| Revision as of 21:26, 28 July 2011 editRjwilmsi (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers931,939 editsm Journal cites:, added 1 PMID, using AWB (7794)← Previous edit |
Latest revision as of 22:01, 2 December 2023 edit undoCitation bot (talk | contribs)Bots5,418,876 edits Add: doi-access. | Use this bot. Report bugs. | Suggested by Headbomb | #UCB_toolbar |
| (24 intermediate revisions by 15 users not shown) |
| Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 399494354 |
|
| verifiedrevid = 441939937 |
|
| ImageFile = Carasinol B.png |
|
| ImageFile = Carasinol B.png |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
|
| PIN = (2''S'',2′''R'',3''S'',3′''R'')-3′-(3,5-Dihydroxyphenyl)-4--2,2′-bis(hydroxyphenyl)-2,2′,3,3′-tetrahydro-6,6′-diol |
|
| IUPACName = |
|
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 777857-86-0 |
|
| CASNo = 777857-86-0 |
|
| PubChem = |
|
| PubChem = 11309056 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| SMILES = OC(C=C4)=CC=4(23=CC(O)=CC(O)=C3)OC1=C2(5(%11=CC=C(O)C=C%11)OC6=C5(7(9=CC(O)=CC(O)=C9)(%10=CC=C(O)C=C%10)O78=CC=C(O)C=C8)=CC(O)=C6)=CC(O)=C1 |
|
|
|
| ChemSpiderID = 9484024 |
|
|
| SMILES = Oc1ccc(cc1)4Oc2cc(O)cc(c24c3cc(O)cc(O)c3)6c7c(O6c5ccc(O)cc5)cc(O)cc7%10(c8cc(O)cc(O)c8)(O%10c9ccc(O)cc9)c%11ccc(O)cc%11 |
|
|
| InChI = 1/C56H44O13/c57-33-9-1-27(2-10-33)53-47(31-17-37(61)21-38(62)18-31)49-43(23-41(65)25-45(49)67-53)52-50-44(24-42(66)26-46(50)68-55(52)29-5-13-35(59)14-6-29)51-48(32-19-39(63)22-40(64)20-32)54(28-3-11-34(58)12-4-28)69-56(51)30-7-15-36(60)16-8-30/h1-26,47-48,51-66H/t47-,48+,51-,52+,53+,54-,55-,56+/m1/s1 |
|
|
| InChIKey = RAUCCLKIJHMTND-HFRYPGABBW |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C56H44O13/c57-33-9-1-27(2-10-33)53-47(31-17-37(61)21-38(62)18-31)49-43(23-41(65)25-45(49)67-53)52-50-44(24-42(66)26-46(50)68-55(52)29-5-13-35(59)14-6-29)51-48(32-19-39(63)22-40(64)20-32)54(28-3-11-34(58)12-4-28)69-56(51)30-7-15-36(60)16-8-30/h1-26,47-48,51-66H/t47-,48+,51-,52+,53+,54-,55-,56+/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = RAUCCLKIJHMTND-HFRYPGABSA-N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>56</sub>H<sub>44</sub>O<sub>13</sub> |
|
| Formula = C<sub>56</sub>H<sub>44</sub>O<sub>13</sub> |
|
| MolarMass = 924.94 g/mol |
|
| MolarMass = 924.94 g/mol |
|
| ExactMass = 924.278191 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
| Line 20: |
Line 29: |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
⚫ |
'''Carasinol B''' is a stilbenoid ] found in '']'' (Chinese : Jin Que-gen).<ref name="Shu">{{cite journal | doi = 10.1248/bpb.29.608 | url = http://cat.inist.fr/?aModele=afficheN&cpsidt=17780314 | title = Simultaneous determination of the contents of three stilbene oligomers in Caragana sinica collected in different seasons using an improved HPLC method |author1=Shu Na |author2=Zhou Hong |author3=Hu Changqi | journal = Biological & Pharmaceutical Bulletin | year = 2006 | volume = 29 | issue = 4 | pages = 608–612 | pmid=16595888| doi-access = free }}</ref> |
|
|
|
|
|
⚫ |
Acid-catalyzed epimerization of ] to carasinol B can be performed ''in vitro''.<ref>{{cite journal | doi = 10.3390/molecules13040938 | title = Acid-catalyzed Epimerization of Kobophenol A to Carasinol B |author1=Kejun Cheng |author2=Gaolin Liang |author3=Changqi Hu | journal = Molecules | year = 2008 | volume = 13 | issue = 4 | pages = 938–942 | pmid = 18463595| pmc = 6245474 | doi-access = free }}</ref> |
| ⚫ |
'''Carasinol B''' is a stilben ] found in '']'' (Chinese : Jin Que-gen).<ref name="Shu">{{cite journal | doi = 10.1248/bpb.29.608 | url = http://cat.inist.fr/?aModele=afficheN&cpsidt=17780314 | title = Simultaneous determination of the contents of three stilbene oligomers in Caragana sinica collected in different seasons using an improved HPLC method | author = Shu Na; Zhou Hong; Hu Changqi | journal = Biological & Pharmaceutical Bulletin | year = 2006 | volume = 29 | issue = 4 | pages = 608–612 | pmid=16595888}}</ref> |
|
|
|
|
|
|
⚫ |
== References == |
| ⚫ |
Acid-catalyzed epimerization of ] to carasinol B can be performed ''in vitro''.<ref>{{cite journal | doi = 10.3390/molecules13040938 | url = http://www.mdpi.com/1420-3049/13/4/938 | title = Acid-catalyzed Epimerization of Kobophenol A to Carasinol B | author = Kejun Cheng, Gaolin Liang and Changqi Hu | journal = Molecules | year = 2008 | volume = 13 | issue = 4 | pages = 938–942 | pmid = 18463595}}</ref> |
|
|
|
|
| ⚫ |
==References== |
|
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
{{stilbenoids}} |
|
{{Oligostilbenoid}} |
|
|
|
|
|
] |
|
|
] |
|
|
|
|
|
] |
|
|
|
|
|
|
{{Natural-phenol-stub}} |
|
{{Aromatic-stub}} |