| Revision as of 05:48, 5 March 2011 editحسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 edits added Category:Phenanthrenes using HotCat← Previous edit |
Latest revision as of 15:38, 8 June 2023 edit undoCitation bot (talk | contribs)Bots5,424,104 edits Add: bibcode. | Use this bot. Report bugs. | Suggested by Spinixster | Category:Isopropyl compounds | #UCB_Category 84/169 |
| (51 intermediate revisions by 32 users not shown) |
| Line 1: |
Line 1: |
|
|
{{more citations needed|date=October 2014}} |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 417210567 |
|
| Name = Carnosic acid |
|
| Name = Carnosic acid |
|
| ImageFile = Carnosic acid.svg |
|
| ImageFile = Carnosic acid.svg |
|
| ImageSize = 200px |
|
|
| ImageName = Chemical structure of carnosic acid |
|
| ImageName = Chemical structure of carnosic acid |
|
| ImageAlt = Chemical structure of carnosic acid |
|
| ImageAlt = Chemical structure of carnosic acid |
|
| IUPACName = (4aR,10aS)-5,6-dihydroxy-1,1-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-4a-carboxylic acid |
|
| IUPACName = 11,12-Dihydroxyabieta-8,11,13-trien-20-oic acid |
|
|
| SystematicName = (4a''R'',10a''S'')-5,6-Dihydroxy-1,1-dimethyl-7-(propan-2-yl)-1,3,4,9,10,10a-hexahydrophenanthrene-4a(2''H'')-carboxylic acid |
|
| OtherNames = Salvin<!-- <br> --> |
|
| OtherNames = Salvin |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo = 3650-09-7 |
|
| CASNo = 3650-09-7 |
|
| CASNo_Ref = |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASOther = |
|
| CASNoOther = |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = LI791SXT24 |
|
| PubChem = 65126 |
|
| PubChem = 65126 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 65585 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 484853 |
|
| SMILES = CC(C)C1=C(C(=C2C(=C1)CCC3C2(CCCC3(C)C)C(=O)O)O)O |
|
| SMILES = CC(C)C1=C(C(=C2C(=C1)CCC3C2(CCCC3(C)C)C(=O)O)O)O |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| InChI = |
|
|
|
| ChemSpiderID = 58635 |
|
|
| InChI = 1/C20H28O4/c1-11(2)13-10-12-6-7-14-19(3,4)8-5-9-20(14,18(23)24)15(12)17(22)16(13)21/h10-11,14,21-22H,5-9H2,1-4H3,(H,23,24)/t14-,20+/m0/s1 |
|
|
| InChIKey = QRYRORQUOLYVBU-VBKZILBWBB |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C20H28O4/c1-11(2)13-10-12-6-7-14-19(3,4)8-5-9-20(14,18(23)24)15(12)17(22)16(13)21/h10-11,14,21-22H,5-9H2,1-4H3,(H,23,24)/t14-,20+/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = QRYRORQUOLYVBU-VBKZILBWSA-N |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=20 | H=28 | O=4 |
|
| Formula = C<sub>20</sub>H<sub>28</sub>O<sub>4</sub> |
|
|
| MolarMass = 332.42 g/mol |
|
|
| ExactMass = 332.1987584 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
|
| MeltingPtC = 185 to 190 |
|
| MeltingPt = 185–190 °C |
|
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
| RPhrases = <!-- {{R10}}, {{R23}}, {{R34}}, {{R50}} etc. --> |
|
|
| SPhrases = <!-- {{S1/2}}, {{S9}}, {{S16}}, {{S26}}, {{S36/37/39}}, {{S45}}, {{S61}} etc. --> |
|
|
}} |
|
}} |
|
}} |
|
}} |
| ⚫ |
'''Carnosic acid''' is a natural ] ] found in the rosemary ('']'') and the common sage ('']'').<ref>{{cite journal |last1 =Schwarz |first1 =Karin |last2 =Ternes |first2 =Waldemar |title =Antioxidative constituents ofRosmarinus officinalis andSalvia officinalis |doi =10.1007/BF01201766 |journal =Zeitschrift f�r Lebensmittel-Untersuchung und -Forschung |year =1992 |volume =195 | pages= 99–103}}</ref> Dried leaves of rosemary or sage contain 1.5 to 2.5% carnosic acid. |
|
|
|
|
|
|
⚫ |
'''Carnosic acid''' is a natural ] ] ] found in rosemary ('']'') and common sage ('']'').<ref>{{cite journal |last1 =Schwarz |first1 =Karin |last2 =Ternes |first2 =Waldemar |title =Antioxidative constituents of Rosmarinus officinalis and Salvia officinalis |doi =10.1007/BF01201766 |pmid =1529648 |journal =Zeitschrift für Lebensmittel-Untersuchung und -Forschung |year =1992 |volume =195 |issue =2 | pages= 99–103|s2cid =100385294 }}</ref> Dried leaves of rosemary and sage contain 1.5 to 2.5% carnosic acid. |
|
Carnosic acid has medicinal properties. It is a potent antioxidant. It protects skin cells against UV-A radiation (]). Studies in animals have also found a protection against carcinogens (]). |
|
|
|
|
|
|
|
Carnosic acid and ], a derivative of the acid, are used as ] ]s in food and nonfood products, where they're labelled as "extracts of rosemary" (]392).<ref>{{Cite journal |last1=Birtić |first1=Simona |last2=Dussort |first2=Pierre |last3=Pierre |first3=François-Xavier |last4=Bily |first4=Antoine C. |last5=Roller |first5=Marc |date=2015-07-01 |title=Carnosic acid |journal=Phytochemistry |language=en |volume=115 |pages=9–19 |doi=10.1016/j.phytochem.2014.12.026 |pmid=25639596 |bibcode=2015PChem.115....9B |issn=0031-9422|doi-access=free }}</ref> |
|
Carnosic acid is used as a preservative or antioxidant in food and non-food products (eg toothpaste , mouthwash and chewing gum -in which it has an antibiotic effect against micro-organisms responsible for bad breath- or skin care products). |
|
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
⚫ |
] |
|
⚫ |
] |
|
|
] |
|
] |
|
] |
| ⚫ |
] |
|
| ⚫ |
] |
|
|
|
|
|
{{Natural phenol-stub}} |
|
|
|
|
|
] |
|
|
] |
|