Misplaced Pages

Catalpic acid: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 12:33, 30 November 2010 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:Wi← Previous edit Latest revision as of 23:02, 29 April 2024 edit undo109.241.162.167 (talk) 9E 
(20 intermediate revisions by 16 users not shown)
Line 1: Line 1:
{{chembox {{chembox
| Watchedfields = changed
| verifiedrevid = 399710304 | verifiedrevid = 399711522
| ImageFile = Catalpic acid.png | ImageFile = Catalpic acid Structural Formula V2.svg
| ImageSize = | ImageSize =
| IUPACName = (9''E'',11''E'',13''Z'')-octadeca-9,11,13-trienoic acid | PIN = (9''E'',11''E'',13''Z'')-Octadeca-9,11,13-trienoic acid
| OtherNames = | OtherNames =
| Section1 = {{Chembox Identifiers |Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4532629 | ChemSpiderID = 4532629
| InChI = 1/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h5-10H,2-4,11-17H2,1H3,(H,19,20)/b6-5-,8-7+,10-9+ | InChI = 1/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h5-10H,2-4,11-17H2,1H3,(H,19,20)/b6-5-,8-7+,10-9+
| InChIKey = CUXYLFPMQMFGPL-WJTNUVGIBJ | InChIKey = CUXYLFPMQMFGPL-WJTNUVGIBJ
| SMILES1 = O=C(O)CCCCCCC\C=C\C=C\C=C/CCCC
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h5-10H,2-4,11-17H2,1H3,(H,19,20)/b6-5-,8-7+,10-9+ | StdInChI = 1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h5-10H,2-4,11-17H2,1H3,(H,19,20)/b6-5-,8-7+,10-9+
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = CUXYLFPMQMFGPL-WJTNUVGISA-N | StdInChIKey = CUXYLFPMQMFGPL-WJTNUVGISA-N
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 4337-71-7 | CASNo = 4337-71-7
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 27D2CW7K2P
| PubChem = 5385589 | PubChem = 5385589
| SMILES = O=C(O)CCCCCCC/C=C\C=C\C=C/CCCC | SMILES = O=C(O)CCCCCCC\C=C\C=C\C=C/CCCC
}} }}
| Section2 = {{Chembox Properties |Section2={{Chembox Properties
| Formula = C<sub>18</sub>H<sub>30</sub>O<sub>2</sub> | Formula = C<sub>18</sub>H<sub>30</sub>O<sub>2</sub>
| MolarMass = 302.45 g/mol | MolarMass = 278.44 g/mol
| Appearance = 278.43 | Appearance =
| Density = | Density =
| MeltingPtC = 44 | MeltingPtC = 32
| BoilingPt = | BoilingPt =
| Solubility = }} | Solubility = }}
| Section3 = {{Chembox Hazards |Section3={{Chembox Hazards
| MainHazards = | MainHazards =
| FlashPt = | FlashPt =
| Autoignition = }} | AutoignitionPt = }}
}} }}


'''Catalpic acid''' is a conjugated polyunsaturated fatty acid. The melting point of this fatty acid is 32 °C. Catalpic acid occurs naturally in the seeds of '']'' and ] (''Catalpa bignonoides''). Seeds of ''Catalpa'' species contain about 40% catalpic acid.<ref>Gunstone, F.D et al. (2007). The Lipid Handbook with CD-ROM, Boca Raton: CRC Press. ISBN 0-8493-9688-3{{Page needed|date=September 2010}}</ref> '''Catalpic acid''' is a ]. The melting point of this fatty acid is 32&nbsp;°C. Catalpic acid occurs naturally in the seeds of ] (''Catalpa ovata'') and ] (''Catalpa bignonioides''). Seeds of ''Catalpa'' species contain about 40% catalpic acid.<ref>Gunstone, F.D. et al. (2007). The Lipid Handbook with CD-ROM, Boca Raton: CRC Press. {{ISBN|0-8493-9688-3}}{{Page needed|date=September 2010}}</ref>


==References== ==References==
Line 40: Line 43:
{{DEFAULTSORT:Catalpic Acid}} {{DEFAULTSORT:Catalpic Acid}}
] ]
]
]