Revision as of 05:36, 30 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChEMBL_Ref', 'ChEBI_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:WikiProject_Pharmacology|erro← Previous edit |
Latest revision as of 16:13, 21 November 2023 edit undoInternetArchiveBot (talk | contribs)Bots, Pending changes reviewers5,382,321 edits Rescuing 1 sources and tagging 0 as dead.) #IABot (v2.0.9.5 |
(25 intermediate revisions by 21 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Unreferenced stub|auto=yes|date=December 2009}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 443508901 |
|
| verifiedrevid = 447440132 |
|
| IUPAC_name = (6''R'',7''R'')-3-(acetyloxymethyl)-7--<br>8-oxo-5-thia-1-azabicyclooct-2-ene-2-<br>carboxylic acid |
|
| IUPAC_name = (6''R'',7''R'')-3-(acetyloxymethyl)-7--<br>8-oxo-5-thia-1-azabicyclooct-2-ene-2-<br>carboxylic acid |
|
| image = Cefacetrile.svg |
|
| image = Cefacetrile.svg |
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = Celospor, Celtol, Cristacef |
|
| Drugs.com = {{drugs.com|international|cefacetrile}} |
|
| Drugs.com = {{drugs.com|international|cefacetrile}} |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S8 --> |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S8 --> |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = Rx-only |
|
| routes_of_administration = ], ] |
|
| routes_of_administration = ], ], intra] |
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = 23 to 38% |
|
| protein_bound = 23 to 38% |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = 1.2 hours |
|
| elimination_half-life = 1.2 hours |
|
| excretion = ] (72%) |
|
| excretion = ] (72%) |
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 10206-21-0 |
|
| CAS_number = 10206-21-0 |
|
| ATC_prefix = J01 |
|
| ATC_prefix = J01 |
|
| ATC_suffix = DB10 |
|
| ATC_suffix = DB10 |
|
| ATC_supplemental = {{ATCvet|J51|DA34}} |
|
| ATC_supplemental = {{ATCvet|J51|DB10}} |
|
| PubChem = 91562 |
|
| PubChem = 91562 |
|
|
| ChEMBL = 2104099 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB01414 |
|
| DrugBank = DB01414 |
Line 40: |
Line 39: |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D07629 |
|
| KEGG = D07629 |
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=13 | H=13 | N=3 | O=6 | S=1 |
|
| C=13 | H=13 | N=3 | O=6 | S=1 |
|
| molecular_weight = 339.325 g/mol |
|
|
| smiles = O=C2N1/C(=C(\CS12NC(=O)CC#N)COC(=O)C)C(=O)O |
|
| smiles = O=C2N1/C(=C(\CS12NC(=O)CC#N)COC(=O)C)C(=O)O |
|
| InChI = 1/C13H13N3O6S/c1-6(17)22-4-7-5-23-12-9(15-8(18)2-3-14)11(19)16(12)10(7)13(20)21/h9,12H,2,4-5H2,1H3,(H,15,18)(H,20,21)/t9-,12-/m1/s1 |
|
|
| InChIKey = RRYMAQUWDLIUPV-BXKDBHETBM |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C13H13N3O6S/c1-6(17)22-4-7-5-23-12-9(15-8(18)2-3-14)11(19)16(12)10(7)13(20)21/h9,12H,2,4-5H2,1H3,(H,15,18)(H,20,21)/t9-,12-/m1/s1 |
|
| StdInChI = 1S/C13H13N3O6S/c1-6(17)22-4-7-5-23-12-9(15-8(18)2-3-14)11(19)16(12)10(7)13(20)21/h9,12H,2,4-5H2,1H3,(H,15,18)(H,20,21)/t9-,12-/m1/s1 |
Line 52: |
Line 47: |
|
| StdInChIKey = RRYMAQUWDLIUPV-BXKDBHETSA-N |
|
| StdInChIKey = RRYMAQUWDLIUPV-BXKDBHETSA-N |
|
}} |
|
}} |
|
'''Cefacetrile''' (], also spelled cephacetrile) is a ] first generation ] ] effective in ] and ] bacterial infections. It is a ] antibiotic. Cefacetrile is marketed under the trade names '''Celospor''', '''Celtol''', and '''Cristacef'''. |
|
'''Cefacetrile''' (], also spelled cephacetrile) is a ] first generation ] ] effective in ] and ] bacterial infections. It is a ] antibiotic.<ref>{{cite web|url=http://www.emea.europa.eu/docs/en_GB/document_library/Maximum_Residue_Limits_-_Report/2009/11/WC500011465.pdf|publisher=], Committee for Veterinary Medicinal Products|title=Cefacetrile Summary Report|year=1998|access-date=2012-01-25|archive-date=2020-05-26|archive-url=https://web.archive.org/web/20200526024746/https://www.ema.europa.eu/en/documents/mrl-report/cefacetrile-summary-report-1-committee-veterinary-medicinal-products_en.pdf|url-status=dead}}</ref><ref name="AC">{{cite book |title= Austria-Codex | veditors = Haberfeld H |publisher=Österreichischer Apothekerverlag |location=Vienna |year=2007 |edition=2007/2008 |isbn=978-3-85200-183-8 |language=German}}</ref> Cefacetrile is marketed under the trade names '''Celospor''', '''Celtol''', and '''Cristacef''',<ref>{{cite journal | vauthors = Horiuchi N, Oyakawa Y, Oka R, Fujiwara T | title = | journal = The Japanese Journal of Antibiotics | volume = 33 | issue = 10 | pages = 1145–55 | date = October 1980 | pmid = 7206219 }}</ref> and as '''Vetimast''' for the treatment of ] infections in lactating cows.<ref name="AC" /> |
|
|
==Synthesis== |
|
|
]).]] |
|
|
It was made by reacting ] (7-aminocephalosporanic acid) with cyanoacetyl chloride in the presence of ].{{cn|date=March 2023}} |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
{{CephalosporinAntiBiotics}} |
|
{{CephalosporinAntiBiotics}} |
Line 58: |
Line 59: |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
|
] |
|
|
|
|
|
{{Antibiotic-stub}} |
|
{{Antibiotic-stub}} |
|
|
|
|
] |
|