviral Drug|website=Drug Development Technology|language=en-GB|access-date=2019-06-02}}</ref> Both phase IIb trials which were conducted failed to demonstrate that therapy with capravirine provided any significant advantage over existing triple-drug ] therapies, and pharmacology studies showed that capravirine may interact with other ] ]s.<ref>{{Cite web|url=https://www.drugdevelopment-technology.com/projects/capravirine/|title=Capravirine - Anti-Retroviral Drug|website=Drug Development Technology|language=en-GB|access-date=2019-06-02}}</ref><ref>{{Cite journal|url=https://clinicaltrials.gov/ct2/show/NCT00006211|title=A Study of Capravirine Plus VIRACEPT Plus Two Nucleoside Reverse Transcriptase Inhibitors in HIV-Infected Patients Who Failed Previous Anti-HIV Treatments - Full Text View - ClinicalTrials.gov|website=clinicaltrials.gov|date=23 June 2005 |language=en|access-date=2019-06-02}}</ref> |
|
|
|
|
|
|
|
|
|
== References == |
|
{{Antiretroviral drug}} |
|
<references />{{Antiretroviral drug}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
{{Antiinfective-agent-stub}} |
|
{{Antiinfective-agent-stub}} |