| Revision as of 01:23, 9 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation← Previous edit |
Latest revision as of 05:23, 17 September 2023 edit undoDMacks (talk | contribs)Edit filter managers, Autopatrolled, Administrators186,052 editsm Reverted edits by Tacos de pastor (talk) to last version by TacyargTag: Rollback |
| (24 intermediate revisions by 20 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 443787193 |
|
⚫ |
| IUPAC_name = (6''R'',7''R'')-7-<nowiki>amino]-3-(imidazopyridazin- 4-ium-1-ylmethyl)-8-oxo-5-thia-1-azabicyclo oct-2-ene-2-carboxylate |
|
⚫ |
| image = Cefozopran.svg |
|
⚫ |
| width = 280 |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
|
| Drugs.com = {{drugs.com|international|cefozopran}} |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 113359-04-9 |
|
⚫ |
| ATC_prefix = J01 |
|
⚫ |
| ATC_suffix = DE03 |
|
⚫ |
| ATC_supplemental = |
|
⚫ |
| PubChem = 9571080 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 1276663 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 1LG87K28LW |
|
| UNII = 1LG87K28LW |
| ⚫ |
| verifiedrevid = 443306034 |
|
| ⚫ |
| IUPAC_name = (6''R'',7''R'')-7-<nowiki>amino]-3-(imidazopyridazin- 4-ium-1-ylmethyl)-8-oxo-5-thia-1-azabicyclo oct-2-ene-2-carboxylate |
|
| ⚫ |
| image = Cefozopran.svg |
|
| ⚫ |
| width = 280 |
|
| ⚫ |
| CAS_number = 113359-04-9 |
|
|
| CAS_supplemental = |
|
| ⚫ |
| ATC_prefix = J01 |
|
| ⚫ |
| ATC_suffix = DE03 |
|
| ⚫ |
| ATC_supplemental = |
|
| ⚫ |
| PubChem = 9571080 |
|
| ⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| ⚫ |
| DrugBank = |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D01052 |
|
| KEGG = D01052 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
| chemical_formula = |
|
|
|
| ChemSpiderID = 7845546 |
| ⚫ |
| C=19 | H=17 | N=9 | O=5 | S=2 |
|
|
|
| smiles = O=C2N1/C(=C(\CS12NC(=O)C(=N\OC)/c3nc(sn3)N)Cn5c4cccn4cc5)C()=O |
|
| molecular_weight = 515.52 g/mol |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| bioavailability = |
|
|
|
| StdInChI = 1S/C19H17N9O5S2/c1-33-24-11(14-23-19(20)35-25-14)15(29)22-12-16(30)28-13(18(31)32)9(8-34-17(12)28)7-26-5-6-27-10(26)3-2-4-21-27/h2-6,12,17H,7-8H2,1H3,(H3-,20,22,23,25,29,31,32)/b24-11-/t12-,17-/m1/s1 |
| ⚫ |
| protein_bound = |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| metabolism = |
|
|
|
| StdInChIKey = QDUIJCOKQCCXQY-WHJQOFBOSA-N |
| ⚫ |
| elimination_half-life = |
|
|
|
|
| ⚫ |
| excretion = |
|
|
|
<!--Chemical data--> |
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
⚫ |
| chemical_formula = |
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
⚫ |
| C=19 | H=17 | N=9 | O=5 | S=2 |
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| ⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
'''Cefozopran''' (]) is a fourth-generation ]. |
|
'''Cefozopran''' (]) is a fourth-generation ].<ref>{{cite book | vauthors = Chang XM | chapter = Chapter 34: Market to Market | veditors = Bristol JA | date = December 1996 | title = Annual Reports in Medicinal Chemistry | volume = 31 | page = 339 | chapter-url = https://books.google.com/books?id=zlYa3l7Rg7AC&q=Cefozopran&pg=PA339 |publisher=Academic Press |location=San Diego, Calif. | isbn = 978-0-08-058375-4 }}</ref> |
|
|
|
|
|
|
==Spectrum of bacterial susceptibility and resistance== |
| ⚫ |
{{CephalosporinAntiBiotics}} |
|
|
|
Most of the strains of '' ]'' have developed resistance toward cefozopran.<ref>{{cite web|title=Cefozopran Susceptibility and Resistance Data|url=http://www.toku-e.com/Assets/MIC/Cefozopran%20hydrochloride.pdf|access-date=23 July 2013}}</ref> |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
⚫ |
{{CephalosporinAntiBiotics|state=collapsed}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{antibiotic-stub}} |
|
{{antibiotic-stub}} |