| Revision as of 16:02, 11 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chembox validati← Previous edit |
Latest revision as of 12:51, 5 August 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,126 edits removed Category:Piperazines using HotCat |
| (16 intermediate revisions by 16 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{Drugbox |
|
⚫ |
| verifiedrevid = 444283882 |
|
⚫ |
| IUPAC_name = (6''R'',7''R'')-7-(amino)-3-sulfanyl)ethenyl]-8-oxo-5-thia-1-azabicyclooct-2-ene-2-carboxylic acid |
|
⚫ |
| image = Ceftiolene.svg |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 77360-52-2 |
|
⚫ |
| ATC_prefix = none |
|
|
| ATC_suffix = |
|
⚫ |
| ATC_supplemental = |
|
⚫ |
| PubChem = 6537430 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
|
| ChEBI = 140116 |
|
|
| ChEMBL = 2106102 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 28TV2P33KF |
|
| UNII = 28TV2P33KF |
|
|
| ChemSpiderID = 5020599 |
| ⚫ |
| verifiedrevid = 437135636 |
|
|
|
| StdInChI = 1S/C20H18N8O8S3/c1-36-26-10(9-7-39-19(21)22-9)13(30)23-11-15(32)28-12(18(34)35)8(6-38-17(11)28)2-5-37-20-25-24-14(31)16(33)27(20)3-4-29/h2,4-5,7,11,17H,3,6H2,1H3,(H2,21,22)(H,23,30)(H,24,31)(H,34,35)/b5-2+,26-10-/t11-,17-/m1/s1 |
| ⚫ |
| IUPAC_name = (6R,7R)-7-(amino)-3-sulfanyl)ethenyl]-8-oxo-5-thia-1-azabicyclooct-2-ene-2-carboxylic acid |
|
|
|
| StdInChIKey = WJXAHFZIHLTPFR-JLRJEBFFSA-N |
| ⚫ |
| image = Ceftiolene.png |
|
|
|
|
| ⚫ |
| CAS_number = 77360-52-2 |
|
|
|
<!--Chemical data--> |
|
| CAS_supplemental = |
|
|
⚫ |
| chemical_formula = |
| ⚫ |
| ATC_prefix = none |
|
|
| ATC_suffix = |
|
| C=20 | H=18 | N=8 | O=8 | S=3 |
|
⚫ |
| smiles = CON=C(C1=CSC(=N1)N)C(=O)NC2C3N(C2=O)C(=C(CS3)C=CSC4=NNC(=O)C(=O)N4CC=O)C(=O)O |
| ⚫ |
| ATC_supplemental = |
|
| ⚫ |
| PubChem = 6537430 |
|
| ⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| ⚫ |
| DrugBank = |
|
| ⚫ |
| chemical_formula = |
|
|
| C=20 | H=18 | N=8 | O=8 | S=3 |
|
|
| molecular_weight = 594.60 g/mol |
|
| ⚫ |
| smiles = CON=C(C1=CSC(=N1)N)C(=O)NC2C3N(C2=O)C(=C(CS3)C=CSC4=NNC(=O)C(=O)N4CC=O)C(=O)O |
|
| ⚫ |
| bioavailability = |
|
| ⚫ |
| protein_bound = |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| ⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
'''Ceftiolene''' (]) is a third-generation ] antibiotic. |
|
'''Ceftiolene''' (]) is a third-generation ] antibiotic.<ref>{{cite journal | vauthors = Williamson R, Gutmann L, Kitzis MD, Acar JF | title = An evaluation of the bacteriolytic and biochemical properties of ceftiolene (42980RP) | journal = The Journal of Antimicrobial Chemotherapy | volume = 14 | issue = 6 | pages = 581–93 | date = December 1984 | pmid = 6394571 | doi = 10.1093/jac/14.6.581 }}</ref> |
|
|
|
|
|
|
== References == |
| ⚫ |
{{antibiotic-stub}} |
|
|
|
{{reflist}} |
|
|
|
|
|
{{CephalosporinAntiBiotics}} |
|
{{CephalosporinAntiBiotics}} |
| Line 41: |
Line 55: |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
⚫ |
{{antibiotic-stub}} |
|
] |
|