| Revision as of 14:42, 30 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem/Drugbox validation← Previous edit |
Latest revision as of 19:16, 31 July 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,126 edits added Category:Cyclohexyl compounds using HotCat |
| (26 intermediate revisions by 14 users not shown) |
| Line 1: |
Line 1: |
|
{{orphan|date=August 2009}} |
|
|
|
|
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 428759792 |
|
| verifiedrevid = 447493788 |
|
| ImageFile = CatFsulf.png |
|
| ImageFile = CatFsulf.png |
|
| ImageSize = 200px |
|
| ImageSize = 190 |
|
|
| ImageFile1 = CataCXium F sulf ions ball.png |
| ⚫ |
| IUPACName = Dicyclohexyl-{9--2-sulfonylfluoren-9-yl}phosphonium hydrogensulfate |
|
|
|
| ImageSize1 = 220 |
|
|
| ImageAlt1 = Ball-and-stick model of the ions in CataCXium F |
|
⚫ |
| IUPACName = (±)-Dicyclohexyl-<nowiki/>{9--2-sulfonylfluoren-9-yl}phosphonium hydrogensulfate |
|
| OtherNames = CataCXium F sulf |
|
| OtherNames = CataCXium F sulf |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo = |
|
| CASNo = 1039775-34-2 |
|
| PubChem = |
|
| PubChem = 24878816 |
|
| SMILES = |
|
| ChemSpiderID = 28475201 |
|
|
| SMILES = c1ccc2c(c1)-c3ccc(cc3C2(CCCc4ccc(cc4)S(=O)(=O)O)(C5CCCCC5)C6CCCCC6)S(=O)(=O)O.OS(=O)(=O) |
|
|
| StdInChI = 1S/C34H41O6PS2.H2O4S/c35-42(36,37)28-19-17-25(18-20-28)10-9-23-34(41(26-11-3-1-4-12-26)27-13-5-2-6-14-27)32-16-8-7-15-30(32)31-22-21-29(24-33(31)34)43(38,39)40;1-5(2,3)4/h7-8,15-22,24,26-27H,1-6,9-14,23H2,(H,35,36,37)(H,38,39,40);(H2,1,2,3,4) |
|
|
| StdInChIKey = HNJNDGZFLWQSEG-UHFFFAOYSA-N |
|
|
|
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>34</sub>H<sub>43</sub>O<sub>10</sub>PS<sub>3 |
|
| Formula = C<sub>34</sub>H<sub>43</sub>O<sub>10</sub>PS<sub>3</sub> |
|
| MolarMass = 738.87 g/mol |
|
| MolarMass = 738.87 g/mol |
|
| Appearance = pale yellow solid |
|
| Appearance = pale yellow solid |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| SolubleOther = soluble in water |
|
| SolubleOther = soluble in water |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
|
| GHSSignalWord = Warning |
|
|
| GHSPictograms = {{GHS07}} |
|
|
| HPhrases = {{H-phrases|315|319|335}} |
|
|
| PPhrases = {{P-phrases|261|264|271|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|403+233|405|501}} |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''CataCXium F sulf''' is a water-soluble ] derived from ]. The palladium complexes of the respective phosphine show an excellent activity in various palladium catalyzed ]s, including ]s, ]s and ]s. |
|
'''CataCXium F sulf''' is a water-soluble ] derived from ]. The ] complexes of the respective phosphine{{clarify|date=June 2014}} show an excellent activity in various ], including ]s, ]s and ]s. |
|
|
|
|
|
==References== |
|
==References== |
|
⚫ |
* C.A. Fleckenstein; H. Plenio, Highly efficient Suzuki-Miyaura coupling of heterocyclic substrates through rational reaction design. ''Chemistry-A European Journal'' '''2008''', ''14(14)'', 4267–4279. |
|
|
|
|
* C.A. Fleckenstein; H. Plenio, Highly efficient Suzuki-Miyaura coupling of heterocyclic substrates through rational reaction design. ''Chemistry-A European Journal'' '''2008''', ''14(14)'', 4267-4279. |
|
* C.A. Fleckenstein; H. Plenio, Aqueous/organic cross coupling: Sustainable protocol for Sonogashira reactions of heterocycles. ''Green Chemistry'' '''2008''', ''10'', 563–570. {{doi|10.1039/B800154E}} |
|
⚫ |
* C.A. Fleckenstein; H. Plenio, Efficient Suzuki-Miyaura Coupling of (Hetero)aryl Chlorides with Thiophene- and Furanboronic Acids in Aqueous ''n''-Butanol. ''Journal of Organic Chemistry'' '''2008''', ''73'', 3236–3244. |
|
|
|
|
* C.A. Fleckenstein; H. Plenio, Aqueous/organic cross coupling: Sustainable protocol for Sonogashira reactions of heterocycles. ''Green Chemistry'' '''2008''', ''10'', 563-570. |
|
* C.A Fleckenstein; R. Kadyrov; H. Plenio, Efficient Large-Scale Synthesis of 9-Alkylfluorenyl Phosphines for Pd-Catalyzed Cross-Coupling Reactions. ''Organic Process Research & Development'' '''2008''', ''12'', 475–479. |
|
|
* C.A. Fleckenstein; H. Plenio, Aqueous cross-coupling. Highly efficient Suzuki–Miyaura coupling of ''N''-heteroaryl halides and ''N''-heteroarylboronic acids. ''Green Chemistry'' '''2007''', ''9'', 1287–1291. {{doi|10.1039/B711965H}} |
|
|
|
| ⚫ |
* C.A. Fleckenstein; H. Plenio, Efficient Suzuki-Miyaura Coupling of (Hetero)aryl Chlorides with Thiophene- and Furanboronic Acids in Aqueous n-Butanol. ''Journal of Organic Chemistry'' '''2008''', ''73'', 3236-3244. |
|
|
|
|
|
* C.A Fleckenstein; R. Kadyrov; H. Plenio, Efficient Large-Scale Synthesis of 9-Alkylfluorenyl Phosphines for Pd-Catalyzed Cross-Coupling Reactions. ''Organic Process Research & Development'' '''2008''', ''12'', 475-479. |
|
|
|
|
| ⚫ |
* C.A. Fleckenstein; H. Plenio, Aqueous cross-coupling. Highly efficient Suzuki-Miyaura coupling of N-heteroaryl halides and N-heteroarylboronic acids. ''Green Chemistry'' '''2007''', ''9'', 1287-1291. |
|
|
|
|
|
|
== External links == |
|
== External links == |
|
* |
|
* from ] |
|
* |
|
* from ] |
|
|
|
|
|
{{DEFAULTSORT:Catacxium F Sulf}} |
|
{{DEFAULTSORT:Catacxium F Sulf}} |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
] |
|