| Revision as of 10:34, 2 September 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'ChEBI', 'StdInChI', 'StdInChIKey').← Previous edit |
Latest revision as of 20:35, 29 January 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers172,170 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| (7 intermediate revisions by 7 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| verifiedrevid = 448018743 |
|
| IUPAC_name = (2S,5R,6R)-3,3-dimethyl-7-oxo-6-amino]-4-thia-1-azabicycloheptane-2-carboxylic acid |
|
| IUPAC_name = (2S,5R,6R)-3,3-dimethyl-7-oxo-6-amino]-4-thia-1-azabicycloheptane-2-carboxylic acid |
|
| image = Carfecillin.png |
|
| image = Carfecillin.png |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
| Line 26: |
Line 28: |
|
| ATC_prefix = G01 |
|
| ATC_prefix = G01 |
|
| ATC_suffix = AA08 |
|
| ATC_suffix = AA08 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 3414 |
|
| ChEBI = 3414 |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C23H22N2O6S/c1-23(2)17(21(28)29)25-19(27)16(20(25)32-23)24-18(26)15(13-9-5-3-6-10-13)22(30)31-14-11-7-4-8-12-14/h3-12,15-17,20H,1-2H3,(H,24,26)(H,28,29)/t15?,16-,17+,20-/m1/s1 |
|
| StdInChI = 1S/C23H22N2O6S/c1-23(2)17(21(28)29)25-19(27)16(20(25)32-23)24-18(26)15(13-9-5-3-6-10-13)22(30)31-14-11-7-4-8-12-14/h3-12,15-17,20H,1-2H3,(H,24,26)(H,28,29)/t15?,16-,17+,20-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = NZDASSHFKWDBBU-KVMCETHSSA-N |
|
| StdInChIKey = NZDASSHFKWDBBU-KVMCETHSSA-N |
|
| PubChem = 33672 |
|
| PubChem = 33672 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 31054 |
|
| ChemSpiderID = 31054 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| Line 38: |
Line 45: |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=23 | H=22 | N=2 | O=6 | S=1 |
|
| C=23 | H=22 | N=2 | O=6 | S=1 |
|
| molecular_weight = 454.49558 g/mol |
|
|
| smiles = O=C(O)3N4C(=O)(NC(=O)C(c1ccccc1)C(=O)Oc2ccccc2)4SC3(C)C |
|
| smiles = O=C(O)3N4C(=O)(NC(=O)C(c1ccccc1)C(=O)Oc2ccccc2)4SC3(C)C |
|
| InChI = 1/C23H22N2O6S/c1-23(2)17(21(28)29)25-19(27)16(20(25)32-23)24-18(26)15(13-9-5-3-6-10-13)22(30)31-14-11-7-4-8-12-14/h3-12,15-17,20H,1-2H3,(H,24,26)(H,28,29)/t15?,16-,17+,20-/m1/s1 |
|
|
| InChIKey = NZDASSHFKWDBBU-KVMCETHSBN |
|
|
}} |
|
}} |
|
|
|
|
|
'''Carfecillin''' is a ] ]. It is a ] derivative of ], acting as a ]. |
|
'''Carfecillin''' is a ] ]. It is a ] derivative of ], acting as a ].<ref name="pmid21771">{{cite journal | vauthors = Basker MJ, Comber KR, Sutherland R, Valler GH | title = Carfecillin: antibacterial activity in vitro and in vivo | journal = Chemotherapy | volume = 23 | issue = 6 | pages = 424–35 | date = 1977 | pmid = 21771 | doi = 10.1159/000222012 }}</ref> |
|
|
|
|
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
{{Gynecological anti-infectives and antiseptics}} |
|
{{Gynecological anti-infectives and antiseptics}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|