| Revision as of 00:52, 25 November 2011 editThe chemistds (talk | contribs)Extended confirmed users5,761 edits added CSID, (Std)InChI & (Std)InChIKey← Previous edit |
Latest revision as of 07:51, 1 October 2023 edit undoVaccinationist (talk | contribs)Extended confirmed users4,731 editsm stereochemistryTag: 2017 wikitext editor |
| (11 intermediate revisions by 7 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 462338588 |
|
⚫ |
| ImageFile=Cefoselis.png |
|
⚫ |
| ImageSize=200px |
|
⚫ |
| IUPACName=(6''R'',7''R'')-3-<nowiki>methyl]-7-<nowiki>amino]-8-oxo-5-thia-1-azabicyclooct-2-ene-2-carboxylate |
|
⚫ |
| OtherNames=Wincef |
|
⚫ |
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
⚫ |
| CASNo=122841-10-5 |
|
⚫ |
| PubChem= 5748845 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 2105940 |
|
⚫ |
| SMILES=CO/N=C(\C1=CSC(=N1)N)/C(=O)N23N(C2=O)C(=C(CS3)C4=CC=C(N4CCO)N)C(=O) |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 16736411 |
|
⚫ |
| InChI = 1/C19H22N8O6S2/c1-33-24-12(10-8-35-19(21)22-10)15(29)23-13-16(30)27-14(18(31)32)9(7-34-17(13)27)6-25-3-2-11(20)26(25)4-5-28/h2-3,8,13,17,20,28H,4-7H2,1H3,(H4,21,22,23,29,31,32)/b24-12-/t13-,17-/m1/s1 |
|
⚫ |
| InChIKey = BHXLLRXDAYEMPP-SBGRAJFYBO |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChI = 1S/C19H22N8O6S2/c1-33-24-12(10-8-35-19(21)22-10)15(29)23-13-16(30)27-14(18(31)32)9(7-34-17(13)27)6-25-3-2-11(20)26(25)4-5-28/h2-3,8,13,17,20,28H,4-7H2,1H3,(H4,21,22,23,29,31,32)/b24-12-/t13-,17-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = BHXLLRXDAYEMPP-SBGRAJFYSA-N |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 0B50MLU3H1 |
|
| UNII = 0B50MLU3H1 |
| ⚫ |
| verifiedrevid = 437132151 |
|
| ⚫ |
|ImageFile=Cefoselis.png |
|
| ⚫ |
|ImageSize=200px |
|
| ⚫ |
|IUPACName=(6''R'',7''R'')-3-<nowiki>methyl]-7-<nowiki>amino]-8-oxo-5-thia-1-azabicyclooct-2-ene-2-carboxylate |
|
|
|IUPACName_hidden=yes |
|
| ⚫ |
|OtherNames=Wincef |
|
| ⚫ |
|Section1={{Chembox Identifiers |
|
| ⚫ |
| CASNo=122841-10-5 |
|
| ⚫ |
| PubChem=9589475 |
|
| ⚫ |
| SMILES=CO/N=C(\C1=CSC(=N1)N)/C(=O)N23N(C2=O)C(=C(CS3)C4=CC=C(N4CCO)N)C(=O) |
|
| ⚫ |
| ChemSpiderID = 16736411 |
|
| ⚫ |
| InChI = 1/C19H22N8O6S2/c1-33-24-12(10-8-35-19(21)22-10)15(29)23-13-16(30)27-14(18(31)32)9(7-34-17(13)27)6-25-3-2-11(20)26(25)4-5-28/h2-3,8,13,17,20,28H,4-7H2,1H3,(H4,21,22,23,29,31,32)/b24-12-/t13-,17-/m1/s1 |
|
| ⚫ |
| InChIKey = BHXLLRXDAYEMPP-SBGRAJFYBO |
|
| ⚫ |
| StdInChI = 1S/C19H22N8O6S2/c1-33-24-12(10-8-35-19(21)22-10)15(29)23-13-16(30)27-14(18(31)32)9(7-34-17(13)27)6-25-3-2-11(20)26(25)4-5-28/h2-3,8,13,17,20,28H,4-7H2,1H3,(H4,21,22,23,29,31,32)/b24-12-/t13-,17-/m1/s1 |
|
| ⚫ |
| StdInChIKey = BHXLLRXDAYEMPP-SBGRAJFYSA-N |
|
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=19|H=22|N=8|O=6|S=2 |
|
| C=19 | H=22 | N=8 | O=6 | S=2 |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
|
'''Cefoselis''' is a fourth generation ]. It is used extensively in Japan and China in the clinical treatment of various gram positive and gram negative infections. A 2014 study illustrated that Cefoselis is effective at treating respiratory and urinary tract infections.<ref>{{Cite web |date=2014-07-10 |title=Multicenter, double-blind, randomized clinical trial of parenterally administered Cefoselis versus Cefepime for the treatment of acute bacterial infections |url=https://www.europeanreview.org/article/7597 |access-date=2022-08-03 |website=European Review |language=en}}</ref> |
|
'''Cefoselis''' is a ]. |
|
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
{{Cell wall disruptive antibiotics}} |
|
{{Cell wall disruptive antibiotics}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{antibiotic-stub}} |
|
{{antibiotic-stub}} |